Write net ionic equations for the reaction that occurs when aqueous solutions of ammonium sulfate,(NH4)2SO4, and barium nitrate, Ba(NO3)2 react to form a white precipitate.a. Write the balanced chemical equation: b. Write the overall ionic equation: c. Identify the spectator ions: d. Write the net ionic equation:

Write net ionic equations for the reaction that occurs when aqueous solutions of ammonium sulfate,(NH4)2SO4, and barium nitrate, Ba(NO3)2 react to form a white precipitate.a. Write the balanced chemical equation: b. Write the overall ionic equation: c. Identify the spectator ions: d. Write the net ionic equation:

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.78PAE

See similar textbooks

Similar questions

Aqueous hydrogen fluoride (hydrofluoric acid) is used to etch glass and to analyze minerals for their silicon content. Hydrogen fluoride will also react with sand (silicon dioxide). (a) Write an equation for the reaction of solid silicon dioxide with hydrofluoric acid to yield gaseous silicon tetrafluoride and liquid water. (b) The mineral fluorite (calcium fluoride) occurs extensively in Illinois. Solid calcium fluoride can also be prepared by the reaction of aqueous solutions of calcium chloride and sodium fluoride, yielding aqueous sodium chloride as the other product. Write complete and net ionic equations for this reaction.
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
n general terms, what are the spectator ions in a precipitation reaction? Why are the spectator ions not included in writing the net ionic equation for a precipitation reaction? Does this mean that the spectator ions do not have to be present in the solution?
What is the difference between a solute and a solvent?
3.88 One Step in the enrichment of uranium for use in nuclear power plants involves the reaction of UO2 with hydro- fluoric acid (HF) solution. The products are solid UF4 and water. Write a balanced chemical equation for this reaction.
3.94 Calcium carbonate (limestone, CaCO3) dissolves in hydrochloric acid, producing water and carbon dioxide. An unbalanced net ionic equation for this reaction is given below. Balance it. CaCO3(s)+H3O+(aq)H2O(l)+CO2(g)+Ca2+(aq)
A 1.345-g sample of a compound of barium and oxygen was dissolved in hydrochloric acid to give a solution of barium ion, which was then precipitated with an excess of potassium chromate to give 2.012 g of barium chromate, BaCrO4. What is the formula of the compound?
In a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.
When organic compounds containing sulfur are burned, sulfur dioxide is produced. The amount of SO2formed can be determined by the reaction with hydrogen peroxide: H2O2(aq)+SO2(g)H2SO4(aq) The resulting sulfuric acid is then titrated with a standard NaOH solution. A 1 .302-g sample of coal is burned, and the SO2is collected in a solution of hydrogen peroxide. It took 28.44 mL of a 0.1000 M NaOH solution to titrate the resulting sulfuric acid. Calculate the mass percent of sulfur in the coal sample. Sulfuric acid has two acidic hydrogens.
Saccharin (C7H5NO3S) is sometimes dispensed in tablet form. Ten tablets with a total mass of 0.5894 g were dissolved in water. The saccharin was oxidized to convert all the sulfur to sulfate ion, which was precipitated by adding an excess of barium chloride solution. The mass of BaSO4 obtained was 0.5032 g. What is the average mass of saccharin per tablet? What is the average mass percent of saccharin in the tablets?
3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).