The vapor pressure of Substance X is measured at several temperatures: temperature vapor pressure -11. °C 0.0799 atm 2. °C 0.101 atm 15. °C 0.125 atm Use this information to calculate the enthalpy of vaporization of X.

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: Please do all 3D drawing for  1. KrBr2 2. H2CO 3.  NH4+

A: 3D drawing is the structure of the compounds.

Q: UESTION 3 ) Look very carefully at the pictures below: Picture 1 and Pio What does each of the…

A: We have to give information about the given image

Q: Select to Draw mCPBA me a 00 1.0₂ 2.Zn/H₂O* Select to Draw

A: 1. Methylcyclohexene reacts with mCPBA produces epoxide. 2. Methylcyclohexene reacts with warm alc…

Q: 3. The sea water is a good conductor at the optical frequencies like lasers. True False

A: The sea water contains NaCl which is salt which is responsible for conduct electricity due to…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Effective Nuclear Charge Z* Calculation for Oxygen: 1. Atomic Number (Z):  Oxygen has an atomic…

Q: 4. Consider a compound with the formula CNS- a. Draw three possible Lewis dot structures, each one…

A: For the compound CNS-  we have to draw three Lewis structures. In the three structures, the central…

Q: Go to the interactive. Use the Single Collision tab to represent how the collision between monatomic…

A: (a)

Q: (1-1) (10-11) 146.44 g mol = ☐

A:

Q: Why is it difficult to study the origin of life? Select all that apply. The fossils of the first…

A: Life has only originated once, and we aren't there when it happened.  Only one option.

Q: d) NacEO THE Solvent e) CH3 + NaOCH,CH, HOCH,CH, solvent CI H,C f) CHa CH, H,C

A:

Q: Select to Draw Bu4NF Select to Draw + Select to Draw

A: Reaction - When alcohol with TBDMSCl it is protected. [TBDMSCl is tert-Butyldimethylsilyl…

Q: Ionic Bonds (p. 8-11) 1) An atom that loses one or more electrons from its outermost energy level…

A: Note:  “Since you have posted multiple questions, we will solve first two questions for you. To get…

Q: 8. Question: Chapter: 1 Lesson: 7 1. Based on Figure F01-7-6, what percentage of the incoming solar…

A: Solution - when we see the diagram, 6% of light is reflected by atmosphere . And 16% is absorbed by…

Q: Problem Consider three reactions with their given rate laws below. What is the order of each…

A:

Q: According to valence bond theory (+hybridization), the carbon highlighted (in red) has the following…

A:

Q: NON OU app.101edu.co Maps CH₂CH3 | CH3–C=C=C-H I H Aav ON YouTube n V A G fi C G b ▸ C B AX GdH 2 GD…

A:

Q: COH Spell out the full name of the compound. Submit Request Answer

A:

Q: ▶ Part A Part B Interactive 3D display mode CH3 CH3 H₂C 2-methyl butane C Submit C Spell out the…

A: For IUPAC naming following steps are required -> First of all identify the longest carbon chain.…

Q: rons. The metal atoms gives up their electrons to the whole crystal, creating a structure made up of…

A: Since your question has multiple sub-parts, we will answer the first three sub-parts for you. If you…

Q: H. H O1= sp3, 2 = sp3, 3 = sp3 1 = sp, 2 = sp2, 3 = sp3 O1= sp2, 2 = sp3, 3 = sp2 01=sp2,2 = sp3, 3…

A:

Q: See Figure 11-5. The reaction shown would not happen as written because It would require the…

A: In the given reaction, an alkene is converted to an alkyl bromide.

Q: Part E Give a common name for 0

A: The objective is to determine the common names of the given compound.

Q: Are polymers today becoming more sophisticated in structure? Why or why not?

A: Polymers basically are large macromolecules synthesized from their respective fragments or monomers…

Q: لم يتم الاجابة عليه بعد الدرجة من 2 علم هذا السؤال Which one of the following statements about…

A: Density is intensive property because it is the ratio of two extensive property which is mass and…

Q: Proteins have complex three-dimensional structures. These polymers are held into these specific…

A:

Q: The angles between sp^3 orbitals are ________.

A: sp3 hybrid orbitals are oriented at bond angle of 109.5° from each other

Q: Cooler bags are quite useful on a hot day when one goes to the beach in Strand. You notice that a…

A: The solution is given below -

Q: Question 2: What is the preferred IUPAC name of the compound in Figure 2? [Numbers are separated by…

A:

Q: !!! Question 2 Not yet answered Marked out of 6.00 Flag question a) C,HJNH, + H,O → C,H,NH5 + OH-…

A: First, we need to identify the type of reaction for each equation. The reactions can be classified…

Q: 2. Calculate AH for the following in the same way you did in #1. 2 H2O (g) a. CO2 (g) + 4 H2 (g) →…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: A sample of an unknown compound is vaporized at 200. °C. The gas produced has a volume of 1760. mL…

A:

Q: A new band sensation is playing a concert and recording it for a live album to be released this…

A: Amplitude of a sound wave is also part of singing. When someone sings with a greater amplitude…

Q: Pd(OAc)2 (cat.) (t-Bu)₂P (cat.) NaOf-Bu toluene, RT

A: The given palladium catalysed reaction is known as Buchwald -Hartwig animation reaction . The…

Q: Although most animals and some plants detect and respond to sound vibrations, the precise…

A: The hearing range of human ears is 20 to 20,000 Hz or 0 dBHL to 20 dBHL, if the range exceeds 20…

Q: Question 8: Calculate the number of protons, neutrons and electrons in the following atoms. Element…

A:

Q: S-37. Aşağıdaki şıklardan hangisinde moleküllerin bazlık kuvvetleri küçükten büyüğe olacak şekilde…

A: To determine the basicity strength of molecules we must understand the  factors that affect…

Q: 1) HNO3, H2SO4

A: HNO3 + H2SO4 is nitration mixture benzene gives nitrobenzene with nitration mixture, it is…

Q: Styles Organic compounds tend not to mix with water. What is the reason for this chemical…

A: Organic compounds tend to mix with water. What is the reason for this chemical characteristic of…

Q: Which of the following combination of the IUPAC name and structure is INCORRECT?

A: As per the guidelines if multiple questions posted , first question is allowed to answer, please…

Q: Use the Chemical Appendix at the back of the Lab Manual to determine the precautions that must be…

A: In laboratory we use different chemicals but to use all these chemicals we have to take care of…

Q: The difference between a covalent and an ionic bond is that the covalent always donates its…

A: There are two types of bond Ionic bond Covalent bond Ionic bond is formed when one atom looses…

Q: What is the anti, gauche, eclipe, and total eclipse. Explain how.

A: The given project is Sawhorse projection.   When we keep an eye and see the molecule from the point…

Mass Spectrometry

This process is an instrumental method in which a sample is changed to fast moving positive ions by electron bombardment. The charged particles vary due to their different mass to charge ratio and are estimated with the help of this difference. It is also called mass spectroscopy.