1. t-BuOK, t-BuOH 2. HBr Which is the major product of the above reaction sequence? a) Br ○ b) c) Br Br 7% ☑ Br ○ d) the Br O e) none of the above
Q: 8TH
A: Step 1:
Q: None
A: Step 1: The Arrhenius equation in linear form is:ln K=R−Ea×T1+ln Awhere:K is the rate constantEa…
Q: Please don't use hend raiting and step by step solutions
A: Step 1: Regardless of the number of steps required to achieve the reaction, the change in enthalpy…
Q: Hello I am stuck on this question, can I get help please? A CLEAR explanation with Drawings and the…
A: Step 1: (a) Nitration Step 2: (b) Sulfonation Step 3: (c) Bromination Step 4: (d) Friedel-Crafts…
Q: Draw the structure of the conjugate acids of the compounds below.
A: Step 1: if we remove H+ Then it will formed conjugate base . But here we add H+ for conjugate acids…
Q: 9. Complete the following reactions by filling in the blanks with the appropriate organic or…
A: Part a) (CH3CH2CH2CH2)2CuLi + CH3CH2CH2I → CH3CH2CH2CH2CH2CH2CH3 + CuI This is a…
Q: A chemist dissolves 617. mg of pure barium hydroxide in enough water to make up 180. mL of solution.…
A: First, we need to convert the mass of barium hydroxide (Ba(OH)2) to moles. The molar mass of Ba(OH)2…
Q: 4) Provide a valid name for the following, remember to include stereochemical designation if needed…
A: Epoxide is given higher priority than CH3. The oxygen is attached in wedge bond, thus making it cis.…
Q: 2ND
A:
Q: Which layout is most suitable for a job shop? A. Product layout B. Process layout C. Fixed-position…
A: A job shop is a type of manufacturing process in which small batches of a variety of custom products…
Q: Please provide detailed solution and give the explanation of the concept... Please answer as soon as…
A: Step 1: In this problem, we will be using the Henderson-Hasselbach equation.…
Q: a) Using the Stokes-Einstein equation D = k bT/6πηrh explain the factors that influence diffusion…
A: Step 1: Step 2: Step 3: Step 4:
Q: Please don't use hend raiting and step by step solutions
A: The acid dissociation constant provides an idea of pH. higher the value of Ka, higher the acidity…
Q: Please provide detailed solution and give the explanation of the correct and incorrect options....…
A: Step 1: Step 2:
Q: Complete the organic mechanism
A: Step 1:Alkyl group in grignard reagent act as a nucleophile Step 2: Step 3: Step 4:
Q: Draw the most stable resonance form for the intermediate in the following electrophilic substitution…
A: Final mechanism will be this.
Q: The pH of a 0.76M solution of pentanoic acid (HCH,O2) is measured to be 2.48. Calculate the acid…
A: Step 1: Step 2: Step 3: Step 4:
Q: Exercises: I) Write the product(s) likely to be formed in the following reactions. Br 1) Zn, THF 1)…
A:
Q: Use K and initial concentrations to calculate equilibrium concentrations. Consider the equilibrium…
A:
Q: None
A: The most stable conformation of this compound would be them taking the equatorial positions. In this…
Q: None
A: For this one, it is impossible to answer without any given values. There is no calculation involved…
Q: Sand is converted to pure silicon in a 3 step process. The final step in this process is as follows.…
A: Step 1: Calculation for mass silicon produced in the reaction: The balanced equation is:…
Q: 3) Draw a stepwise mechanism for the treatment of the ester below with methyl Grignard followed by…
A: Determine the mechanism for the given reaction. Explanation:In this reaction first the addition of…
Q: Fill in the blanks - all the statements refer to bowls A-F shown in the figure below. 2. Solutions…
A: Bowl A: The solution inside the bag (10% sugar) is hypertonic compared to the bowl (5% sugar).Bowl…
Q: Check In: Determine the pH of a 0.232 M Sr(OH)2 solution at 25°C. a. 12.73 b. 13.37 c. 13.67 d.…
A: The Sr(OH)2 shows the dissociation in water as:Sr(OH)2(aq)⇌Sr2+(aq)+2OH−(aq)By looking at the…
Q: None
A: Binary search only works on sorted arrays. The elements within the array must be arranged in…
Q: 7TH
A:
Q: X Give the major product for the following E2 reaction. A) CH -CH=CHỊCH CHỊCH: CH3 CHCH…
A: Step 1:Reactant:A benzene ring attached to a CH2−CHBr−CH2−CH3 group.Base:Methoxide ion…
Q: Fast answer please
A: The half-life of a radioactive substance is the time it takes for half of the atoms in a sample to…
Q: Draw the least stable resonance form for the intermediate in the following electrophilic…
A:
Q: What is the nuclear binding energy of a helium nucleus in KILOJOULES? A. 4.5 x 10 9 kJ B. 6.3 x 10…
A: To determine the nuclear binding energy of a helium nucleus (also known as an alpha particle), we…
Q: 1. Name the following compounds. If needed, be sure to include stereochemical labels (cis/trans,…
A: Step 1:CIP (cahn-Ingold-Prelog) rules to determine R, S configuration on a chiral carbon1) Rank the…
Q: A given acid is 35.59 % by mass sulfuric acid, H2SO4, and the rest water. Its specific gravity is…
A:
Q: Provide the IUPAC name for the following compound: CH3CH2CH2CH2CH(CH3)CH2CH2CH(CH2CH3)2
A: Step 1:Long chain has 10 carbons So called dec Step 2: Step 3: Step 4:
Q: in text form with proper workings and explanation for each and every part and steps with concept and…
A: To express the product of 9.3cm×6.81cm×0.3744cm with the correct number of significant figures and…
Q: HO 1. CO₂H SnCl4 CO₂H Ph H₂O CH3O LOCH3 CH3O. OCH3 ZnCl2 H₂O + 2. HO CH3 a = Proton transfer b =…
A: 1) Step-by-Step Mechanism:The SnCl4 acts as a Lewis acid, which helps to activate the benzoic acid…
Q: Hello I am stuck on this question, can I get help please? A CLEAR explanation with Drawings and the…
A:
Q: What is the volume of NH3 produced in the following reaction when 3.0 L of N2 reactscompletely with…
A: In the given chemical reaction, N2(g) + 3H2(g) → 2NH3(g), the stoichiometric coefficients indicate…
Q: N H₂SO4 HO Click and drag to start drawing a structure.
A: The reaction takes place as below: In this reaction, the protonation/addition of a proton (H+), to…
Q: answer must be in table format or i will give down vote
A: Step 1: Step 2: Step 3: Step 4:
Q: Identify the strongest acid based upon its Ka. O Acid X, Ka = 1.8 × 10-6 O Acid Y, Ka = 2.2 × 10-5 O…
A: The acid dissociation constant, Ka, is a measure of the strength of an acid in solution. It is the…
Q: 16.71 What is the pH of a solution that is 0.600 M HCHO2 (formic acid) and 0.400 M NaCHO₂? 16.72…
A: Step 1: 16.71: Given: Concentration of formic acid: 0.600 M.Concentration of sodium formate: 0.400…
Q: Does any element with Z ≤ 92 match the description? A halogen with a lower atomic number than…
A: The question is asking if there is a halogen element with an atomic number (Z) less than or equal to…
Q: Hello I am stuck on this question, can I get help please? A CLEAR explanation with Drawings and the…
A:
Q: 8.Naphthalene , acetanilide , benzoin , or biphenyl Which of the above four compounds would be…
A: Step 1: Polar compounds are soluble in polar compounds while non Polar compounds are soluble in non…
Q: The amount of heat (q) gained or lost by a substance (with mass m) as its temperature changes (A7)…
A:
Q: For the reaction below, the equilibrium constant is K = 3.2×10-10 at 25 °C. Pb(s) + 2 Cr3+(aq) =…
A: The equilibrium expression for the reaction is given by the law of mass action…
Q: Suppose a 250. mL flask is filled with 1.8 mol of Cl₂, 0.20 mol of CHCl3 and 0.60 mol of HCl. The…
A: First, we need to calculate the initial concentrations of the reactants and products. The…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Ester-> This is the wrong answer since the group for esters is RCOOR′ Ether-> This is the…
Q: None
A: Potassium reacts with iodine to form KI .Potassium losses one electron to form K+ ion and iodine…
answer must be in proper format or i will give down vote
Step by step
Solved in 2 steps with 2 images
- What is the missing reagent in the reaction below? of of. cr CI Multiple Choice O LIAIH4. [2] H2O (1] CH2=CHLI, [2] H2O (1]) (CH2=CH)2CULİ, (2) H20 (1] DIBAL-H, (2] H20In each reaction box, place the best reagent and conditions from the list provided. 1) Br 2) 3) 4) DEET (the active ingredient in over the counter insect repellant) 5) Answer Bank Mg, Et,0 HN(CH, CH, ), (1 equiv.) H,O* CH,COOH CH,CH,NH, CH,CH, Br NH(CH,CH,),(2 cquiv.) НСООСH, H,CO НСООН CH, CH, OH NaCN NaNH, Br,, FeBr, SOCI, CO,Do it clearly...
- II. Apply all the criteria for each reaction, and then draw the product(s) of each. a) b) 9 d) Br X² CH3CH₂O CH3 Br CH3 CH3 Br + j EtOH CH3CH₂CI CH3OH heat ? CH3ONa CH3OH ? ? i ? 15. What is the major product of the following reaction? OH A) I B) || C) III D) all of the above E) none of the above H₂SO4 heat ||| LOSO3HPlease do step by step Thanks
- 1. Which would be formed in the following reaction? CH3 ☺☺ CH3 A) I and II OCH3 CH3 CH3 CH3 Ayd OCH3 CH3 Br B) I and III NaOEt 55° || C) II and III CH3 CH3 CH₂ IV D) III and IV E) All of the above2-butanol reacts with HCl in the presence of ZnCl2 at high temperature. The final product of the reaction: A has inversion of configuration B is racemic C) none of these has retention of configurationcomplete the following reaction
- Which is the expected product of this reaction 1.(O 2. H2O2, NaOH BH C6H5-C=C-H – CA) Снссн, %3D CH5CCH3 B) ОН CGH3CHCH3 %3D CGH3CH2CH ) CH;CH2CH2OHPredict the major product of this reaction. K2Cr2O7 H3O* II HO2C. CO2H НО HO. II IV HO2C. HO A) I B) I| C) II D) IVWhich of the following would accomplish the transformation below? a) 1. HSCH2CH2SH, H+; 2. H2, Raney Ni b) H2N-NH2, NaOH(aq), heat c) H2, Pd d) All of the above