3.49b2 SH + Your answer is incorrect. OH Predict which side of the reaction is favored under equilibrium conditions, and explain your choice. ○ The reactants are favored, because the negative charge on the large sulfur atom is more stable (making it the stronger base). ○ The reactants are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the stronger base). The products are favored, because the negative charge on the large sulfur atom is more stable (making it the weaker base). ○ The products are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the weaker base).

3.49b2 SH + Your answer is incorrect. OH Predict which side of the reaction is favored under equilibrium conditions, and explain your choice. ○ The reactants are favored, because the negative charge on the large sulfur atom is more stable (making it the stronger base). ○ The reactants are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the stronger base). The products are favored, because the negative charge on the large sulfur atom is more stable (making it the weaker base). ○ The products are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the weaker base).

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter4: Acids And Bases

Section: Chapter Questions

Problem 4.33P: Complete the equation for the reaction between each Lewis acid-base pair. In each equation, label...

See similar textbooks

Similar questions

Complete the equation for the reaction between each Lewis acid-base pair. In each equation, label which starting material is the Lewis acid and which is the Lewis base; use curved arrows to show the flow of electrons in each reaction. In doing this problem, it is essential that you show valence electrons for all atoms participating in each reaction. (a) (b) (c) (d)
For each molecule below, draw the conjugate acid or conjugate base or both if the molecule hasboth a conjugate acid and a conjugate base (e.g., water).
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Predict the position of equilibrium for this acid-base reaction.
In equilibrium, label the stronger acid, the stronger base, the weaker acid, and the weaker base. Also estimate the position of equilibrium.
Which of the following anions is the stronger base? Explain your choice.
OH- + CH3COOH ==== CH3COO- + H2O . Which of the products is a conjugate base?
H2SO4 + NH3 ==== HSO4- + NH4+ . Which of the products is a conjugate base?
Can somone explain what I'm looking at on a molecule that will determine how strong/weak of a base it is?
Draw the conjugate base and rank the compounds in order of increasing acidity. Explain the reason briefly
Predict the position of the equilibrium for the reaction and provide a brief explanation. (The acidic protons are shown in red.) A B Forward direction is favored because oxygen is more electronegative, making B the weaker base and D the stronger acid. O Reverse direction is favored because oxygen is more electronegative, making B the weaker base and D the stronger acid. O Forward direction is favored because sulfur is larger, making C the weaker base and A the stronger acid. Reverse direction is favored because sulfur is larger, making C the weaker base and A the stronger acid.
134. Subject :- Chemistry