22 The figure represents the spontaneous evaporation of nitrogen in which liquid nitrogen, N2(1), becomes gaseous nitrogen, N2 (g ):N2()- N2 (g )What are the signs (+ or -) of AH,ASand AGfor this process?8 888O AH=-, AS= +, AGO AH= -, AS= -, AGAH= +, AS= +, AGO AH= -, AS= -, AG= +ΔΗ= +, AS= +, AG= +O O O O O

22. Given reaction, N2(l) → N2(g)

The figure represents the spontaneous evaporation of nitrogen in which liquid nitrogen, N2 (/ ), becomes gaseous nitrogen, N2 (g ): N2 (I)- N2 (g ) What are the signs (+ or -) of AH AS ,and AG for this process? 0008 888 Ο ΔΗ = -, AS = +, AG ΔΗ =-, AS = -, AG Ο ΔΗ = +, AS = +, AG Ο ΔΗ = -, AS =-, AG O AH = +, AS = +, AG O O O OO

The figure represents the spontaneous evaporation of nitrogen in which liquid nitrogen, N2 (/ ), becomes gaseous nitrogen, N2 (g ): N2 (I)- N2 (g ) What are the signs (+ or -) of AH AS ,and AG for this process? 0008 888 Ο ΔΗ = -, AS = +, AG ΔΗ =-, AS = -, AG Ο ΔΗ = +, AS = +, AG Ο ΔΗ = -, AS =-, AG O AH = +, AS = +, AG O O O OO

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section: Chapter Questions

Problem 42QRT

See similar textbooks

Similar questions

A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
Define the standard enthalpy of formation. What are standard states for elements and for compounds? Using Hess's law, illustrate why the formula Hreaction=npHf(products)nfHf(reactants) works to calculate H for a reaction.
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
When a gas expands, what is the sign of w? Why? When a gas contracts, what is the sign of w? Why? What are the signs of q and w for the process of boiling water?
A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Three gas-phase reactions were run in a constant-pressure piston apparatus as shown in the following illustration. For each reaction, give the balanced reaction and predict the sign of w (the work done) for the reaction. . If just the balanced reactions were given, how could you predict the sign of w for a reaction?
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
Given 2Cr2O3(s)4Cr(s)+3O2(g)H=+2269.4kJ (a) What is the heat of formation of chromium(III) oxide? (b) What is H for the formation of 13.65 g of chromium (III) oxide?