Introductory Chemistry (5th Edition) (Standalone Book)
5th Edition
ISBN: 9780321910295
Author: Nivaldo J. Tro
Publisher: PEARSON
expand_more
expand_more
format_list_bulleted
Concept explainers
Videos
Textbook Question
Chapter 8, Problem 105E
Consider the combustion of propane:
a. Balance the reaction.
b. Divide all coefficients by the coefficient on propane, so that you have the reaction for the combustion of 1 mol of propane.
c. ∆Hrxn for the combustion of one mole of propane is −2219 kJ. What mass of propane would you need to burn to generate 5. 0MJ of heat?
d. If propane costs about $0.67/L and has a density of 2.01 g/cm3, how much would it cost to generate 5.0 MJ of heat by burning propane?
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solution
Chapter 8 Solutions
Introductory Chemistry (5th Edition) (Standalone Book)
Ch. 8 - Q1. Sulfur and fluorine react to form sulfur...Ch. 8 - Hydrogen chloride gas and oxygen gas react to form...Ch. 8 - Sodium reacts with fluorine to form sodium...Ch. 8 - Consider the hypothetical reaction shown here. If...Ch. 8 - Prob. 5SAQCh. 8 - Prob. 6SAQCh. 8 - Sodium and chlorine react to form sodium chloride....Ch. 8 - A reaction has a theoretical yield of 22.8 g. when...Ch. 8 - Titanium can be obtained from its oxide by the...Ch. 8 - Which statement best describes an exothermic...
Ch. 8 - Consider the generic reaction: A+2BAB2Hrxn=155kJ...Ch. 8 - Q12. Hydrogen gas reacts with oxygen to form...Ch. 8 - Prob. 1ECh. 8 - Nitrogen and hydrogen can react to from ammonia:...Ch. 8 - Prob. 3ECh. 8 - Prob. 4ECh. 8 - 5 what is the general from of the solution map...Ch. 8 - 6. Consider the recipe for making tomato and...Ch. 8 - 7 In a chemical reaction, what is the limiting...Ch. 8 - Prob. 8ECh. 8 - In a chemical reaction, what are the actual yield...Ch. 8 - If you are given a chemical equation and specific...Ch. 8 - 11. Consider the generic chemical...Ch. 8 - Prob. 12ECh. 8 - Prob. 13ECh. 8 - Explain the relationship between the sign of Hrxn...Ch. 8 - Consider the generic chemical reaction: A+2BC How...Ch. 8 - Prob. 16ECh. 8 - 17. For the reaction shown, calculate how many...Ch. 8 - 18. For the reaction shown, calculate how many...Ch. 8 - 19. Dihydrogen monosulfide reacts with sulfur...Ch. 8 - 20. Chlorine gas reacts with fluorine gas...Ch. 8 - For each reaction, calculate how many moles of...Ch. 8 - 22. For each reaction, calculate how many moles of...Ch. 8 - 23. For the reaction shown, calculate how many...Ch. 8 - 24. For the reaction shown, calculate how many...Ch. 8 - Consider the balanced equation:...Ch. 8 - 26. Consider the balance equation:
Complete the...Ch. 8 - 27. Consider the unbalanced equation for the...Ch. 8 - Prob. 28ECh. 8 - 29. Consider the unbalanced equation for the...Ch. 8 - 30. Consider the unbalanced equation for the...Ch. 8 - Prob. 31ECh. 8 - 32. For the reaction shown, calculate how many...Ch. 8 - For each of the reactions, calculate how many...Ch. 8 - 34. For each of the reactions, calculate how many...Ch. 8 - 35. For the reaction shown, calculate how many...Ch. 8 - 36. For the reaction shown, calculate how many...Ch. 8 - Prob. 37ECh. 8 - Consider the balanced equation for the combustion...Ch. 8 - 39. For each acid–base reaction, calculate how...Ch. 8 - 40. For each precipitation reaction, calculate how...Ch. 8 - Sulfuric acid can dissolve aluminum metal...Ch. 8 - Hydrochloric acid can dissolve solid iron...Ch. 8 - 43. Consider the generic chemical equation:
a....Ch. 8 - Prob. 44ECh. 8 - Prob. 45ECh. 8 - Prob. 46ECh. 8 - For the reaction shown, find the limiting reactant...Ch. 8 - Prob. 48ECh. 8 - 49. For the reaction shown, calculate the...Ch. 8 - For the reaction shown, calculate the theoretical...Ch. 8 - Consider the generic reaction between reactants A...Ch. 8 - Consider the reaction between reactants S and O2:...Ch. 8 - Consider the reaction 4HCI(g)+O2(g)2H2O(g)+2Cl2(g)...Ch. 8 - 54. Consider the reaction
Each molecular diagram...Ch. 8 - 55. For the reaction shown, find the limiting...Ch. 8 - For the reaction shown, find the limiting reactant...Ch. 8 - Prob. 57ECh. 8 - For the reaction shown, calculate the theoretical...Ch. 8 - 58. If the theoretical yield of a reaction is 24.8...Ch. 8 - If the theoretical yield of reaction is 0.118 g...Ch. 8 - 61. Consider the reaction between calcium oxide...Ch. 8 - Consider the reaction between sulfur trioxide and...Ch. 8 - Consider the reaction between NiS2 and O2:...Ch. 8 - LIMITING REACTANT, THEORETICAL YIELD, AND PERCENT...Ch. 8 - Lead ions can be precipitate form solution with...Ch. 8 -
Ch. 8 - Consider the reaction between TiO2 and C:...Ch. 8 - 68. Consider the raction between N2H4 and N2O4:
A...Ch. 8 - 69. Classify each process as exothermic or...Ch. 8 - 70. Classify each process as exothermic or...Ch. 8 - Consider the generic reaction: A+2BCHrxn=55kJ...Ch. 8 - Prob. 72ECh. 8 - Consider the equation for the combustion of...Ch. 8 - ENTHALPY AND STOICHIOMETRY OF Hrxn
74. The...Ch. 8 - 75. Octane (C8H18) is a component of gasoline that...Ch. 8 - Prob. 76ECh. 8 - Consider the reaction:...Ch. 8 - Prob. 78ECh. 8 - A solution contains an unknown mass of dissolved...Ch. 8 - Prob. 80ECh. 8 - Prob. 81ECh. 8 - Prob. 82ECh. 8 - 83. The combustion of gasoline produces carbon...Ch. 8 - Many home barbecues are fueled with propane gas...Ch. 8 - Prob. 85ECh. 8 - 86. Magnesium ions can be precipitated from...Ch. 8 - Hydrogen gas can be prepared in the laboratory by...Ch. 8 - Prob. 88ECh. 8 - Prob. 89ECh. 8 - Pure oxygen gas can be prepared in the laboratory...Ch. 8 - 91. Aspirin can be made in the laboratory by...Ch. 8 - 92. The combustion of liquid ethanol produces...Ch. 8 - Urea (CH4N2 O), a common fertilizer, can be...Ch. 8 - 94. Silicon, which occurs in nature as SiO2, is...Ch. 8 - 95. The ingestion of lead from food, water, or...Ch. 8 - Prob. 96ECh. 8 - The propane fuel (C3H8) used in gas barbecues...Ch. 8 - Prob. 98ECh. 8 - 99. A loud classroom demonstration involves...Ch. 8 - 100. A hydrochloric acid solution will neutralize...Ch. 8 - Prob. 101ECh. 8 - Prob. 102ECh. 8 - What volume of air is needed to burn an entire...Ch. 8 - Have each member of your group choose a...Ch. 8 - 105. Consider the combustion of propane:
a....
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Shown below is a diagram depicting the enthalpy change of a chemical reaction run at constant pressure. a Is the reaction exothermic or endothermic? b What is the sign of H? c What is the sign of q? d If the reaction does no work, what is the sign of E for this process?arrow_forward9.68 What are some features of petroleum that make it such an attractive fuel?arrow_forwardConsider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.arrow_forward
- A typical fat in the body is glyceryl trioleate, C57H104O6. When it is metabolized in the body, it combines with oxygen to produce carbon dioxide, water, and 3.022104 kJ of heat per mole of fat. (a) Write a balanced thermochemical equation for the metabolism of fat. (b) How many kilojoules of energy must be evolved in the form of heat if you want to get rid of five pounds of this fat by combustion? (c) How many nutritional calories is this? (1 nutritional calories =1103 calories)arrow_forwardA beaker of water at 40C (on the left in the drawing) and a beaker of ice water at 0°C are placed side by side in an insulated container. After some time has passed, the temperature of the water in the beaker on the left is 30°C and the temperature of the ice water is still 0°C. Describe what is happening in each beaker (a) on the molecular level and (b) in terms of the second law of thermodynamicsarrow_forwardYou wish to heat water to make coffee. How much heat (in joules) must be used to raise the temperature of 0.180 kg of tap water (enough for one cup of coffee) from 30C to 96C (near the ideal brewing temperature)? Assume the specific heat is that of pure water, 4.18 J/(gC).arrow_forward
- 9.35 A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5°C and then dropped into a coffee cup calorimeter containing 75.0 g of water at 2 1.7°C. When thermal equilibrium is reached, the final temperature is 24.3°C. Calculate the specific heat capacity of titanium.arrow_forward9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forward9.61 Silane, SiH4, burns according to the reaction, SiH4+2O2SiO2+2H2O , with H=1429 kJ. How much energy is released if 15.7 g of silane is burned?arrow_forwardUsing the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) N2(g)+O2(g)2NO(g) (b) Si(s)+2Cl2(g)SiCl4(g) (c) Fe2O3(s)+3H2(g)2Fe(s)+3H2O(l) (d) 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(g)arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
Chemistry: Principles and Practice
Chemistry
ISBN:9780534420123
Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer
Publisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
General Chemistry - Standalone book (MindTap Cour...
Chemistry
ISBN:9781305580343
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Publisher:Cengage Learning
Calorimetry Concept, Examples and Thermochemistry | How to Pass Chemistry; Author: Melissa Maribel;https://www.youtube.com/watch?v=nSh29lUGj00;License: Standard YouTube License, CC-BY