Balance the following equations 13. _ Sno +NF3 →SnF2 +_ N20314.NANO3 +_ Pb0 →.Pb(NO3)2 + _ Na2015.AgI +_ Fe2(C03)3 →_ Fel3 +Ag2CO316.C2H402 -_ 02 →_ CO2 + __ H20+-

A chemical reaction is said to be balanced if the number of atoms (and charges if present) on both…

Answered: 13. Sn0 + __ NF3→ NF3 → SnF2 + _ N203…

13. Sn0 + __ NF3→ NF3 → SnF2 + _ N203 NaNO3 + _ Pb0 →_ Pb(NO3)2 +_ Na20 15. AgI +_ Fe2(C03)3 →_ Fel3 + Ag2CO3 16. C2H402 + _ 02 →_CO2 + _ H2O - - -

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter3: Mass Relations In Chemistry; Stoichiometry

Section: Chapter Questions

Problem 47QAP: Balance the following equations: (a) CaC2(s)+H2O(l)Ca(OH)2(s)+C2H2(g) (b)...

See similar textbooks

Related questions

Q: 1E. C₂H12O₂

A: Given Molecular formula: C8H12O2 To Determine: 1) IHD 2)Label the significant peak 3) Determine the…

Q: j. Cl2 a= OH FeCl3 HNO 3 H2SO4 H₂SO k. H2CrO4 A OCH3

A: The questions are based on substitution electrophilic aromatic. The reagents combine in-situ to…

Q: P.S. 6. A miner was digging up some ore (rock). The ore contains 84% lead(II) sulfide by mass. How…

Q: _ 19. P4S3 _ 20. SiCl, _ 21. Hg2(CN)2

A: Soln

Q: 4. Enter the chemical equation 2H+(aq)+S2−(aq)→H2S(g)2H+(aq)+S2−(aq)→H2S(g)?

A: Given:-we have to enter the chemical equation.2H+aq+S2-aq → H2Sg

Q: Which equation below violates the law of conservation of mass? a. 2H2+ O2 –→ 2H2O b. KCl + Br –→ KBr…

A: Law of conservation of mass = It sates that in a chemical reaction no mass is created or destroyed,…

Q: . C. 6. . 6. . S. .. .. _H3PO4 + КОН → K+ _B₂O3 → HCI + NaOH → C + Na + NaOH + Rb + _C6H6 + S8 → _O₂…

Q: 5. Would you expect the following reactions to be nearly complete? Why or why not? -31 a. N₂(g) +…

A: In the given question, we have to find whether the reaction is completed or not.

Q: 13. Complete the table below. :8 hes Equation 1: Equation 2: 1 H₂(g) + 02(g) Mg(s) + 2HCl(aq) SUL…

Q: c. CH₂O(s) + 0(g) →CO₂(g) + H₂O(g) d. Fe(s) +0g)→ Fe,0,(s) e. Fe0(s) + 0(g) → Fe,0,(s)

Q: 8. Fill in the following boxes. . HO, heat HO, SOCI2 NaN3 1. he t 2. H2C 2 MeI +

A: There is lots of reaction involved in the given questions.

Q: CO₂CH3 NH₂ CH(CH,)ẠNH, (excess) 1. P₂05, A 2. CH3CH₂CH₂Li 3. H30*

A: The question is based on organic reactions. we need to identify the product formed and explain…

Q: a. KO2(s) + H20(1) → KOH(aq)+ O2 (g) + H2O2(aq) b. Fe, O3 (s) + HNO3(aq) → Fe(NO3)3 (aq) + H2O(1) c.…

A: Using hit trial method In this method we have to equal all elements both side of arrow by…

Q: CHM 151 Exp #8 Copper Cycle General Observations: Your instructor has provided pictures and video…

A: 1. The reaction of copper with nitric acid results in the formation of copper nitrate, nitrogen…

Q: Classify each chemical reaction: reaction Na₂S (aq) + FeCl₂ (aq) → 2NaCl(aq) + FeS (s) -> 2CH, (CH₂)…

A: We are given 4 reactions, and asked to classify these as the type of reaction to which they belong…

Q: Number of trucks: Chemicals that can be in each truck together:

A: Chemical A can be shipped safely with: C, D, E, G Chemical B can be shipped safely with: F, G…

Q: ΤΗ Cl2 FeCl3 OCH3 HNO3 H2SO4 H2CrO4 Δ

A: The questions are based on substitution electrophilic aromatic. The reagents combine in-situ to…

Q: 3. +¹C 3 n + 103Lr 1. 4. 35Cl + p 17 4 20 α + 5. 235Cm + In → 96 91 + 8 n + Zr

A: Balancing a nuclear reaction involves making sure that the total number of protons and neutrons…

Q: 1Mg + 1H2SO4 1MgSO4 + ___H2 2. 3Fe + ___O2 1Fe3O4 3. 2Pb(NO3)2  2PbO + ___NO2 + 1O2 4. ___C2H6 +…

Q: Use the data below to determine the mass ratio of iron to oxygen for compound 1. Compound 1 2 Mass…

A: Given: In compound 1, Mass of Fe = 15.55 g and mass of O = 4.45 g

Q: +2 Pb Thallium Lead 200.592 2818 32 182 1832 18 1 204.383 207.2 28 18 32 10 2818 32 18 3 111 112 +2…

A: In Balanced chemical equation number of atoms of each species are equal on both reactant and…

Q: Which of the following equation is both physically and mathematically correct? Select all correct…

A: In thermodynamics, the thermodynamic properties are classified into two types of functions.There are…

Q: 2- Make a comparison between brittle and ductile materials Brittle Materials Ductile materials

Q: 25. NaOH Fe2(SO4)3 >

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Greenhouse Gas Carbon dioxide is a greenhouse gas that is linked to global warming. It is released…

A: It is based on the concept of stoichiometry Here we are required to find the mass of octane…

Q: OH OH OH CrO3 / H* 1 2 3. 4

A: CrO3 is an oxidizing agent and will oxidize primary alcohol to aldehyde and secondary alcohol to a…

Q: 1. CH3CH₂COCI, AICI3 2. Br₂, CH3CO₂H 3. K* tBuO- 4. OsO4 then NaHSO3 5. H₂CRO4

A: The objective of the question is to predict the products formed on the following reactions with…

Q: h Oxidation: Cr2+→ Cr³+ + e Reduction: Cu2+ + 2 e² → Cu Net: 2 Cr2+ + Cu2+ Cu + 2 Cr³+ What is the…

A: Oxidation is defined as an increase in the oxidation state of the element.It can also be defined as…

Q: 4. Two engineers are serving as trainees in a laboratory of a pharmaceutical company. One of their…

A: Given: % of C in the sample = 59.0 % % of H in the sample = 5.0 % % of N in the sample = 22.9 % % of…

Q: 7 1 4 6.3Li +1H - 2He+ 2 1H 4 О не O 4 O ABe 3 On

Q: Consider the following changes:a.N2 (g) → N2 (l)b.CO (g) + H2O (g) → H2 (g) + CO2 (g)c.Ca3P2 (s) +…

A: Work done: The work is a transfer of energy from one system to another system without the change in…

Q: In the reaction 2Li(s) + 2H20()→ 2LIOH(aq) + H2(g), which compound is in the gaseous state? A. H20…

A: From any reaction, we can determine in which state the reactants and products are present. The…

Q: Using the table provided, what is the enthalpy for the reaction shown below: 6H₂(g) + 4NO(g) + CH4…

A: The thermochemical equations can be treated as algebraic equation which can be added, subtracted,…

Q: Ammonia is an important compound in agriculture. The chemical reaction in forming ammonia, known as…

Q: In the following equation for a chemical reaction, the notation (s), (I), or (g) indicates whether…

A: Reactants lie on left hand side of the arrow. Products lie on the right hand side of the arrow. If…

Q: This activity will help you become skilled at balancing chemical equations. Bala

A: Since you have asked multiparts, we will solve the first three subparts for you. If you want any…

Q: 2. Calculate the maximum volume of 6 M HNO; which would be required to react with 0.350 g of Cu…

A: Concentration of HNO3 = 6 M Mass of Cu metal = 0.350 g

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

13. _ Sno +
NF3 →
SnF2 +_ N203
14.
NANO3 +_ Pb0 →.
Pb(NO3)2 + _ Na20
15.
AgI +_ Fe2(C03)3 →_ Fel3 +
Ag2CO3
16.
C2H402 -
_ 02 →_ CO2 + __ H20
+
-

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Balance the following equations: a. Li3N(s)Li(s)+N2(g) b. Cu2O(s)+O2(g)CuO(s) c. Zn(s)+HNO3(aq)Zn(NO3)2(aq)+H2(g) d. K2SO4(aq)+BaCl2(aq)BaSO4(s)+KCl(aq) e. dinitrogenmonoxidenitrogen+oxygen f. dinitrogenpentoxidenitrogendioxide+oxygen g. P4O10(s)+H2O(l)H4P2O7(aq) h. CaCO3(s)+HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)
Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)
Rewrite the following word equation using chemical formulas. Balance the equation and write the balanced equation in net ionic form: bariumchloride(aq)+sodiumsulfate(aq)sodiumchloride(aq)+bariumsulfate(s)
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
Many over-the-counter antacid tablets are now formulated using calcium carbonate as the active ingredient, which enables such tablets to also be used as dietary calcium supplements. As an antacid for gastric hyperacidity, calcium carbonate reacts by combining with hydrochloric acid found in the stomach, producing a solution of calcium chloride, converting the stomach acid to water, and releasing carbon dioxide gas (which the person suffering from stomach problems may feel as a “burp”). Write the unbalanced chemical equation for this process.
Balance the following equations: (a) CaC2(s)+H2O(l)Ca(OH)2(s)+C2H2(g) (b) (NH4)2Cr2O7(s)Cr2O3(s)+N2(g)+H2O(f) (c) CH3NH2(g)+O2(g)CO2(g)+N2(g)+H2O(g)
list at least three quantities that must be conserved in chemical reactions.
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)arefurnaceElectricSi(s)+CO(g) b. Liquid silicon tetrachloride is reacted with very pure solid magnesium, producing solid silicon and solid magnesium chloride. c. Na2SiF6(s) + Na(s) Si(s) + NaF(s)