The Sun supplies about 1.0 kilowatt of energy for each squaremeter of surface area (1.0 kW/m2,where a watt = 1 J/s). Plants produce the equivalent of about 0.20 g of sucrose (C12H22O11) per hour per square meter. Assuming that the sucrose is produced as follows, calculate the percentage ofsunlight used to produce sucrose.
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
Study Guide for Chemistry: The Central Science
- 4.60 Why are fuel additives used?arrow_forwardThe equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forward9.59 For the reaction N2(g)+O2(g)2NO(g),H=180.5kJ . How much energy is needed to generate 35 moles of NO(g)?arrow_forward
- A rebreathing gas mask contains potassium superoxide, KO2, which reacts with moisture in the breath to give oxygen. 4KO2(s)+2H2O(l)4KOH(s)+3O2(g) Estimate the grams of potassium superoxide required to supply a persons oxygen needs for one hour. Assume a person requires 1.00 102 kcal of energy for this time period. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 1.00 102 kcal of heat, calculate the amount of oxygen consumed and hence the amount of KO2 required. The ff0 for glucose(s) is 1273 kJ/mol.arrow_forwardThe reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forwardConsider the two space shuttle fuel reactions in Exercises 81 and 82. Which reaction produces more energy per kilogram of reactant mixture (stoichiometric amounts)? 81. The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate as fuel. A possible reaction is 3Al(s)+3NH4ClO4(s)Al2O3(s)+AlCl3(s)+3NO(g)+6H2O(g) Calculate H for this reaction 82. The space shuttle Orbiter utilizes the oxidation of methylhydrazine by dinitrogen tetroxide for propulsion: 4N2H3CH3(l)+5N2O4(l)12H2O(g)+9N2(g)+4CO2(g) Calculate H for this reactionarrow_forward
- How many kilojoules of heat will be released when exactly 1 mole of iron, Fe, is burned to form Fe2O3(s) at standard state conditions?arrow_forwardCalculate H298 for the process Co3O4(s)3Co(s)+2O2(g) from the following information: Co(s)+12O2(g)CoO(s)H298=237.9kJ3CoO(s)+12O2(g)Co3O4(s)H298=177.5kJarrow_forwardWe burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.arrow_forward
- The enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardHow much heat is produced when 1.25 g of chromium meta’ reacts with oxygen gas under standard conditions?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning