Q: Tamoxifen Product
A:
Q: Balance the following reaction equation: Fe+ 02 → Fe2O3
A: The unbalanced chemical equation given is: Fe + O2 → Fe2O3.
Q: Please correct answer and don't use hand rating
A: Approach to solving the question:This is a simple alkyl halide formation reaction, in which we…
Q: Convert the following numbers into the standard form of scientific notation189x10^-3
A: Scientific notation is a way of expressing numbers that are too large or too small to be…
Q: 22
A: The reaction in question is a Friedel-Crafts chlorination reaction. In this type of reaction, a…
Q: 2 Draw the major organic product for the reaction. Draw the major organic product for the reaction.…
A:
Q: Don't use AI
A: Given, S = 1.45×10−4 The solubility of ZnC₂O₄ at pH 4.00 is 1.45×10−4 M
Q: Question 19
A: The order of a reaction is a term used in chemistry to describe the relationship between the rate of…
Q: 1. Calculate the theoretical amount (in mL) of CH3CH2CH2CH2CN (valeronitrile) needed to make 2.50…
A: Step 1:The reaction between valeronitrile and water under acidic or basic conditions can yield…
Q: Don't use AI.
A: Given:…
Q: The reaction C4H8 (g) → 2C₂H (9) has rate constant 9.23 × 10¯³ -1 S at 773 K and rate constant…
A: The given values are:Rate constant at 773 K (k1) = 9.23 × 10^-3 s^-1Rate constant at 855 K (k2) =…
Q: Calculate the maximum % recovery possible if the solubility at room temperature is 1g/451 mL and at…
A: Step 1:Given data,Solubility at room temperature = 1g/451 mLSolubility at boiling temperature of the…
Q: Is EtOH a strong or weak base? Explain with reasoning.
A: EtOH, also known as ethanol, is a type of alcohol. Its chemical formula is C2H5OH. It consists of a…
Q: What is the pH of 0.010 M HCl (aq) using activity coefficients?
A: Step 1: Write the dissociation equation:HCl is a strong acid and dissociates completely in…
Q: Predict the Major product(s) for the following reactions. Show the correct stereochemistry when…
A: The reactants in this reaction are (CH3)2NNa (sodium dimethylamide) and a brominated phenyl (Ph)…
Q: chem
A: Step 1: Bond line structuresBond line structures show carbon atoms at the corners and ends of lines.…
Q: Results A1+B in 10 degree: Trial 1: it took 200.4 seconds to turn from clear to purple, trail 2: was…
A: Step 1:Step 2: Step 3: Step 4:
Q: 1. BH3-THF 2. H2O2, NaOH Select to Draw Mg + Br Select to Draw Q 1. ether 2. H3O+ Please sele
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Please correct answer and don't use hand rating
A: The reaction shown is a nucleophilic addition of an amine (NH2) group to a carbonyl (C=O) group.In…
Q: Window Help 0 achieve.macmillanlearning.com ning © Macmillan Learning Glyceraldehyde is an aldose…
A:
Q: A leading antacid is 60% CaCO3 . How does CaCO3 contribute to antacid properties? Use chemical…
A: Step 1:Hydrochloric acid (HCl) is the main component of stomach acid. A neutralizing reaction…
Q: a. Explain what someone can learn about from the experiment of Le Chatelier’s Principle? b. What…
A: Approach to solving the question:All the explanation given above. Please go through this.Detailed…
Q: Match each octahedral complex transition metal center with its correct Ligand Field Stabilization…
A: Step 1: Step 2: Step 3: Step 4:
Q: What volume of 0.25M lithium fluoride solution can be made by dissolving 5.0 g lithium fluoride,…
A: The molar mass of a compound is calculated by adding up the atomic masses of each element in the…
Q: qu7 I cannot understand why the directions have been changed Why does a is a Sn2 even thought it…
A:
Q: Consider the titration of 39 mL of 0.5 M base with 0.3 M HCI. The analyte is dibasic with pKb1 = 4.7…
A: To find the pH of the solution after adding 65 mL of 0.3 M HCl to 39 mL of 0.5 M dibasic base, we…
Q: None
A: Step 1: To convert 1-butanol to 2-bromobut-2-ene, the process typically involves several steps:Step…
Q: YouTube Maps + Question 6 of 15 appropriate equilibrium equation for the acid or base that exists…
A: Step 1: Write the ionization of the salt.(CH3)NH2ClO4(aq)→(CH3)2NH2(aq)++ClO4(aq)− Step 2:…
Q: Don't use AI.
A:
Q: You have 162.0 g of solute Q dissolved in 150-mL of water. The distribution coefficient between…
A:
Q: The following chromatogram shows the separation of several alcohols. The elution order of these…
A: The question is asking us to identify the type of liquid chromatography used based on the elution…
Q: Balance teh following redox equation using a redox method in basic conditions ClO^- +Cr_2O^- = CrO…
A: First, we need to identify the oxidation and reduction half-reactions. In the given equation, ClO-…
Q: None
A: The molarity of Ag(NO3)=0.600MThe volume of Ag(NO3)=30mLThe number of moles of…
Q: Please help
A: 5.The most efficient way to write and compare the stereoisomers of any given molecule is to write…
Q: (not a graded assignment just aleks practice)
A: Draw the major productCH3-O-CH2-C(CH3)(CH2CH2CH3)2 This molecule is formed by replacing the Cl with…
Q: Please correct answer and don't use hand rating
A: Step 1: Step 2: Step 3: Step 4:
Q: Please correct answer and don't use hand rating
A: Step 1: Step 2: Step 3: Step 4:
Q: Please correct answer and don't use hand raiting
A: Step 1:To keep the temperature from changing, the heat absorbed or released by dissolving one…
Q: Please answer accuratly and dont use AI to get answer like the other person who did this when i…
A:
Q: NaHCO3 is an intermediate form of the diprotic acid carbonic acid H2CO3. What is the pH of 0.100 M…
A: The problem involves determining the pH of a 0.100 M solution of sodium bicarbonate (NaHCO₃). Sodium…
Q: Please correct answer and don't used hand raiting
A: Step 1: Redox ReactionReaction in which oxidation and reduction occur simultaneously is known as…
Q: 4. Air in a piston/cylinder assembly at 200 kPa and 500 K is expanded in a constant-pressure process…
A:
Q: Need experts solution only Don't use AI.
A:
Q: The Ksp of La(OH) 3 is 2.0x10-21 When activities are considered, what is the concentration of La3+…
A: Dear Student,You are asked to find the concentration of La3+ in a saturated solution of La(OH)₃,…
Q: Show work with explanation needed. Don't give Ai generated solution
A: (a)Longest Chain: The main chain has 7 carbons, so the base name is heptene.Double Bond: The double…
Q: Show work with explanation needed. Don't give Ai generated solution
A: Step 1: Lewis structureChemical structure represents the valence electrons present in each atom of…
Q: Give detailed mechanism Solution with explanation needed. don't give Ai generated solution
A: the given reaction is the Diels alder reaction.In Diels alder reaction, diene and dienophile…
Q: Please correct answer and don't use hand rating
A: Step 1:Step 2: Step 3: Step 4:
Q: The reaction described by the equation 2A+B+2C products is first order in A, first order in B, and…
A: The rate law for the reaction 2A + B + 2C --> products is: Rate = k[A][B][C]2The rate of…
Q: I need help drawing the lewis structure for -C2H5
A: Approach to solving the question: Lewis structure: It is a structure that shows the distribution of…
Step by step
Solved in 2 steps with 2 images
- For each molecule below, draw the conjugate acid or conjugate base or both if the molecule hasboth a conjugate acid and a conjugate base (e.g., water).The following are equivalent ways of asking about the acidity of an H atom: • What is the most acidic H on the molecule? • Which H is associated with the published pKa value? • Which H on the molecule is easiest to remove? • Which H on the molecule takes the least energy to remove? • Which bond to an H is most polarized? • For which H atom is removal least uphill in energy? • Which bond to an H atom, when broken, results in the lowest PE conjugate base? We will often find the last of these questions is easiest to answer. To do this, find all the different Hatoms on the molecule, and draw all possible conjugate bases.Only the lowest-energy one is the “real” conjugate base. Identify this structure, and you have found the most acidic H. Use this strategy to find the most acidic H on each of the following molecules. Note: Each structure hasat least three different kinds of H’s, so draw at least three unique conjugate bases for each.Put a 1 under the most basic molecule, a 2 under the second most basic molecule, and a 3 under the least basic molecule in each set of three molecules. Choose a set and give your reasoning for your answer.
- please answer and explainRank the following compounds according to acidity, 1 being the most acidic and 4 being the least acidic. First, list the ranking number followed by the compound letter in order from 1 to 4, and then explain your reasoning in a sentence or two.7) Using the ranking from above, explain using the respective compounds conjugate base to explain the order you chose (remember weak bases come from strong acids, and strong bases come from weak acids): CH3OH, NH3, HF, H₂O, CH4
- 1. c) Indicate the most acidic hydrogen in each of the following molecules. 요 CH3COCH 3 X° (CH₂CH₂)₂NLi O || CH3CNHCH3 CH,CH,ONa 4 d) Arrange the following bases in order of increasing basicity, starting from the weakest base on the left to the strongest base on the right. O (CH3)3CCCH3 (CH3), COK CHỊCH Li (CH₂CH₂),Ndo all with explanation..if u plan to skip one answer then skip do all plz2. a) For each compound show its conjugate base. Lone pairs have been left out but are assumed to be t Show all valence electrons. Show any resonance structures if applicable. b) Rank the conjugate bases in the order you would predict, from most stable to least stable. c) Rank the original compounds in order, from strongest acid to weakest acid. OH Br OH OH OH
- Arrange the fallowing structures according to INCREASING ACIDITY (1-5). Prompts Submitted Answers Choose a match HO. be HO, Choose a match HO, Br Choose a match HO, inAs we will see in later chapters, many steps in key reaction sequences involve acid–base reactions. (a) Draw curved arrows to illustrate the flow of electrons in steps [1]–[3]. (b) Identify the base and its conjugate acid in step [1]. (c) Identify the acid and its conjugate base in step [3].circle the stronger base in the following pairs, and in a sentence explain your choice