EBK STUDENT SOLUTIONS MANUAL TO ACCOMPA7th EditionHYSLOP Publisher: YUZUISBN: 9781119360902
EBK STUDENT SOLUTIONS MANUAL TO ACCOMPA
Solutions for EBK STUDENT SOLUTIONS MANUAL TO ACCOMPA
Problem 3PE:
When monitoring a reaction, the initial temperature of the reaction is 25C, it rose to 67C , and...Problem 4PE:
Practice Exercise 6.4
A hall bearing at is dropped into a cup containing 250.0 g of water at. The...Problem 6PE:
Silicon, used in computer chips, has a specific heat capacity of 0.705Jg-1C-1. If 549 J of heat is...Problem 7PE:
Would the explosive reaction of hydrogen and oxygen to form water be exothermic or endothermic?...Problem 8PE:
Practice Exercise 6.8
When ammonium nitrate is dissolved in water, the container holding the...Problem 9PE:
An exothermic reaction is carried out at a constant volume and then repeated under constant...Problem 10PE:
For an exothermic reaction that is conducted under conditions of constant pressure and expanded, and...Problem 11PE:
Since it can be obtained in very high purity, benzoic acid is one of the classic materials used for...Problem 12PE:
A 1.50 g sample of pure sucrose is burned in a bomb calorimeter that has a heat capacity of...Problem 13PE:
For the Analyzing and Solving Multi-Concept Problems example we just solved, calculate H per mole of...Problem 14PE:
Practice Exercise 6.14
The exact same procedure as described in the Analyzing and Solving...Problem 15PE:
The combustion of methane can be represented by the following thermochemical equation:...Problem 18PE:
Consider the following thermochemical equations:...Problem 20PE:
Ethanol, C2H5OH, is made industrially by the reaction of water with ethylene, C2H4. Calculate the...Problem 21PE:
Practice Exercise 6.21
The heat of combustion, , of acetone, , is -1790.4 kJ/mol. How many...Problem 22PE:
Practice Exercise 6.22
n-Octane, , has a standard heat of combustion of —5450.5 kJ/mol. A 15 gallon...Problem 23PE:
Write the thermochemical equation that would be used to represent the standard heat of formation of...Problem 24PE:
Write the thermochemical equation that would be used to represent the standard heat of formation of...Problem 26PE:
Write thermochemical equations corresponding to Hf for SO3(g) and SO2(g) and show how they can be...Problem 27PE:
Calculate H for the following reactions: 2NO(g)+O2(g)2NO2(g) NaOH(s)+HCl(g)NaCl(s)+H2O(l)Problem 4RQ:
6.4 State the law of conservation of energy. Describe how it explains the motion of a child on a...Problem 5RQ:
6.5 A pendulum such as a swinging chandelier continuously converts kinetic energy to potential...Problem 7RQ:
6.7 What is meant by the term chemical energy?
Problem 8RQ:
How does the potential energy change (increase, decrease, or no change) for each of the following?...Problem 9RQ:
What is the SI unit of energy? How much energy (in joules and in calories) does a 75 kg object have...Problem 12RQ:
6.12 How is internal energy related to molecular kinetic and potential energy? How is a change in...Problem 13RQ:
On a molecular level, how is thermal equilibrium achieved (a) when a hot object is placed in contact...Problem 14RQ:
Consider the distribution of molecular kinetic energies shown in the following diagram for a gas at...Problem 15RQ:
Suppose the temperature of an object is raised from 100Cto200C by heating it with a Bunsen burner....Problem 16RQ:
A quart of boiling water will cause a more severe burn if its spilled on you than will just a drop...Problem 20RQ:
6.20 How can the state of a system be specified?
Problem 21RQ:
6.21 What do the terms system and surroundings mean? What is the difference between an isolated...Problem 22RQ:
What are the names of the thermal properties whose values can have the following units?...Problem 23RQ:
6.23 For samples with the same mass, which kind of substance needs more energy to undergo an...Problem 24RQ:
6.24 How do heat capacity and specific hear differ?
Problem 26RQ:
6.26 Suppose object A has twice the specific heat and twice the mass of object B. If the same amount...Problem 27RQ:
In a certain chemical reaction, there is a decrease in the potential energy (chemical energy) as the...Problem 28RQ:
6.28 What term do we use to describe a reaction that liberates heat to its surroundings? How does...Problem 29RQ:
6.29 What term is used to describe a reaction that absorbs heat from the surroundings? How does the...Problem 30RQ:
6.30 When gasoline burns, it reacts with oxygen in the air and forms hot gases consisting of carbon...Problem 31RQ:
Write the equation that states the first law of thermodynamics. In your own words, what does this...Problem 32RQ:
How are heat and work defined?Problem 33RQ:
Devise an example, similar to the one described in Figure 6.8 to distinguish between heat and work...Problem 34RQ:
6.34 Why are heat and work not state functions?
Problem 35RQ:
When we measure the heat of combustion of glucose, C6H12O6, in a bomb calorimeter, what products are...Problem 36RQ:
Consider the reaction C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) Are the values of EandH expected to be...Problem 37RQ:
How is enthalpy defined?Problem 38RQ:
What is the sign of H for an endothermic change?Problem 39RQ:
6.39 If the enthalpy of a system increases by 100 kJ, what must he true about the enthalpy of the...Problem 40RQ:
If a system containing gases expands and pushes back a piston against a constant opposing pressure,...Problem 41RQ:
6.41 Why do standard reference values for temperature and pressure have to be selected when we...Problem 43RQ:
Why are fractional coefficients permitted in a balanced thermochemical equation? If a formula in a...Problem 45RQ:
6.45 What two conditions must be met by a thermochemical equation so that its standard enthalpy...Problem 46RQ:
Describe what must be done with the standard enthalpy of reaction if a reaction is reversed (i.e.,...Problem 47RQ:
What two additional thermochemical equations are needed to determine the standard heat of formation...Problem 48RQ:
Peptides, small parts of proteins, contain nitrogen and sulfur atoms in addition to carbon and...Problem 49RQ:
If a car increases its speed from 30 mph to 60 mph, by what factor does the kinetic energy of the...Problem 50RQ:
6.50 If the mass of a truck is doubled—for example, when it is loaded—by what factor does the...Problem 51RQ:
6.51 What is the kinetic energy, in joules, of a mole of oxygen moving at a speed of (use the...Problem 52RQ:
What is the kinetic energy, in joules, of a molecule of carbon tetrachloride moving at a speed of...Problem 53RQ:
How much heat, in joules and in calories, must be removed from 1.75 mol of water to lower its...Problem 54RQ:
6.54 How much heat, in joules and calories, is needed to increase the temperature of 215 mL of water...Problem 55RQ:
How many grams of water can be heated from 25.0Cto35.0C by the heat released from 85.0 g of iron...Problem 56RQ:
6.56 How many grams of copper can be cooled from by the heat gained by 100.0 g of water that has an...Problem 57RQ:
A 50.0 g piece of a metal at 100.0C was plunged into 100.0 g of water at 24.0C. The temperature of...Problem 58RQ:
6.58 A sample of copper was heated to and then thrust into 200.0 g of water at . The temperature of...Problem 60RQ:
6.60 What is the molar heat capacity of ethyl alcohol, , in units of -1if its specific heat is...Problem 61RQ:
A vat of 4.54 kg of water underwent a decrease in temperature from 60.25Cto58.65C. How much energy...Problem 62RQ:
A container filled with 2.46 kg of water underwent a temperature change from 25.24Cto27.31C. How...Problem 63RQ:
6.63 Nitric acid neutralizes potassium hydroxide. To determine the heat of reaction, a student...Problem 64RQ:
In the reaction between formic acid (HCHO2) and sodium hydroxide, water and sodium formate (NaCHO2)...Problem 65RQ:
6.65 A 1.000 mol sample of propane, a gas used for cooking in many rural areas, was placed in a bomb...Problem 66RQ:
Toluene, C7H8, is used in the manufacture of explosives such as TNT (trinitrotoluene). A 1.500 g...Problem 67RQ:
If a system does 4$ J of work and receives 28 J of heat, what is the value of E for this change?Problem 68RQ:
If a system has 48 J of work done on it and absorbs 22 J of heat, what is the value of E for this...Problem 69RQ:
An automobile engine converts heat into work via a cycle. The cycle must finish exactly where it...Problem 70RQ:
Chargers for cell phones get warm while they are being used. Some of the energy that they are using...Problem 71RQ:
If the engine in Problem 6.69 absorbs 250 joules of heat per cycle, how much work can it do per...Problem 72RQ:
If a battery can release 535 J of energy and 455 J are used for work, how much energy is released as...Problem 73RQ:
Ammonia reacts with oxygen as follows: 4NH3(g)+7O2(g)4NO2(g)+6H2O(g)H=-1132kJ (a) Calculate the...Problem 75RQ:
Magnesium bums in air to produce a bright light and is often used in fireworks displays. The...Problem 76RQ:
Methanol is the fuel in canned heat containers (e.g., Sterno) that are used to heat foods at...Problem 77RQ:
Methane burns with oxygen to produce carbon dioxide and water as a gas. The balanced thermochemical...Problem 78RQ:
Methanol, as described in Problem 6.76, is used to heat food. The combustion of methanol can he...Problem 79RQ:
*6.79 Construct an enthalpy diagram that shows the enthalpy changes for a one-step conversion of...Problem 80RQ:
*6.80 Construct an enthalpy diagram for the formation of from its elements by two pathways: first,...Problem 81RQ:
Show how the equations N2O4(g)2NO2(g)H=+57.93kJ2NO(g)+O2(g)2NO2(g)H=113.14kJ Can be manipulated to...Problem 82RQ:
6.82 We can generate hydrogen chloride by heating a mixture of sulfuric acid and potassium chloride...Problem 83RQ:
Calculate H in kilojoules for the following reaction, the preparation of the unstable acid nitrous...Problem 85RQ:
Given the following thermochemical equations,...Problem 86RQ:
6.86 Given the following thermochemical equations,
calculate the standard enthalpy of formation .
Problem 87RQ:
Given the following thermochemical equations,...Problem 88RQ:
Given the following thermochemical equations, 4NH3(g)+7O2(g)4NO2(g)+6H2O(g)H=1132kJ...Problem 89RQ:
Which of the following thermochemical equations can have Hf for the heat of the reaction? If it...Problem 90RQ:
Which of the following thermochemical equations can have Hf for the heat of the reaction? If it...Problem 91RQ:
Write the thermochcmical equations, including values of H in kilojoules per mole (from Table 6.2),...Problem 92RQ:
Write the thermochemical equations, including values of H in kilojoules per mole (from Appendix C),...Problem 93RQ:
Using data in Table 6.2, calculate H in kilojoules for the following reactions. (a)...Problem 94RQ:
6.94 Using data in Table 6.2, calculate in kilojoules for the following reactions.
(a)
(b)...Problem 95RQ:
The value for the standard heat of combustion, H combustion, for sucrose, Cl2H22O11,...Problem 97RQ:
6.97 Look at the list of substances in Table 6.1. Which one will require the most energy to raise...Problem 98RQ:
*6.98 A dilute solution of hydrochloric acid with a mass of 610.29 g and containing 0.33183 mol of...Problem 99RQ:
A 2.00 kg piece of granite with a specific heat of 0.803Jg-1C-1 and a temperature of 95.0C is placed...Problem 100RQ:
In the recovery of iron from iron ore, the reduction of the ore is actually accomplished by...Problem 101RQ:
Use the results of Problem 6.100 and the data in Table 6.2 to calculate the value of Hf for FeO....Problem 102RQ:
6.102 The amino acid glycine, , is one of the compounds used by the body to make proteins. The...Problem 103RQ:
The value of Hf for HBr(g) was first evaluated using the following standard enthalpy values obtained...Problem 104RQ:
Acetylene, C2H2, is a gas commonly burned in welding because of its hot flame. Small amounts can be...Problem 105RQ:
The reaction for the metabolism of sucrose, C12H22O11, is the same as for its combustion in oxygen...Problem 106RQ:
Consider the following thermochemical equations:...Problem 107RQ:
6.107 Chlorofluoromethanes (CFMs) are carbon compounds of chlorine and fluorine and are also known...Problem 109RQ:
Suppose a truck with a mass of 14.0 tons (lton=2000lb) is traveling at a speed of 45.0 mi/hr. If the...Problem 110RQ:
How much work must be done to form one mole of CH4 and enough oxygen from CO2andH2O? Why is it so...Problem 111RQ:
A cold -15C piece of copper metal weighing 7.38 g was placed in a beaker as illustrated, holding 55...Problem 112RQ:
Both Na2CO3 and NaHCO3 can be used to neutralize acids. Using the information from Appendix C, which...Problem 113RQ:
*6.113 When 4.56 g of a solid mixture composed of and was dissolved in 100.0 mL water, the...Problem 114RQ:
Using the results from Analyzing and Solving Multi- Concept Problems in Section 6.6 and the Practice...Problem 115RQ:
*6.115 For ethanol, , which is mixed with gasoline to make the fuel gasohol, Calculate the number...Problem 116RQ:
Both calcium and potassium react with water to form hydrogen and the corresponding hydroxide. The...Problem 117RQ:
6.117 As a routine safety procedure, acids and bases should be stored separately in a laboratory....Problem 118RQ:
In an experiment, 95.0 mL of 0.225 M silver nitrate was mixed rapidly with 47.5 mL of 0.225 M...Problem 119RQ:
6.119 Growing wheat and converting it into bread requires energy. In the process, the wheat absorbs...Problem 120RQ:
Suppose we compress a spring, tie it up tightly, and then dissolve the spring in acid. What happens...Problem 122RQ:
Why do we usually use H rather than E when we discuss energies of reaction? Develop an argument for...Browse All Chapters of This Textbook
Chapter 0 - A Very Brief History Of ChemistrChapter 1 - Scientific MeasurementChapter 2 - Elements, Compounds, And The Periodic TableChapter 3 - The Mole And StoichiometryChapter 4 - Molecular View Of Reactions In Aqueous SolutionsChapter 5 - Oxidation–reduction ReactionChapter 6 - Energy And Chemical ChangeChapter 7 - The Quantum Mechanical AtomChapter 8 - The Basics Of Chemical BondingChapter 9 - Theories Of Bonding And Structure
Chapter 10 - Properties Of GasesChapter 11 - Intermolecular Attractions And The Properties Of Liquids And SolidsChapter 12 - Mixtures At The Molecular Level: Properties Of SolutionsChapter 13 - Chemical KineticChapter 14 - Chemical EquilibriumChapter 15 - Acids And Bases, A Molecular LookChapter 16 - Acid–base Equilibria In Aqueous SolutionsChapter 17 - Solubility And Simultaneous EquilibriaChapter 18 - ThermodynamicsChapter 19 - ElectrochemistryChapter 20 - Nuclear Reactions And Their Role In ChemistryChapter 21 - Metal ComplexesChapter 22 - Organic Compounds, Polymers, And Biochemicals
Sample Solutions for this Textbook
We offer sample solutions for EBK STUDENT SOLUTIONS MANUAL TO ACCOMPA homework problems. See examples below:
Chapter 0, Problem 1PEChapter 1, Problem 1PEChapter 2, Problem 1PEChapter 3, Problem 1PEa) CaI2 CaI2 consists of calcium and iodine atoms. Calcium is in the group 2A and has a charge of 2+...Chapter 5, Problem 1PEGiven information: The pudding contains 140 Cal per serving. Nutritional calories are related to...Chapter 7, Problem 1PEChapter 8, Problem 1PE
Chapter 9, Problem 1PEGaseous molecules have a very weak force of attraction within them; therefore they are free to move...The graph is as: As the intensity of the attractive force is reduced constantly, the variation in...Chapter 12, Problem 1PEChapter 13, Problem 1PEChapter 14, Problem 1PEChapter 15, Problem 1PEGiven information: The molarity of the hydronium ion is 12 M. The moles of HCl in the solution is 12...Chapter 17, Problem 1PEChapter 18, Problem 1PEChapter 19, Problem 1PEGiven information: The rest mass of tennis ball is 57.7 g. The mass of the tennis ball is calculated...The most common oxidation state of silver Ag is +1 is when it loses one electron and becomes Ag+...a) The molecular formula of the given organic compound consists of 6 carbon atoms and 14 hydrogen...
More Editions of This Book
Corresponding editions of this textbook are also available below:
CHEMISTRY: A MOLECULAR NATURE - ACCESS
8th Edition
ISBN: 9781119741923
All Access Pack, 7th edition,
7th Edition
ISBN: 9781118738726
Chemistry: The Molecular Nature of Matter 7e Binder Ready Version+ WileyPLUS Registration Card (Wiley Plus Products)
7th Edition
ISBN: 9781118865552
Study Guide To Accompany Chemistry: The Molecular Nature Of Matter, 7e
7th Edition
ISBN: 9781118705087
CHEMISTRY:MOLECULAR NATURE (LL)W/ACCESS
7th Edition
ISBN: 9781119497325
MOLECULAR NATURE ... W/SOLNS+WILEYPLUS
7th Edition
ISBN: 9781119171973
CHEMISTRY MOLECULAR NATURE F16
7th Edition
ISBN: 9781119291992
Chemistry:The Molecular Nature Of Matter 7e WileyPLUS Multi-term
7th Edition
ISBN: 978EEGRP37878
Chemistry: The Molecular Nature of Matter, 7e WileyPLUS Card with Looseleaf Print Companion Set (Wiley Plus Products)
7th Edition
ISBN: 9781119461791
CHEMISTRY: THE MOLECULAR NATURE OF MATT
7th Edition
ISBN: 9781119461814
CHE 120 TEXT/LM PKG >C<
7th Edition
ISBN: 9781119211334
Chemistry: The Molecular Nature of Matter
7th Edition
ISBN: 9781118516461
Student Solutions Manual To Accompany Chemistry: The Molecular Nature Of Matter, 7e
7th Edition
ISBN: 9781118704943
CHEMISTRY:MOLECULAR..(LL)-PRINT..W/CODE
7th Edition
ISBN: 9781119457282
Chemistry: The Molecular Nature of Matter - Package
7th Edition
ISBN: 9781118984789
Chemistry: The Molecular Nature of Matter - Print Companion (Looseleaf)
7th Edition
ISBN: 9781119456452
Chemistry: Molecular Nature of Matter
7th Edition
ISBN: 9781118800362
EBK CHEMISTRY: THE MOLECULAR NATURE OF
7th Edition
ISBN: 8220106961377
EBK STUDY GUIDE TO ACCOMPANY CHEMISTRY:
7th Edition
ISBN: 9781119360889
Chemistry: The Molecular Nature of Matter 7th Edition Jespersen WileyPlus Access Code ONLY
7th Edition
ISBN: 9781118423035
Chemistry: The Molecular Nature Of Matter 7e + Wileyplus Registration Card (wiley Plus Products)
7th Edition
ISBN: 9781118866818
WILEY PLUS-CHEMISTRY- STUDENT PKG >I<
7th Edition
ISBN: 9781118716625
EBK CHEMISTRY: THE MOLECULAR NATURE OF
7th Edition
ISBN: 9781119513216
CHEMISTRY:MOLECULAR..-WILEYPLUS+BLACKB.
7th Edition
ISBN: 9781118842997
MOLECULAR NATURE OF MATTER 7/E LL W/AC
7th Edition
ISBN: 9781119664796
PRINT UPGRADE - CHEM: MOLECULAR NATURE
8th Edition
ISBN: 9781119910688
Chemistry, Study Guide: The Molecular Nature Of Matter
6th Edition
ISBN: 9780470577721
Chemistry: The Molecular Nature of Matter
6th Edition
ISBN: 9780470577714
Related Chemistry Textbooks with Solutions
Still sussing out bartleby
Check out a sample textbook solution.
