Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standardconditions:Fe₂O3(s)+ 3 CO(g) →2 Fe(s)+3 CO₂(g)Round your answer to the nearest kJ.KJx10Thermodynamic properties of pure substances1 (aq)HI(g)Fe(s)Fe²+ (aq)Fe³+ (aq)FeCl₂ (s)FeCl3(s)FeO(s)Fe₂O3(s)Fe3O4(s)Fe(OH)2(s)Fe(OH)3(s)Pb(s)2+Pb²+ (aq)DhBr-(s)-35.226.5Iron0-89.1-48.5-341.8-399.5-272.0-824.2-1118.4-574.04-832.62Lead0-1.7270 7-U1.01.70-78.9-4.7-302.3-334.0-255.2-742.2-1015.4-483.55-696.50-24.4261.0111.5206.627.3-137.7-315.9118.0142.360.7587.4146.487.93104.5664.810.5161 5X0

Answered: Image /qna-images/answer/123a7fe2-4fd6-40f2-a059-78c440d7ec24.jpg

Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standard conditions: Fe₂O3(s) + 3 CO(g) →2 Fe(s) + 3 CO₂(g) Round your answer to the nearest kJ. ☐ kJ X S olo Thermodynamic properties of pure substances 1 (aq) -33.4 26.5 HI(g) Fe(s) Fe²+ (aq) Fe³+ (aq) FeCl₂(s) FeCl3(s) FeO(s) Fe₂O3(s) Fe3O4(s) Fe(OH)2 (s) Fe(OH)3(s) Pb(s) Pb²+ (aq) RbBr (c) Iron 0 -89.1 -48.5 -341.8 -399.5 -272.0 -824.2 -1118.4 -574.04 -832.62 Lead 0 -1.7 770 7 31.0 1.7 0 -78.9 -4.7 -302.3 -334.0 -255.2 -742.2 -1015.4 -483.55 -696.5 0 -24.4 2010 114.3 206.6 27.3 -137.7 -315.9 118.0 142.3 60.75 87.4 146.4 87.93 104.56 64.8 10.5 C X

Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standard conditions: Fe₂O3(s) + 3 CO(g) →2 Fe(s) + 3 CO₂(g) Round your answer to the nearest kJ. ☐ kJ X S olo Thermodynamic properties of pure substances 1 (aq) -33.4 26.5 HI(g) Fe(s) Fe²+ (aq) Fe³+ (aq) FeCl₂(s) FeCl3(s) FeO(s) Fe₂O3(s) Fe3O4(s) Fe(OH)2 (s) Fe(OH)3(s) Pb(s) Pb²+ (aq) RbBr (c) Iron 0 -89.1 -48.5 -341.8 -399.5 -272.0 -824.2 -1118.4 -574.04 -832.62 Lead 0 -1.7 770 7 31.0 1.7 0 -78.9 -4.7 -302.3 -334.0 -255.2 -742.2 -1015.4 -483.55 -696.5 0 -24.4 2010 114.3 206.6 27.3 -137.7 -315.9 118.0 142.3 60.75 87.4 146.4 87.93 104.56 64.8 10.5 C X

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Using the equations Ca(s) + 1/2 0, (g) → CaO (s) AH° = -450 kJ/mol CO, (g) → C (s) + O, (g) AH° = 394 kJ/mol Determine the enthalpy for the reaction C(s) + 2 CaO(s) → CO, (g) + 2 Ca(s). KJ/mol 1 2 3 6. C 7 8 9. +/- х 100 4.
Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standard conditions: 2 HNO₂(g) + O₂(g) → 2 HNO3(g) Round your answer to the nearest kJ. KJ x10 X Ś 00. 18 Ar
Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standard conditions: 2 C,Hg(9)+70,(9)→4CO2(9)+6H,O(0) Round your answer to the nearest kJ. kJ x10
A chemist measures the enthalpy change AH during the following reaction: 2 Al(OH),(s)→Al,03(s) + 3 H,0(1) ΔΗ-41. kJ Use this information to complete the table below. Round each of your answers to the nearest kJ/mol, reaction ΔΗ 4AI(OH), (3) → 2Al,0;(s) + 6H,0(1) 82 kJ Al,0, (;) + 3H,0(1) → 2A1(OH), (s) -41 kJ Al,0, () + H,0() -- AI(OH), (-)
Given the reactions, X(s) + ¿0,(g) – XO(s) AH = -527.1 kJ XCO,(s) → XO(s) + CO,(g) ΔΗ +261.3 kJ what is AH for this reaction? X(s) + ¿0,(g) + CO,(g) XCO,(s) ΔΗ- kJ
A chemist measures the enthalpy change AH during the following reaction: 2 H,O(1) + O2(9)→2 H,O2(1) ДН-196. kJ Use this information to complete the table below. Round each of your answers to the nearest kJ/mol. reaction ΔΗ x10 4H, 0, (1) → 4H,0(1) + 20, (g) kJ 2H,0, (1) → 2H,0(1) + 0, (g) I kJ 1 H,0(1) + 0,(2) - H,0,) H,0, (1) O kJ
Calculate the standard enthalpy change for the reaction at 25 C. Standard enthalpy of formation values can be found in this list of thermodynamic properties. 2 CH,OH(g) + 30,(g) → 2 CO,(g) + 4 H, O(g) 2 CO, (g) + 4 H,0(g) kJ AHixn %3|
Determine the enthalpy change, AH, in kJ, for the following reaction: CS2 (1) + 302 (g) --> CO₂ (g) + 2SO2 (g) given the following thermochemical equations: C(s) + O₂ (g) --> CO₂ (g) ΔΗ = 91.2 kJ S (s) + O₂ (g) --> SO₂ (g) ΔΗ = -382 kJ C(s) + 2S (g) --> CS₂ (1) Do not report units in your answer. Report your answer to one decimal place and include the correct sign in your answer. AH = 82.6 kJ
(b) Calculate the enthalpy change for the reaction C(graphite) + 2 H2(g) → CH4(g) with the help of the enthalpy changes of the following reactions: C(graphite) + O2(g) → CO2(g) ∆H= -393.5 kJmol−1 H2(g) +1/2O2(g) → H2O(l) ∆H = -285.8 kJmol−1 CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(l) ∆H = -890.4 kJmol−1 The temperature is 25 ◦C in all instances.
Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standard conditions: 2 HNO₂(g) + O₂(g) →2 HNO3(g) Round your answer to the nearest kJ. ៣ kJ x10 X
Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab, calculate the reaction enthalpy of this reaction under standard conditions: 2 NaOH(s)+CaCl2(s)→Ca(OH),(s)+2 NaCl(s) Round your answer to the nearest kJ. kJ x10
A chemist measures the enthalpy change AH during the following reaction: 4 Fe(s) + 3 02(g)→2 Fe,O3(s) AH =-320. kJ Use this information to complete the table below. Round each of your answers to the nearest kJ/mol. reaction ΔΗ x10 Fe(s) + 0,6) - Fe,0,(1) O kJ 2Fe,0; (s) – 4Fe(s) + 30, (3) O kJ 4Fe,0, (s) - 8Fe(s) + 60, (3)