Concept explainers
A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps:
(a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products.
(b) What is ΔH for the formation of one mole of silicon?
(c) Is the overall reaction exothermic?
Trending nowThis is a popular solution!
Chapter 8 Solutions
CHEMISTRY:PRIN.+REACTIONS-OWLV2 ACCESS
- When one mole of ethylene gas, C2H4, reacts with fluorine gas, hydrogen fluoride and carbon tetrafluoride gases are formed and 2496.7 kJ of heat are given off. What is Hf for CF4(g)?arrow_forwardChlorine dioxide, ClO2, is a reddish yellow gas used in bleaching paper pulp. The average speed of a ClO2 molecule at 25C is 306 m/s. What is the kinetic energy (in joules) of a ClO2 molecule moving at this speed?arrow_forwardThe equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forward
- When lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardGraphite is burned in oxygen to give carbon monoxide and carbon dioxide. If the product mixture is 33% CO and 67% CO2 by mass, what is the heat from the combustion of 1.00 g of graphite?arrow_forwardA piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?arrow_forward
- Although the gas used in an oxyacetylene torch (Figure 5.7) is essentially pure acetylene, the heat produced by combustion of one mole of acetylene in such a torch is likely not equal to the enthalpy of combustion of acetylene listed in Table 5.2. Considering the conditions for which the tabulated data are reported, suggest an explanation.arrow_forwardEnthalpy a A 100.-g sample of water is placed in an insulated container and allowed to come to room temperature at 21C. To heat the water sample to 41C, how much heat must you add to it? b Consider the hypothetical reaction,2X(aq)+Y(l)X2Y(aq)being run in an insulated container that contains 100. g of solution. If the temperature of the solution changes from 21C to 31C, how much heat does the chemical reaction produce? How does this answer compare with that in part a? (You can assume that this solution is so dilute that it has the same heat capacity as pure water.) c If you wanted the temperature of 100. g of this solution to increase from 21C to 51C, how much heat would you have to add to it? (Try to answer this question without using a formula.) d If you had added 0.02 mol of X and 0.01 mol of Y to form the solution in part b, how many moles of X and Y would you need to bring about the temperature change described in part c. e Judging on the basis of your answers so far, what is the enthalpy of the reaction 2X(aq) + Y(l) X2Y(aq)?arrow_forwardHow much would the temperature of 275 g of water increase if 36.5 U of heat were added?arrow_forward
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardIn a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?arrow_forwardWe burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning