1. Draw a crystal field splitting diagram of [Cr(CN)6] complex ions. (a) What is the oxidation number of central metal ion? (b) How many unpaired electrons will there be in central metal ion in the complex? (c) Write the electronic configuration of central metal ion in the form t'g (d) Calculate the crystal field splitting energy of the complex. (6+3+3+3+3 points)

1. Draw a crystal field splitting diagram of [Cr(CN)6] complex ions. (a) What is the oxidation number of central metal ion? (b) How many unpaired electrons will there be in central metal ion in the complex? (c) Write the electronic configuration of central metal ion in the form t'g (d) Calculate the crystal field splitting energy of the complex. (6+3+3+3+3 points)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 6Q: Four different octahedral chromium coordination compounds exist that all have the same oxidation...

See similar textbooks

Similar questions

What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Consider the pseudo-octahedral complex ion of Cr3+, where A and B represent ligands. Ligand A produces a stronger crystal field than ligand B. Draw an appropriate crystal field diagram for this complex ion (assume the A ligands are on the z-axis).