(2) Based on the thermite reaction, Fe2O3 (s) + 2 Al (s) ---> 3 Fe (1) + Al2O3 (s), (2.A. on question 12) How much aluminum oxide (Al2O3) is formed from 21.5 gram of ferric oxide (Fe2O3)? (2.B. on question 13) How much aluminum oxide (Al2O3) is formed from 8.0 gram of aluminum (Al)? (2.C. on question 14) What is the limiting reagent?

(2) Based on the thermite reaction, Fe2O3 (s) + 2 Al (s) ---> 3 Fe (1) + Al2O3 (s), (2.A. on question 12) How much aluminum oxide (Al2O3) is formed from 21.5 gram of ferric oxide (Fe2O3)? (2.B. on question 13) How much aluminum oxide (Al2O3) is formed from 8.0 gram of aluminum (Al)? (2.C. on question 14) What is the limiting reagent?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

xercise Over the years, the thermite reaction ha solid-fuel rocket motors What masses of iron(III) oxide a mass of aluminum oxide that cc The reaction is as follows: Fe,O, (s) + 2Al(s)-
1. Consider the combustion of gasoline. Gasoline is a complex mixture of hydrocarbon compounds containing between 4 and 9 carbon atoms. Heptane (CH16) can be considered to represent the typical gasoline compound. Consider gasoline combustion as: C,H16 + O2 > CO2 + H20 [2] a. Balance the chemical reaction (2) b. How many moles of O2 are required to burn 1 mole of gasoline. [2] c. How many grams of O2 are required to burn a gallon of gasoline (use gasoline density = 780 g / L). [2] d. At standard temperature and pressure (1 atm and 0 °C) what volume of 02 would be required to burn a gallon of gasoline. If air is 21% O2 what volume of air at STP would be required? [2] e. What mass of CO, (kg) would be produced from burning a gallon of gasoline?
Im havin g toublr understanding what I did wrong on this conversion, can someone write it out and walk through it like in the question?
Fill in the blanks: Identify the oxidizing and reducing agent of the given equation: Answers should be the symbol of the element only. 8H*(aq) + 6Cl(aq) + Sn(s) + 4NO3-(aq) SnCl²(aq) + 4NO₂(g) + 4H₂O(1) 1. oxidizing agent 2. reducing agent = S
A common ingredient in homemade laundry detergents is Washing soda, you were asked to do an analysis of a sample of this ingredient. You found the sample contains 4.20% C and 7.05% H. What is the formula for washing soda if this ingredient is a hydrate of sodium carbonate? *Select one: O a. Na,CO,X8H20 O b. Na,CO,x4H;0 O . Na;CO,X10H0 O d. Na,CO,x2H,0 O e. Na;COsx6H20
need help with this chemistry
E-85 is an alternative fuel for automobiles and light trucks that consists of 85.0% (by volume) ethanol (C2H5OH), and 15.0% gasoline. When ethanol burns completely it produces CO2 and H2O. The balanced equation for the burning of ethanol isC2H5OH+3O2-->2CO2+3H2OThe density of ethanol is 0.790 g/mL. How many moles of carbon dioxide are produced by the complete combustion of the quantity of ethanol in 8.00 gallons of E-85 fuel? _mol CO2
Glucose CH2O, reacts with oxygen to give CO, and H,0. What mass of the oxygen (in grams) is required for complete reaction of 25.0 g of glucose? What masses of carbon dioxide and water (in gramy are formed? CHOg O-CO2+ H,0
5.(0-2) The combustion of a 0.265g sample of a chemical compound yielded 0.880g of carbon(IV) oxide and 0.225g of water vapor. The molar mass of this chemical compound is 106 9. Determine mol the sum formula of this chemical compound.
64. When three moles of a metal oxide, MO2, react with ammonia gas, the metal (M), water, and nitrogen gas are formed. (a) Write a balanced equation to represent the reaction. (b) When 13.8 g of ammonia react with an excess of metal oxide, 126 g of M are formed. What is the molar mass for M? What is the identity of M?
Balance the following equations: (a) Ag(s)+H2S(g)+O2(g)⟶Ag2S(s)+H2O(l)Ag(s)+H2S(g)+O2(g)⟶Ag2S(s)+H2O(l) (b) P4(s)+O2(g)⟶P4O10(s)P4(s)+O2(g)⟶P4O10(s) (c) Pb(s)+H2O(l)+O2(g)⟶Pb(OH)2(s)Pb(s)+H2O(l)+O2(g)⟶Pb(OH)2(s) (d) Fe(s)+H2O(l)⟶Fe3O4(s)+H2(g)
4.111. The burning of acetylene (C2H2) in oxygen is the reaction in the oxyacetylene torch. How many g of CO2 is produced by burning 20.0 kg of acetylene in an excess of O2? The unbalanced equation is: