The redction Fe-> Fe+ Ce3++ CeIS rapid and reversable cit equilibrium throughoutthe titration, thus electrode poten tials for2 half recctions ae always equal, as is electrodepotential f the indicator usedGIuen Feas anglyte cincl Ce T as the titruntZEeqShow that+ E° ce ce3t%3Dた2t

The reaction is Fe2+ + Ce4+ <------> Fe3+ + Ce3+ This reaction…

3+ The redction Fe + Ce + Ce IS rapid and reversable cit equilibrium throughout the titration, thus electrode potentials for 2 half recctions cie always equal, as is electrode potential f the indicator used GIven Fe 2+ as analyte cinci ce4 CIs the titrunt Show that ZEeq = Efast + E° ce ce3t %3D

3+ The redction Fe + Ce + Ce IS rapid and reversable cit equilibrium throughout the titration, thus electrode potentials for 2 half recctions cie always equal, as is electrode potential f the indicator used GIven Fe 2+ as analyte cinci ce4 CIs the titrunt Show that ZEeq = Efast + E° ce ce3t %3D

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Complete and balance the following redox reaction in basic solution Zn(OH),2- (aq) + As (s) → Zn(s)…

Q: Calculate the Ecel of the following reaction Zno + Ni*²(aq) Zn*2(aq) Ni(s) When Ni*2 = 0.85 M and…

A: [Ni+2] = 0.85 M [Zn+2] = 0.45 M We need to find emf of given cell reaction.

Q: 15 The electromotive force of the cell: Pt | H,(1 atm) | HCI | Hg,CI, | Hg; is 0.686 V at 300 K. The…

Q: The equilibrium constant of a redox reaction can be calculated from the standard reduction…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Calculate AG for the following reaction 2 Fe* (ag) + Brz2(aq) → 2 Fe (ag)+2 Br (aq) HaRction OP + C…

A: For any redox reaction, the relationship between gibbs free energy and electromotive force in…

Q: Which of the following salts would give you the highest concentration of sulfide ions in solution if…

A: The solubility product constant, Ksp, is an equilibrium constant that describes the solubility of a…

Q: (b) Mg(s) | Mg2 (aq, 0.0600 M) || [Al(OH)4] (aq, 0.340 M), OH (aq, 0.0300 M) | Al(s) Ecell Number V…

Q: Determine the potential when 20 mL of 0.15 M Co is reacted with 20 mL of 0.15 M Cr at a pH=3.8. E…

A: To determine the potential when 20 mL of 0.15 M Co3+ is reacted with 20 mL of 0.15 M Cr3+ at pH =…

Q: Q26 (C). (a) Explain the following redox reactions: (i) 3Zn + 2Fe+3 3Zn+2 + 2Fe (ii) 3Cd + 2Cr*6…

Q: E Za a) ) Define the term standard electrode potential 2e 2 ZA Explain

A: Redox reactions are a kind of chemical reaction that involves oxidation and reduction. The element…

Q: inkulate the & and Me BOA FOR A a solution that is 1433 M 2N AND₂ and 116 MIN K NU ₂ K. FOR HNO₂ =…

Q: Given: Fe * (a) t 2e teu). E0:-0.49V fe * E 0.04. (aq) +3e te la). Fe "( aqlte 7 Fe "(aq). Cl2(g) +…

A: We have asked to find out the ∆E° for the following reaction Fe(s) + Cl2 (g) → Fe(aq)2+ +…

Q: Ihe acid ionization constant for Cu(H20)62+(aq) is 1.0x10-7. Calculate the pH of a 0.0410 M solution…

A: Answer:- Determined the pH of a 0.0410 M solution of cu(NO3)2 by using equilibrium expression. Here…

Q: Balance the following equations by REDOX

Q: Balance the following reactions by half reaction method 1) Sn(OH) 4 -2 + MnO 4 -1 =>MnO 2 + Sn(OH) 6…

Q: Balance the following in acidic solution: PbO2+ Hg ⟶Hg22++ Pb2+

A: The oxidation is assigned on each atom involve in redox reaction.

Q: Compute the standard electrode potential for the following half-reaction Ni(CN)42- +2e-→ Ni(s) +…

A: Given: E0= -0.25 V Formation constant of Ni(CN)42- = 1.0 x 1022

Q: Which of the following reactions is /are feasible? NaCl CI NH3 H&C NH2 %3D SOCI, OH H,C HO II H,C CI…

A: The carboxylic acids and their derivatives undergo chemical reaction by nucleophilic acyl…

Q: Fez++ Mn Oq- Fe3tA My2t >Fe3t + Mn2t OXO

A: Step by step solution are below

Q: 8. The standard electrode potentials are: 9°(Sn²*/Sn) = -0.137 5 V, q®(Fe*"/Fe") = 0.771 V, qº…

Q: Standard reduction potential for the reduction of permagnaate in acidic solution is +1.51 V. what is…

A: Reduction is lose of electrons. Oxidation is gaining of electrons. The reactions where oxidation and…

Q: Q12 Balance the following reaction in acidic medium: Cr207 (aq) + Sn²+ → Cr*(aq) + Sn 4+ (aq) (aq)…

Q: the reaction below takes place in an aqueous basic solution MnO2 + Fe ^3+ ---->Fe^2+ + MnO4- when…

A: A redox reaction is simultaneously occurring of the oxidation reaction and the reduction reaction.An…

Q: Pls help ASAP

A: Applying concept of electrochemical series.

Q: calculate the potential of platinum elctrode emersed in a solution 0.0613 M in k4Fe(CN)6 and…

A: The concentration of k4Fe(CN)6=0.0613 M The concentration of k3Fe(CN)6=0.00669 M The oxidation…

Q: en 7.Give a chorthand notaction galvanic cell that employs the overll reachion pbCNO,)2 Gnt Ni e p+…

A: Given that Pb(NO3)2 + Ni ---->. Pb + Ni(NO3)2

Q: Question 3 The standard reduction potential for the MSE is +650,mV (vs. SHE). What will the…

A: #Question-3: Given the standard reduction potential of MSE electrode, Eored = 650 mV

Q: The activity of Zn2+ in a saturated solution with Zn(OH)2 with 0.00500 M KNO3 (Ksp = 1.20 X10-17, y…

A: Given: Ksp of Zn(OH)2 = 1.20 X 10-17 γ of Zn2+ = 0.748 And γ of OH- = 0.926

Q: Cobalt 6f many meta l that can be oxidized bynitic one acid. Balance the toowing caction Hou…

Q: [Ca?+] (M) Ecell (V) What is the concentration of Ca2+ in a water 1.00 x 10-5 sample if its cell…

Q: FelOH,) be low Calkulut e in all iron CUmplexes K OH O.1355 M with Sowtion sa tusated FCOH)2 F COH)2…

A: Fe(OH)2 dissociates as:Fe(OH)2(s)→Fe2++2OH-Ksp=[Fe2+][OH-]2 7.9×10-15=[Fe2+](0.1355)2…

Q: Calculate Keq for the reaction Ag+ (aq) + Fe2+ (aq) ⇄ Ag(s) + Fe3+ Ag+ + e- → Ag +0.80 V Fe3+ +…

A: The relationship between Ecell∘ and Keq is expressed as: Eocell=0.0592nlogKeq......(1) The given…

Q: 293) What is the value of ECELL (in V) for the following unbalanced reaction: Mg²+ (aq) + Al(s) --->…

Q: NU Z 2. (Balance this reaction In Acidic Solution): +3-2x4 = -4 MnO4 (aq) + Br¯¯ (aq) +2 +3 24…

A: Oxidation is defined as increase in oxidation state of the element.It can also be defined as…

Q: De sure to answer all parts. The AG" for the reaction is 2.60 kmol at 28C. In ene esperiment, the…

A: Given data : PH2 = 4.32 atm PI2 = 0.017 atm PHI = 0.50 atm Temperature = 25°C = 298 K Gas constant R…

Q: At 25 o C: 3Pe2 (s) + 2Fe (s) -> 2Fe3+ (aq) + 6Pe- (aq) Eo(Pe2/Pe-) = +0.55 V Eo(Fe3+/Fe) =…

A: Given, Temperature (T) = 25 o C: 3Pe2 (s) + 2Fe (s) -> 2Fe3+ (aq) + 6Pe- (aq) Standard reduction…

Q: Consider the following cell reaction: Fe(s) + 2 H*(? M) –→FE²*(1.00 M) + H2(g)(1.00 atm) If the cell…

Q: Calculate the equilibrium constant for the following reactions at 298.15 K: // CHECK PIC//

A: Equilibrium Constant k = Concentration of products / Concentration of Reactants…

Q: Considering the reaction and the information in the Excel table below, what should be entered into…

Q: The standard reduction potential (E°) for the conversion of Cr,0 to Cr* at 25°C in an aqueous…

A: Cr2O7 2- + 14H+ + 6e- ------------------> 2Cr3+ + 7H2O E0(Cr6+/Cr3+) = 1.33 V +6…

Q: 3) Balance the following redox reaction if it occurs in acidic solution. MnO4 (aq) + Fe(s) Mn2+(aq)…

A: You follow a series of steps in order: 1. Identify the oxidation number of every atom. 2. Determine…

Question

The redction Fe
-> Fe
+ Ce
3+
+ Ce
IS rapid and reversable cit equilibrium throughout
the titration, thus electrode poten tials for
2 half recctions ae always equal, as is electrode
potential f the indicator used
GIuen Fe
as anglyte cincl Ce T as the titrunt
ZEeq
Show that
+ E° ce ce3t
%3D
た2t

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Balance by REDOX
A concentration cell is constructed with each half cell comprised of 90.0 mL of 0.0100 M Cu(NO3)2 (aq) and a copper bar. A 10.0 mL portion of a 8.20 x 10-4 M NaOH solution is added to one half-cell, which forms Cu(OH)2 (). Given that Ksp(Cu(OH)2) 2.20 x 10-20, calculate Eell %3!
The activity of Zn2+ in a saturated solution with Zn(OH), with 0.0100 M KNO3 (Ksp = 1.20 X10-17, y Zn2* = 0.676 , y OH- = 0.900) is: 2.80X10-6 1.19X10-6 1.99 X10-6 O 4.69X106 O 2.45 X10-6
In a titration experiment, 25.0 ml of 0.0500M Sn was titrated with 0.10OM Fe in I M HCl to give Fe and Sn', using Pt and calomel electrodes Fe (aq) +e Fe (aq) E" = 0.732 V Sn (aq) +2e Sn E 0.139 V E(calomel) = 0.241VN Calculate E when 28.5mL of Fe is added.
A 1.000-g sample containing KHC2O4, H2C2O4, and impurities required 38.22 mL of 0.1000 M NaOH for acid-base titration. Another 1.000-g sample required 27.02 mLof 0.04000 M KMnO4 for redox titration in acid solution, according to the following reaction: MnO4- + 5C2O42- + 16H+ ⇄ 2Mn2+ + 10CO2 + 8H2O How many mmols of KHC2O4 are there in the sample?
Question 5 (c)
I don't understand what the xM is or how to find [H+]
40.00 mL of 0.300 M Fe3+ solution is titrated with 0.150 M Sn2+ solution. a) Calculate the equilibrium constant of the reaction. b) Calculate the potential of the electrochemical cell for the following volumes of titrant additions. i) 0.0 mL ii) 20.0 mL iii) 40.0 mL iv) 6 0.0 mL
e) Using the half reaction below sHE Pou3- HPO,2 + 2H* + 2e HPO+H;O E--0,234 V and acid dissociation constants for H3PO4 (K=7.11 × 10°; K2 = 6.32 × 10*, K7.1 x 1014), calculate standard reduction potential for the half reaction he Oy H2POª + H* + 2e HPO + H;O
QUSETION5 (a) You have a solution of 50.0 mL of 0.01 M AGNO , What is the AE after the addition of 50.0mL of 0.05M ligand which forms AgL complex? 3 Given log B = 16.3, and Ag* + e ++ Ag(s) E° = 0.799 V (b) Balance the foflowing reactions: KMNO4 with NaNO2 in acidic medium.
4
its also not 4.57e-13