Chemistry
13th Edition
ISBN: 9781259911156
Author: Raymond Chang Dr., Jason Overby Professor
Publisher: McGraw-Hill Education
expand_more
expand_more
format_list_bulleted
Textbook Question
Chapter 3, Problem 3.25QP
Calculate the molar mass of a compound if 0.372 mole of it has a mass of 152 g.
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionStudents have asked these similar questions
Calculate the molar mass of a compound if 0.372 molof it has a mass of 152 g.
0.117 mol of a particular substance weighs 21.9 g. What is the molar mass of this substance?
If 3.655 moles of a substance weighs 62.5 g, what is the molar mass of the substance, in units of g/mol?
Chapter 3 Solutions
Chemistry
Ch. 3.1 - The atomic masses of the two stable isotopes of...Ch. 3.1 - There are two stable isotopes of iridium: 191Ir...Ch. 3.1 - The hypothetical element Q occurs as a mixture of...Ch. 3.2 - How many moles of magnesium (Mg) are there in 87.3...Ch. 3.2 - Calculate the number of grams of lead (Pb) in 12.4...Ch. 3.2 - Gold atoms form small clusters containing a fixed...Ch. 3.2 - Determine which of the following contains the...Ch. 3.2 - How many moles of rubidium (Rb) are there in 3.75 ...Ch. 3.2 - What is the mass in grams of 1.68 moles of...Ch. 3.3 - What is the molecular mass of methanol (CH4O)?
Ch. 3.3 - Prob. 6PECh. 3.3 - Prob. 7PECh. 3.3 - Determine the molecular mass and the molar mass of...Ch. 3.3 - What is the mass in grams of 0.382 moles of...Ch. 3.3 - How many oxygen atoms are in 124 g of calcium...Ch. 3.5 - Calculate the percent composition by mass of each...Ch. 3.5 - Determine the empirical formula of a compound...Ch. 3.5 - Prob. 10PECh. 3.5 - Prob. 1RCFCh. 3.5 - Prob. 2RCFCh. 3.5 - Determine the empirical formula of a compound...Ch. 3.6 - A sample of a compound containing boron (B) and...Ch. 3.6 - What is the molecular formula of a compound...Ch. 3.7 - Balance the equation representing the reaction...Ch. 3.7 - Which parts of the equation shown here are...Ch. 3.7 - Prob. 2RCFCh. 3.8 - Methanol (CH3OH) burns in air according to the...Ch. 3.8 - The reaction between nitric oxide (NO) and oxygen...Ch. 3.8 - Which of the following statements is correct for...Ch. 3.8 - Prob. 2RCFCh. 3.8 - At high temperatures, magnesium reacts with...Ch. 3.9 - The reaction between aluminum and iron(III) oxide...Ch. 3.9 - Prob. 16PECh. 3.9 - Aluminum and bromine vigorously react according to...Ch. 3.9 - Consider the following reaction:...Ch. 3.10 - Industrially, vanadium metal, which is used in...Ch. 3.10 - Prob. 1RCFCh. 3.10 - Sulfur trioxide (SO3) is prepared from the...Ch. 3 - What is an atomic mass unit? Why is it necessary...Ch. 3 - What is the mass (in amu) of a carbon-12 atom? Why...Ch. 3 - Explain clearly what is meant by the statement,...Ch. 3 - What information would you need to calculate the...Ch. 3 - The atomic masses of 1735Cl (75.53 percent) 1737Cl...Ch. 3 - The atomic masses of 36Li and 37Li are 6.0151 amu...Ch. 3 - What is the mass in grams of 13.2 amu?Ch. 3 - How many amu are there in 8.4 g?Ch. 3 - Define the term mole. What is the unit for mole in...Ch. 3 - What is the molar mass of an atom? What are the...Ch. 3 - Earths population is about 7.2 billion. Suppose...Ch. 3 - The thickness of a piece of paper is 0.0036 in....Ch. 3 - How many atoms are there in 5.10 moles of sulfur...Ch. 3 - How many moles of cobalt (Co) atoms are there in...Ch. 3 - How many moles of calcium (Ca) atoms are in 77.4 g...Ch. 3 - How many grams of gold (Au) are there in 15.3...Ch. 3 - What is the mass in grams of a single atom of each...Ch. 3 - What is the mass in grams of a single atom of each...Ch. 3 - What is the mass in grams of 1.00 1012 lead (Pb)...Ch. 3 - A modern penny weighs 2.5 g but contains only...Ch. 3 - Which of the following has more atoms: 1.10 g of...Ch. 3 - Which of the following has a greater mass: 2 atoms...Ch. 3 - Calculate the molecular mass or formula mass (in...Ch. 3 - Calculate the molar mass of the following...Ch. 3 - Calculate the molar mass of a compound if 0.372...Ch. 3 - How many molecules of ethane (C2H6) are present in...Ch. 3 - Calculate the number of C, H, and O atoms in 1.50...Ch. 3 - Dimethyl sulfoxide [(CH3)2SO], also called DMSO,...Ch. 3 - Pheromones are a special type of compound secreted...Ch. 3 - The density of water is 1.00 g/mL at 4C. How many...Ch. 3 - Describe the operation of a mass spectrometer.Ch. 3 - Describe how you would determine the isotopic...Ch. 3 - Carbon has two stable isotopes, 612C and 613C, and...Ch. 3 - Hydrogen has two stable isotopes, 11H and 12H, and...Ch. 3 - Use ammonia (NH3) to explain what is meant by the...Ch. 3 - Describe how the knowledge of the percent...Ch. 3 - Tin (Sn) exists in Earths crust as SnO2. Calculate...Ch. 3 - For many years chloroform (CHCl3) was used as an...Ch. 3 - Cinnamic alcohol is used mainly in perfumery,...Ch. 3 - All of the substances listed here are fertilizers...Ch. 3 - The formula for rust can be represented by Fe2O3....Ch. 3 - Tin(II) fluoride (SnF2) is often added to...Ch. 3 - What are the empirical formulas of the compounds...Ch. 3 - What are the empirical formulas of the compounds...Ch. 3 - The anticaking agent added to Morton salt is...Ch. 3 - What does the word empirical in empirical formula...Ch. 3 - If we know the empirical formula of a compound,...Ch. 3 - The empirical formula of a compound is CH. If the...Ch. 3 - The molar mass of caffeine is 194.19 g. Is the...Ch. 3 - Peroxyacylnitrate (PAN) is one of the components...Ch. 3 - Allicin is the compound responsible for the...Ch. 3 - Monosodium glutamate (MSG), a food-flavor...Ch. 3 - Use the formation of water from hydrogen and...Ch. 3 - What is the difference between a chemical reaction...Ch. 3 - Why must a chemical equation be balanced? What law...Ch. 3 - Write the symbols used to represent gas, liquid,...Ch. 3 - Problems 3.57Balance the following equations using...Ch. 3 - Balance the following equations using the method...Ch. 3 - Prob. 3.59QPCh. 3 - Prob. 3.60QPCh. 3 - Prob. 3.61QPCh. 3 - Prob. 3.62QPCh. 3 - Consider the combustion of carbon monoxide (CO) in...Ch. 3 - Silicon tetrachloride (SiCl4) can be prepared by...Ch. 3 - Ammonia is a principal nitrogen fertilizer. It is...Ch. 3 - Certain race cars use methanol (CH3OH, also called...Ch. 3 - Calculate the mass in grams of iodine (I2) that...Ch. 3 - How many grams of sulfur (S) are needed to react...Ch. 3 - Prob. 3.69QPCh. 3 - When baking soda (sodium bicarbonate or sodium...Ch. 3 - If chlorine bleach is mixed with other cleaning...Ch. 3 - Fermentation is a complex chemical process of wine...Ch. 3 - Each copper(II) sulfate unit is associated with...Ch. 3 - For many years the recovery of goldthat is, the...Ch. 3 - Limestone (CaCO3) is decomposed by heating to...Ch. 3 - Nitrous oxide (N2O) is also called laughing gas....Ch. 3 - Prob. 3.77QPCh. 3 - A common laboratory preparation of oxygen gas is...Ch. 3 - Prob. 3.79QPCh. 3 - Prob. 3.80QPCh. 3 - Consider the reaction 2A+BC (a)In the diagram here...Ch. 3 - Consider the reaction N2+3H22NH3 Assuming each...Ch. 3 - Nitric oxide (NO) reacts with oxygen gas to form...Ch. 3 - Ammonia and sulfuric acid react to form ammonium...Ch. 3 - Propane (C3H8) is a component of natural gas and...Ch. 3 - Consider the reaction MnO2+4HClMnCl2+Cl2+2H2O If...Ch. 3 - Why is the theoretical yield of a reaction...Ch. 3 - Prob. 3.88QPCh. 3 - Hydrogen fluoride is used in the manufacture of...Ch. 3 - Nitroglycerin (C3H5N3O9) is a powerful explosive....Ch. 3 - Titanium(IV) oxide (TiO2) is a white substance...Ch. 3 - Ethylene (C2H4), an important industrial organic...Ch. 3 - When heated, lithium reacts with nitrogen to form...Ch. 3 - Disulfide dichloride (S2Cl2) is used in the...Ch. 3 - Prob. 3.95QPCh. 3 - Rubidium is used in atomic clocks and other...Ch. 3 - Prob. 3.97QPCh. 3 - Prob. 3.98QPCh. 3 - Prob. 3.99QPCh. 3 - Write balanced equations for the following...Ch. 3 - Industrially, nitric acid is produced by the...Ch. 3 - A sample of a compound of Cl and O reacts with an...Ch. 3 - Prob. 3.103QPCh. 3 - A 26.2-g sample of oxalic acid hydrate (H2C2O4 ...Ch. 3 - Prob. 3.105QPCh. 3 - How many moles of O are needed to combine with...Ch. 3 - Prob. 3.107QPCh. 3 - The aluminum sulfate hydrate [Al2(SO4)3 xH2O]...Ch. 3 - The explosive nitroglycerin (C3H5N3O9) has also...Ch. 3 - Prob. 3.110QPCh. 3 - Prob. 3.111QPCh. 3 - A certain metal oxide has the formula MO, where M...Ch. 3 - Prob. 3.113QPCh. 3 - One of the reactions that occurs in a blast...Ch. 3 - Prob. 3.115QPCh. 3 - Prob. 3.116QPCh. 3 - Prob. 3.117QPCh. 3 - Analysis of a metal chloride XCl3 shows that it...Ch. 3 - Prob. 3.119QPCh. 3 - Myoglobin stores oxygen for metabolic processes in...Ch. 3 - Calculate the number of cations and anions in each...Ch. 3 - Prob. 3.122QPCh. 3 - Prob. 3.123QPCh. 3 - Prob. 3.124QPCh. 3 - Aspirin or acetyl salicylic acid is synthesized by...Ch. 3 - Calculate the percent composition by mass of all...Ch. 3 - Lysine, an essential amino acid in the human body,...Ch. 3 - Prob. 3.128QPCh. 3 - Prob. 3.129QPCh. 3 - Prob. 3.130QPCh. 3 - Prob. 3.131QPCh. 3 - Prob. 3.132QPCh. 3 - Prob. 3.133QPCh. 3 - Prob. 3.134QPCh. 3 - Prob. 3.135QPCh. 3 - Platinum forms two different compounds with...Ch. 3 - Prob. 3.137QPCh. 3 - Prob. 3.138QPCh. 3 - Prob. 3.139QPCh. 3 - A compound X contains 63.3 percent manganese (Mn)...Ch. 3 - Prob. 3.141QPCh. 3 - Prob. 3.142QPCh. 3 - Prob. 3.143QPCh. 3 - Prob. 3.144QPCh. 3 - A mixture of CuSO4 5H2O and MgSO4 7H2O is heated...Ch. 3 - When 0.273 g of Mg is heated strongly in a...Ch. 3 - A mixture of methane (CH4) and ethane (C2H6) of...Ch. 3 - Leaded gasoline contains an additive to prevent...Ch. 3 - Because of its detrimental effect on the...Ch. 3 - Prob. 3.150QPCh. 3 - A certain sample of coal contains 1.6 percent...Ch. 3 - Air is a mixture of many gases. However, in...Ch. 3 - Prob. 3.153QPCh. 3 - Octane (C8H18) is a component of gasoline....Ch. 3 - Industrially, hydrogen gas can be prepared by...Ch. 3 - Prob. 3.157QPCh. 3 - Prob. 3.158QPCh. 3 - Potash is any potassium mineral that is used for...Ch. 3 - Prob. 3.161QPCh. 3 - A certain metal M forms a bromide containing 53.79...Ch. 3 - Prob. 3.163QPCh. 3 - Prob. 3.165QPCh. 3 - Interpreting, Modeling Estimating 3.166While most...Ch. 3 - Without doing any detailed calculations, arrange...Ch. 3 - Consider the reaction 6Li(s)+N2(g)2Li3N(s) Without...Ch. 3 - Estimate how high in miles you can stack up an...Ch. 3 - The following is a crude but effective method for...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Given that the molar mass of carbon tetrachloride, CCl4 , is 153 g, calculate the mass in grams of 1 molecule of CCl4 .arrow_forwardA sample of a hydrocarbon (a compound consisting of only carbon and hydrogen) contains 2.59 1023 atoms of hydrogen and is 17.3% hydrogen by mass. If the molar mass of the hydrocarbon is between 55 and 65 g/mol, what amount (moles) of compound is present, and what is the mass of the sample?arrow_forwardIn a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).arrow_forward
- Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.arrow_forwardThe following quantities are placed in a container: 1.51024 atoms of hydrogen, 1.0 mol of sulfur, and 88.0 g of diatomic oxygen. What is the total mass in grams for the collection of all three elements? What is the total number of moles of atoms for the three elements? If the mixture of the three elements formed a compound with molecules that contain two hydrogen atoms, one sulfur atom, and four oxygen atoms, which substance is consumed first? How many atoms of each remaining element would remain unreacted in the change described in (c)?arrow_forwardConsidering your answer to Exercise 79, which type of formula, empirical or molecular, can be obtained from elemental analysis that gives percent composition?arrow_forward
- Determine the molar mass of a substance if 0.360 moles has a mass of 152 g.arrow_forwardA metal has the mass of 12.00 g and 5.850 x 1022 atoms. Calculate molar mass of the metal.arrow_forwardif 0.274 moles of a substance weigh 62.5 g, what is the molar mass of the substance in units of g/mol?arrow_forward
- The empirical formula for a compound is CHN. What is the molecular formula of this compound if 0.1 moles has a mass of 10.8g?arrow_forwardWhat is the molar mass of a particular compound if 0.081 mol weighs 5.84 g?arrow_forward68.5 grams of a certain compound contains 5.25 x 1023 molecules. What is the molar mass of the compound?arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- World of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
Chemistry: Principles and Practice
Chemistry
ISBN:9780534420123
Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer
Publisher:Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
World of Chemistry, 3rd edition
Chemistry
ISBN:9781133109655
Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste
Publisher:Brooks / Cole / Cengage Learning
Chemistry: Matter and Change
Chemistry
ISBN:9780078746376
Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom
Publisher:Glencoe/McGraw-Hill School Pub Co
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
GCSE Chemistry - Differences Between Compounds, Molecules & Mixtures #3; Author: Cognito;https://www.youtube.com/watch?v=jBDr0mHyc5M;License: Standard YouTube License, CC-BY