Synthesize 2-Ethyl-3-methyloxirane from dimethyl(propyl)sulfonium iodide using the necessary organic or inorganic reagents. Draw the structures of the compounds.
Q: Pls help asap
A: Q.11The reaction between a carboxylic acid and an amine forms an amide -CONH2. This reaction…
Q: 8. Draw all the resonance forms for each of the fling molecules or ions, and indicate the major…
A: Approach to solving the question:Systematically apply each method to determine unique coordinates…
Q: Write down three most common errors in thermogravimetric analysis. Identify them as systematic or…
A: Step 1: Thermogravimetric Analysis (TGA) : Thermogravimetric Analysis (TGA) is a widely used…
Q: Q1: a) Arrange the compounds in order of decreasing pKa, highest first. ОН ΟΗ ῸΗ дон ОН ОН CI Br
A: The pKa of a compound reflects its acidity—higher pKa means weaker acidity. The factors influencing…
Q: We added a brown solution of Br2 to one of our products, and the brown color disappeared. This…
A: 1) The brown color of bromine (Br2) solution disappears when it reacts with an unsaturated compound,…
Q: What are the missing reagents for the spots labeled 1 and 3? Please give a detailed explanation and…
A:
Q: Liquid chromatography has been used to track the concentration of remdesivir (a broad-spectrum…
A:
Q: The following equations represent the formation of compound MX. What is the AH for the electron…
A:
Q: For the decomposition reaction of N2O5(g): 2 N2O5(g) → 4 NO2(g) + O2(g), the following mechanism has…
A: The given reaction mechanism consists of four steps. The first step is the decomposition of N2O5…
Q: In the following reaction, the OH- acts as which of these? NO2-(aq) + H2O(l) ⇌ OH-(aq) +…
A:
Q: Predict the final product. If 2 products are made, list which should be “major” and “minor”. **see…
A: Step 1: Step 2: Step 3: Step 4:
Q: Polar solutes are most likely to dissolve into _____, and _____ are most likely to dissolve into…
A: In chemistry, the principle of solubility is often summarized by the phrase 'like dissolves like'.…
Q: Pls help.
A:
Q: Which of the following are descriptions of possible starting material for this reaction? H ? trace…
A:
Q: Explain why the S-F bond strength is 367 kJ/mol in SF2 and 329 kJ/mol in SF6.
A: The S-F bond strength in SF2 and SF6 can be explained by considering the molecular structure and the…
Q: When N,N-dimethylaniline is treated with bromine both the ortho and para products are observed.…
A: Reaction with Bromine (Br₂ / FeBr₃) Amine (-N(CH₃)₂) is an electron-donating group.Electron-donating…
Q: At 300 K, in the decomposition reaction of a reactant R into products, several measurements of the…
A: The order of a reaction is a term used to describe the relationship between the rate of a chemical…
Q: Predict major product(s) for the following reactions. Note the mechanism(s) of the reactions (SN1,…
A: Step 1: Step 2: Step 3: Step 4:
Q: Which of the following is the most acidic transition metal cation? Group of answer choices Fe3+…
A: In the context of transition metal cations, acidity is related to the ability of the cation to…
Q: Assign all the protons
A:
Q: Draw the resulting product(s) from the coupling of the given radicals. Inlcude all applicable…
A: Here, two radicals combines together to generate a new single bond between two oxygen atoms. Hence,…
Q: Aromatic Compunds for Organic ChemistryDraw the sigma complex of the following general reaction:…
A: Step 1: When benzene reacts with an electrophile (E+) in an electrophilic aromatic substitution…
Q: k₁ Given the reaction R₂ R + R, indicate k-1 (A). the rate law with respect to R2: (B). the rate law…
A: The given reaction is R2 -> R + R. This is a first-order reaction where a molecule of R2…
Q: Draw the line-angle formula of cis-2,3-dichloro-2-pentene. Then, draw the line-angle formula of…
A: Step 1:The skeletal structure, also known as the skeletal formula or line-angle formula, is a simple…
Q: Ppplllleeeaaasssseeee helllppp wiithhh thisss Organic chemistryyyyyy I talked like this because AI…
A: Step 1: Analyze the IR SpectrumIdentify key peaks:Look for the most prominent peaks and note their…
Q: Predict the organic reactant of X and Y that are involved in the reaction below, and draw the…
A: To determine the organic reactants X and Y, let's analyze the given reaction step by step.Step 1:…
Q: Can you please explain this problem to me and expand it so I can understand the full Lewis dot…
A: The steric number (SN) is given by: SN=(Number of sigma bonds)+…
Q: Calculate the pH of 0.450 M KOH.
A: The problem is asking us to calculate the pH of a 0.450 M KOH solution. KOH is a strong base, which…
Q: Michael Reactions 19.52 Draw the products from the following Michael addition reactions. 1. H&C CH…
A:
Q: Draw the products formed when the following alkene is treated with 03 followed by Zn, H₂O. Be sure…
A: Answer: When an alkene is treated with ozone both the sigma and pi bonds of the double bond break…
Q: For the photochemical halogenation reaction below, draw both propagation steps and include the…
A:
Q: I would like my graphs checked please. Do they look right? Do I have iodine and persulfate on the…
A: In the first graph which is log [I-] vs log [t], please notice that there are negative values for…
Q: P A student claims the right-hand side of the reaction in the drawing area below shows the product…
A: Step 1: The product given is: This compound can be formed using the Claisen condensation reaction.…
Q: Synthesize the compound 4-ethyl-2-[(4-ethylphenyl)diazenyl]phenol (azo dye), using benzene and…
A: The synthesis of 4-ethyl-2-[(4-ethylphenyl)diazenyl]phenol (an azo dye) using benzene and acetyl…
Q: please draw the arrows
A: Below is the mechanism for the given reaction with proper arrows drawn.Step 1
Q: Q1: Answer the questions for the reaction below: ..!! Br OH a) Predict the product(s) of the…
A: D) What occurs to the SN1 response rate in each of these instances:1:change the substrate to…
Q: LTS Solid: AT=Te-Ti Trial 1 Trial 2 Trial 3 Average ΔΗ Mass water, g 24.096 23.976 23.975 Moles of…
A: Step 1: Determine Heat Released (q)The heat released by the reaction is absorbed by the water, so we…
Q: -lease help me answer the questions in the photo.
A:
Q: 1. Consider the following molecular-level diagrams of a titration. O-HA molecule -Aion °° о ° (a) о…
A:
Q: answer all the questions with explanation
A: a. What is meant by Ki? Ki (inhibition constant) tells us how strongly a compound sticks to a…
Q: Indicate the rate expressions for reactions that have order 0, 1, and 2.
A: In chemistry, the order of a reaction refers to the power dependence of the rate on the…
Q: Pls help asap
A: Structural Diagrams: a. 2,3-Dichloropentanal Pentanal: A five-carbon aldehyde with the -CHO…
Q: 1Help
A:
Q: In the drawing area below, draw the major products of this organic reaction: If there are no major…
A: Step 1:Our aim is to draw the product of the given reaction.The hydrogen attach to the terminal…
Q: Use the reaction coordinate diagram to answer the below questions. Type your answers into the answer…
A: A) D has higher energy than F. It means that some of the energy has been lost or given out by…
Q: Can the target compound at right be efficiently synthesized in good yield from the unsubstituted…
A:
Q: How could you get from the starting material to product? A. OH B. OH Ό
A:
Q: In an equilibrium mixture of the formation of ammonia from nitrogen and hydrogen, it is found that…
A: :
Q: Identify as E1 or E2 and write the mechanism.
A: Reaction 1:The reaction follows a conceted E2 elimination mechanism.Because a Strong base…
Q: O-Nitrophenol was distilled over with the steam in our experiment while the other isomer did not.…
A: Question 1The ortho- and para-isomers of nitrophenol can be separated by steam distillation.…
Synthesize 2-Ethyl-3-methyloxirane from dimethyl(propyl)sulfonium iodide using the necessary organic or inorganic reagents. Draw the structures of the compounds.
Step by step
Solved in 2 steps with 3 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
- Draw the formulas of the reactants and products of the reaction: 2-ethylbutanoyl bromide with excess ethylmagnesium bromide and heating the product with concentrated H2SO4.Give an IUPAC and common name for each of the following naturally occurring carboxylic acids: (a) CH3CH(OH)CO2H (lactic acid); (b) HOCH2CH2C(OH)(CH3)CH2CO2H (mevalonic acid).Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Synthesize each compound.You may use benzene, acetylene (HC≡CH), ethanol, ethylene oxide, and any inorganic reagents.11) Synthesize 2-methyl-3-hydroxycyclohexone from cyclohexone, methyl iodide, and inorganic precursors.
- Draw the structure of each product from the reaction of benzene with 2-chloro-1-methylcyclohexane using AlCl 3 as the catalyst and Identify the major product.Describe how 3-methyl-1-phenyl-3-pentanol can be prepared from benzene. You can use any inorganic reagents and solvents, and any organic reagents provided they contain no more than two carbons.Synthesize methyl ethyl acetylene using acetylene.
