(2) Based on the thermite reaction, Fe2O3 (s) + 2 Al (s) ---> 3 Fe (1) + Al2O3 (s), (2.A. on question 12) How much aluminum oxide (Al2O3) is formed from 21.5 gram of ferric oxide (Fe2O3)? (2.B. on question 13) How much aluminum oxide (Al2O3) is formed from 8.0 gram of aluminum (Al)? (2.C. on question 14) What is the limiting reagent?

(2) Based on the thermite reaction, Fe2O3 (s) + 2 Al (s) ---> 3 Fe (1) + Al2O3 (s), (2.A. on question 12) How much aluminum oxide (Al2O3) is formed from 21.5 gram of ferric oxide (Fe2O3)? (2.B. on question 13) How much aluminum oxide (Al2O3) is formed from 8.0 gram of aluminum (Al)? (2.C. on question 14) What is the limiting reagent?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

xercise Over the years, the thermite reaction ha solid-fuel rocket motors What masses of iron(III) oxide a mass of aluminum oxide that cc The reaction is as follows: Fe,O, (s) + 2Al(s)-
Im havin g toublr understanding what I did wrong on this conversion, can someone write it out and walk through it like in the question?
A common ingredient in homemade laundry detergents is Washing soda, you were asked to do an analysis of a sample of this ingredient. You found the sample contains 4.20% C and 7.05% H. What is the formula for washing soda if this ingredient is a hydrate of sodium carbonate? *Select one: O a. Na,CO,X8H20 O b. Na,CO,x4H;0 O . Na;CO,X10H0 O d. Na,CO,x2H,0 O e. Na;COsx6H20
need help with this chemistry
E-85 is an alternative fuel for automobiles and light trucks that consists of 85.0% (by volume) ethanol (C2H5OH), and 15.0% gasoline. When ethanol burns completely it produces CO2 and H2O. The balanced equation for the burning of ethanol isC2H5OH+3O2-->2CO2+3H2OThe density of ethanol is 0.790 g/mL. How many moles of carbon dioxide are produced by the complete combustion of the quantity of ethanol in 8.00 gallons of E-85 fuel? _mol CO2
Glucose CH2O, reacts with oxygen to give CO, and H,0. What mass of the oxygen (in grams) is required for complete reaction of 25.0 g of glucose? What masses of carbon dioxide and water (in gramy are formed? CHOg O-CO2+ H,0
64. When three moles of a metal oxide, MO2, react with ammonia gas, the metal (M), water, and nitrogen gas are formed. (a) Write a balanced equation to represent the reaction. (b) When 13.8 g of ammonia react with an excess of metal oxide, 126 g of M are formed. What is the molar mass for M? What is the identity of M?
Balance the following equations: (a) Ag(s)+H2S(g)+O2(g)⟶Ag2S(s)+H2O(l)Ag(s)+H2S(g)+O2(g)⟶Ag2S(s)+H2O(l) (b) P4(s)+O2(g)⟶P4O10(s)P4(s)+O2(g)⟶P4O10(s) (c) Pb(s)+H2O(l)+O2(g)⟶Pb(OH)2(s)Pb(s)+H2O(l)+O2(g)⟶Pb(OH)2(s) (d) Fe(s)+H2O(l)⟶Fe3O4(s)+H2(g)
4.111. The burning of acetylene (C2H2) in oxygen is the reaction in the oxyacetylene torch. How many g of CO2 is produced by burning 20.0 kg of acetylene in an excess of O2? The unbalanced equation is:
6.24 Ethanol, used in alcoholic beverages, can be produced by the fermentation of sucrose, which is found in sugar cane and other plants. The balanced equation for the fermentation process is C12H„0,(s) + H,0(1) – (a) What mass of ethanol, C,H,OH, would be produced when 2.50 g sucrose reacts by this process? (b) What mass of CO, would also be produced? 4C,H,OH() + 4CO,(g)
Given the unbalanced chemical equation, CH3OH(I) + O2(g) -> CO2(g) + H2O(g), what is the mole ration between CH3OH and CO2 (CH3OH:CO2)?
Ethylene glycol, C₂H6O2, is used as antifreeze for automobile engines. If you want to produce 2.00 kg of ethylene glycol from the reaction of C₂H4Cl2 and Na2CO3, what is the minimum amount of C₂H4Cl2 that is needed? C₂H4Cl2(1) + Na2CO3(s) + H₂O(l) C₂H6O₂(1)+ 2NaCl(aq) + CO₂(g) 3.19 x 10⁰ g 1.23 x 107 g 2.00 x 10⁰ g 3.19 x 10³ g 3.42 x 10³ g -