reaction mechanism, synthesis of salicylic acid from methyl salicylate, NaOH and H2SO4

What would the major product be

When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels, at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.

Give the major organic product for the following reaction

Give the name for the major organic product formed by the following reaction: + HI

2,4-Pentanedione is a considerably stronger acid than is acetone (Chapter 19). Write a structural formula for the conjugate base of each acid and account for the greater stability of the conjugate base from 2,4-pentanedione.

When reducing 4-nitrobenzaldehyde to 4-nitrobenzyl alcohol, the reducing agent of choice is LIAIH4 (lithium aluminum hydride) because it reduces the nitro group to an amine. O 1) True O 2) False

denydrati O elimination, HBr dehydrohalogenation, HCI QUESTION 29 What is the mass of the organic fragment of 2-chloro -3-phenyl-prop-1-yne? 150 amu 77 amu 115 amu 126 amu 116 amu QUESTION 30 In an SN1 experiment similar to the "SN2Competition Experiments", four alkyl halides several days to give each reaction time to go to completion. The starting alkyl halides are as follows: A. 2-chlorobutane + H20 B. 2-bromobutane + H20 C. 1-bromo-1-phenylmethane + H20 → D. 1-bromobenzene + H20 → E. 2-bromo-3-methylbutane + H20 → The products were separated and identified using gas chromatography. The peak of wh O A Click Save and Submit to save and submit. Click Save All Answers to save all answers.

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.