3) The enzyme aldolase catalyzes the conversion of fructose-1,6-diphosphate (FDP) to dihydroxyacetone phosphate (DHAP) and glyceraldehide-3-phosphate (G3P). The reaction is A,GO(298.15 K) = 23.8 kJ mol-¹ In red blood cells the concentration of these species are [FDP] = 35 µM, [DHAP] = 130 μM, and [G3P] = 15 µM. (Remember that 1.0 μM = 1.0 x 10-6 mol L-¹. The standard state for reactions in solution can be taken as cº= 1.0 mol L-¹). Calculate A, G in a red blood cell at 25°C. Will the reaction occur spontaneously in the cell at this temperature? FDP DHAP + G3P

Q: The reaction COCI₂(g) CO(g) + Cl₂(g) has Kp = 4.6 x 10-2 at 395 °C. What is Ke at this temperature?…

A: Given reaction is COCl2(g) ⇔CO(g) + Cl2(g) The relation between Kp and Kc is Kp=KccoRTpo∆n po is 1…

Q: 6) Predict the effect of decreasing the temperature on the position of the following equilibria. (a)…

A: The equilibrium of the reaction shift when the temperature of the reaction is increased, For an…

Q: CH3OH(g)⇌CO(g)+2H2(g)CH3OH(g)⇌CO(g)+2H2(g) (Note that…

A: we need to calculate ΔG for the given reaction

Q: Determine values of ΔG° and equilibrium constant K at 25°C for the following reaction catalyzed by…

A: This is a simple calculation of net change in enthalpy and entropy of the whole reaction followed by…

Q: Knowing the following 2 H₂S (g) + CH₄ (g) ⇄ 4 H₂ (g) + CS₂ (g)      Kc=5.27×10-8 What is the value…

A: 2 H2(g) + 1/2 CS2(g) ⇌ H2S(g) + 1/2 CH4(g)  ;  Kc = 4.36 x 103

Q: For the following chemical reaction,      CO (g)   +   H2O (g)      CO2 (g)   +   H2 (g)     Kc =…

A: A chemical reaction is given as, CO (g) + H2O (g)  -----> CO2 (g) + H2 (g) Here the reaction is…

Q: Consider the system   4NH3(g) + 3O2(g)     2N2(g) + 6H2O(l)           ∆H= -1530.4 kJ   How will…

A:

Q: Calculate the value of K, for the equation C(s) + CO, (g) =2CO(g) Kp = ? given that at a certain…

A: Given: C(s)+2H2O(g)⇋CO2(g)+2H2(g)   KP1=3.51H2(g)+CO2(g)⇋H2O(g)+CO(g)    KP2=0.759 To find: Overall…

Q: Calculate the value of K, for the equation C(s) + CO, (g) = 2CO(g) Kp = ? given that at a certain…

A: The two reactions given are, 1) 2) The reaction for which Kp needs to be found is, 3)

Q: Consider the reaction: C(s) + 1/20₂ (g) = CO(g) Write the equilibrium constant for this reaction in…

A: K is equilibrium constant and it is equal to concentration of product divide by concentration of…

Q: How the equilibrium constant K' of a reaction will change if the temperature rises from 25ºC to 37ºC…

A: The standard free energy change of the reaction, ΔG0 is equal to the difference between the free…

Q: A reaction has a standard free‑energy change of −14.80 kJ mol−1(−3.537 kcal mol−1). Calculate the…

A:

Q: If the system 2C0(g) + O2(g) 2 2C02lg) has come to equilibrium and then more CO(g) is added, O [CO2]…

A: We have to predict the effect of adding more of carbon monoxide on equilibrium.

Q: Calculate the equilibrium constant for the phosphorylation of glucose to glucose 6-phosphate at 37.0…

A: In the phosphorylation of glucose, glucose in presence of ATP reacts to form glucose 6-phosphate…

Q: The reaction A(g) = B(g) has AH°rxn = 208 kJ and AS°rxn = 520 J K-1. At what temperature will the…

A:

Q: For the reaction catalyzed by the enzyme hexokinase:Glucose + ATP → glucose 6-phosphate + ADPthe…

A: Glucose + ATP ⇌ glucose 6-phosphate + ADP     ; Keq = 7.8 x 102  Reaction quotient , Q = glucose…

Q: For the triose phosphate catalyzed reaction: dihydroxyacetone phosphate glyceraldehyde-3-phosphate…

A: Given:  ΔGº=7.53 kJ/mol.

Q: Given the following data, H2(g) + 1/2 O2(g) ⇌ H2O(g) ΔGo = -237. 2 H(g) + O(g) ⇌ H2O(g) ΔGo =…

A: Given reactions are :  1). H2 (g) + 1/2 O2 (g) ⇌ H2O (g),  ΔG1o = -237. 2 2). 2H (g) + O (g) ⇌ H2O…

Q: Calculate the standard free-energy change of the reaction catalysed by the enzyme phosphoglucomutase…

A:

Q: he equilibrium constant Kc for the reaction  fructose-1,6-diphosphate ⇋ glyceraldehyde-3-phosphate…

A: Given Reaction:- fructose-1,6-diphosphate⇋glyceraldehyde-3-phosphate + dihydroxyacetone phosphate

Q: reaction if the concentration of glucose-6-phosphate is 0.01 M and the concentration of…

A: calculate the ΔG for the isomerization reaction using the given data.Given values:Keq =…

Q: For the reaction: 2A(g) + 3B(g) ⇒ 4C(g) + 5D(g) where Kp = 2.432.104 the gaseous components are…

A: ΔG is the change in free energy of a system as it goes from some initial state, such as all…

Q: (Q102) Consider the production of hydrogen chlorine gas from its elements. H2 (g) + Cl2 (g) 2 HCI…

A:

Q: The following reactions at 1800.0 K have the following Kp values: H2(g) + Cl2(g) ⇄ 2 HCl(g)…

A:

Q: consider the following general reaction: 2A(g)+3B(s)3C(g) if the Kc for this reaction is 10.89 at…

A: We have to predict the Kp value.

Q: Calculate the value of Kp for the equation C(s) + CO2(g) 2 CO(g) Kp = ? given that at a certain…

A: The problem is asking us to find the equilibrium constant (Kp) for the reaction C(s) + CO2(g) ->…

Q: For which of these equilibria, is Kp / Kc? P (I) 2HgO(s) = 2Hg(l) + O2(g) (II) SO₂Cl₂ (g) = SO2(g) +…

A:

Q: 4NH3 (g) + 5O2 (g) ⇄ 4NO (g) + 6H2O (g) Given: [NH3] = 0.1210 [O2] = 0.1008 [NO] = 0.1111 [H2O]…

A: To calculate the expressions for Kb, K, and Ka for the given reaction: Write the balanced chemical…

Q: For the following reaction at equilibrium CO(g) + 2H2(g) CH3OH (g) In a 2.00 L flask, a mixture of…

A:

Q: r which one of the following reactions is Kp equal to Kc? NH41(s) = NH3(g) + HI(g) 2NH3(g) = 3H₂(g)…

A: Kp is equilibrium constant expressed as when equilibrium concentration is measured by atmospheric…

Q: CO (g)   +   H2O (g)      CO2 (g)   +   H2 (g)     Kc = 0.0257 What is the value for Kp at 25.0oC?…

A: CO(g) + H2O(g) ....> CO2(g) + H2(g) Kc = 0.0257  T = 25°C = 25°C + 273 = 298 K  Kc = [CO2][H2] ÷…

Q: for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate Kc

A:

Q: Methane and chlorine react to form chloroform and hydrogen chloride, like this: CH,(g)+3C1,(g) –…

A: For exothermic reactions, heat is produced in reaction. So if temperature is changed, the…

Q: Given the following information A(I) + B(g) + C (g) - 3D(g) Kp = 5.20 x 10-10 at 298 Determine Kc at…

A: For reaction :  A + B + C ----> 3 D  Kp = 5.20 x 10-10

Q: 3 In which of the following reactions will Kp = Kc? * 3A (g) + 2B(g) = 4E(g) + 6D(g) O A(s) +2B(g) =…

A: The relationship between Kp and Kc: Kp = Kc(RT)∆n Where, Kp = Equilibrium constant in terms of…

Q: Calculate the value of K, for the equation C(s) + CO₂(g) 2 CO(g) given that at a certain temperature…

A:

Q: C(9) + 2 H,0(@) — со,(g) + 2H, (8) Кр 3 3.95 H, (g) + CO, (g) = H,O(g)+CO(g) %3D

A: multiple equation 2 by 2 and add to equation 1 to obtain: C(s) +2H2O+ 2H2+ 2CO2 ------- >CO2 +…

Q: When two cotton plugs, one moistened with ammonia and the other with hydrochloric acid, are…

A: NH3 + HCl ---> NH4Cl Molar mass of NH3, MM1 = 1 x N +…

Q: k1 For the equilibrium reaction A(g) = C(g), the following data were collected: k-1 k-1 = 2E-3 s1 k1…

A: According to the clausius clapeyron equation, where K2 = Rate constant at temperature 2  K1 = Rate…

Q: What is the Kc expression for this reaction? 2N6CIA(g) NbCla(g) + NbCls(g)

A:

Q: The following reactions at 1800.0 K have the following Kp values: H2(g) + Cl2(g) ⇄ 2 HCl(g)…

A:

Q: The following reaction presents a ΔH0 and ΔG0 of 217.9 kJ/mol and 72.4 kJ/mol respectively, at 600…

A: ReactionCH4 (g) + H2O (g) → CO(g) + 3H2 (g)∆H° = 217.9 kJ /mol∆G° = 72.4 kJ/molTemperature = T = 600…

Q: A reaction has a standard free‑energy change of −12.50 kJ mol−1(−2.988 kcal mol−1). Calculate the…

A: Standard free energy change, ∆G°= -12.50 k J mol-1 = -12500 J mol-1  Temperature, T = 25°C = 273.15…

Q: If the KP for the reaction CO(g) + H2O(g) ⇌ CO2(g) + H2(g) was calculated to be 3.32 × 103 at 298.15…

A: According to the question, The balanced chemical reaction is as follows, CO(g) + H2O(g) ⇌ CO2(g) +…

Q: that at a certain temperature C(s) + 2 H₂O(g) H₂(g) + CO₂(g) CO₂(g) + 2 H₂(g) H₂O(g) + CO(g) A k

A:

Photochemistry

Photochemistry is the part of chemistry that studies the various mechanisms of reactions that are triggered by the presence of light energy. It also helps to study the changes involved in a molecule that can undergo the absorption of radiation.