Answered: Give the systematic name for the…

Science

Chemistry

Give the systematic name for the following coordination compound or complex ion: H3 NIIII.. NC Pt...CN NH3

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 94CWP: Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an...

See similar textbooks

Related questions

Q: Draw the product of this reaction. Ignore inorganic byproducts. H H ⚫OH HO ⚫H I H ⚫OH H ⚫OH CH2OH…

A: Step 1: Step 2: Step 3: Step 4:

Q: Please don't provide handwritten solution.

Q: 0.071- 13.9 14.0 20.3 33.2 T Kelvin (a) What is the normal melting point? K The normal boiling…

A: Step 1: Defining phase diagram Phase diagram given us the interpretation of different physical…

Q: None

Q: In the following FTIR Spectrum, what functional group can you recognize?

A: Step 1:Given Infrared spectrum of an unknown molecule. Determine the functional group present in the…

Q: None

A: Convert electron mass to kilograms: The mass is given in grams, but we need it in kilograms for the…

Q: Using the retrosynthetic analysis propose a logical route for the following transformation. Draw all…

A: In the given question, the starting reactant is given i.e. ethylidenecyclohexane and the final…

Q: 198 Au is used in the diagnosis of liver problems. The half-life of isotope, what mass (in μg)…

Q: Organic Chemistry problem. Please help solve. Provide reasonable product structure for reaction…

A: This reaction is cyanohydrin formation.In this reaction, the cyano adds to the ketone also forming…

Q: Dec X Typ x Typ x Typ x Rea x y! x lỵ HỌ X y Na X BL SCL SCH3U-02 939218…

A: 1)The average atomic mass for lithium, considering the isotopic abundances and masses, can be…

Q: For a second order reaction which of the following statements is TRUE? Decreasing the initial…

A: Consider a geneal reaction of second order2A → P1) The intial rate is given asRate = K[A]2(It means…

Q: Question 3 Give the most appropriate major product(s): CHO HTOH CH₂OH OH OH | ОН CH₂OH OCH OCH3 IV…

A: Step 1: Step 2: Step 3: Step 4:

Q: Look at the titration curve below and determine what acid from the list could be the acid being…

A: Step 1: Determine the volume at the equivalence point. From the given titration curve the volume at…

Q: The peaks in a UV-Visible spectrum are associated with which molecular changes? electronic state…

A: In a UV-Visible spectrum, the peaks are associated with electronic state changes within molecules.…

Q: Determine the electron geometry, molecular geometry, and idealized bond angles for each molecule. In…

A: Molecular geometry refers to the 3D arrangement (spatial arrangement) of atoms in a molecule…

Q: how would you answer part III of this question? This is a non-graded practice FRQ.

A: Structure 1 gives phosphorus a positive charge, which is not ideal since it would prefer to have…

Q: As the lead product manager at OrganometALEKS Industries, you are trying to decide if the following…

A: Step 1: Step 2: Step 3: Step 4:

Q: Supply the missing isotope in the nuclear equation below. When entering isotopes, use the text…

Q: 3.15 mol of an unknown solid is placed into enough water to make 150.0 mL of solution. The…

A: Given: molunk=3.15mol;V=150.0mL;d=1.20g/mL;ΔT=12.41°C;C=4.18J/g°CStep 1: Write the equations we will…

Q: 15 1/1 point Which of the following reactions has a positive AS? Select all correct answers. Na(s) +…

A: A ( g ) + B ( g ) → 3 C ( g ) : There are 3 moles of products and 2 moles of reactants, so this…

Q: Major organic product predict

Q: Show work, thank you!

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: A major component of gasoline is octane C8H18 . When octane is burned in air, it chemically…

A: We know Molar mass of octane = 114.23 g /molOxygen gas consumed = 9.92 gMolar mass of oxygen =…

Q: Predict the missing product of this organic reaction please:

A: Step 1: Step 2:Mechanism Step 3: Step 4:

Q: Question 8

A: Step 1: Step 2: Step 3:

Q: Question 7 Propose a chemical structure for the name below. Make sure to clearly define the…

Q: None

A: Step 1:Assign priority to the two substituents attached to each carbon atom of the double bond. Use…

Q: By what processes do these transformations most likely occur? (a) 243 Es to 243 Cf alpha decay beta…

Q: Please give a detailed stepwise mechanism for the following reactions. All arrows, charges, and…

A: Step 1: example is adol convention

Q: In the following FTIR Spectrum, what functional group can you recognize?

A: In the IR spectrum there are two regions.The region which has wavenumber < 1500 cm-1 is called…

Q: Draw the most stable chair conformation of each of the following compounds. (a)cis-1,1,4 -…

A: Step 1: Step 2: Step 3: Step 4:

Q: Provide the major products, including steps

A: Step 1: Step 2: Step 3: Step 4:

Q: 1) Et2O 2) H₂O MgBr

Q: Draw a Haworth projection of a common cyclic form of this monosaccharide:

A: The sugar in open chain form is a 5-carbon aldose (aldopentose) known as D-Arabinose.It is…

Q: None

A: Step 1: Given that Mass = 79g Volume = 47 cm3 Density can be calculated as Density = Mass/Volume…

Q: What would the potential of a standard hydrogen electrode (S.H.E.) be under the following…

A: Here's how to find the potential of the SHE under these conditions:Standard Hydrogen Electrode…

Q: None

A: The solution containing 50 g of KCl in 100 g water at 70 °C is most likely supersaturated (C).Here's…

Q: Write the systematic name of each organic molecule: structure CH3 CI- CH-CH2- CH=CH2 CH2 CI C-CH2- -…

A: Thank you.

Q: The chart shows the names of the different bands of the electromagnetic spectrum. Which of the bands…

A: Step 1:From the spectrum, The wavelength of radiowaves are of the order of, 1The wavelength of…

Q: b. What is a Calorimeter used for?

A: Defination A calorimeter is used to measure the heat released or absorbed during a chemical reaction…

Q: When dissolved in water, which of the following salts would be acidic? OA) CrBr3 B) NH41 OC)…

A: CrBr3 is acidic when dissolve in water. HBr + Cr(OH)3 —-> CrBr3 + H2O CrBr3 undergo hydrolysis…

Q: Outline the steps you would take to conduct a thorough risk assessment of chemical hazards in the…

A: Analyzing the approach to conducting a thorough risk assessment of chemical hazards in the workplace…

Q: Rimantadine is an antiviral drug used to treat people infected with life-threatening influenza…

Q: Plz explain, no handwritten answer

A: Step 1:To solve this problem, we can use Henry's Law, which states that the amount of gas dissolved…

Q: QUESTION 1-DATA ANALYSIS a. Obtain a table expressing concentrations in mg/L and micromole/L ( b.…

A: The question asks you to analyze the data from a potentiometric titration. The data shows the…

Q: Here is the liquid water is 4.18 J/g °C. What is the amount of heat energy that is associated with…

Q: Use acetylene as a starting material and design a synthesis for pentanal

A: Step 1: Step 2: Step 3: Step 4:

Q: Decide whether each of the molecules in the table below is stable, in the exact form in which it is…

A: For the last two compounds, they are enol forms of their ketones. But at lower pH the keto form…

Q: How am I able to solve this problem? I would really appreciate any help :)

Q: 9. Draw the following chemical reactions. a) cyclopentylamine + water b) cyclopentylamine + butanoic…

A: Step 1: Step 2: Step 3: Step 4:

Question

Give the systematic name for the following coordination compound or
complex ion:
H3 NIIII..
NC
Pt...CN
NH3

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
Vitamin B12 is a coordination compound with cobalt as its central atom. It contains 4.4% cobalt by mass and has a molar mass of 1.3103 g/mol. How many cobalt atoms are in a molecule of vitamin B12?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
The complex ion PdCl42is diamagnetic. Propose a structure for PdCl42.
How many geometric isomers are possible for the square-planar complex ion [Pt(NH3)(CN)Cl2)?