Question 4 A solution is made by dissolving 60.0 g of AlCl3 in enough water to make 250.0 mL of solution. How many moles of chloride ions are in 5.00 mL of solution? O a. 1.25 x 10-3 mol Ob. 1.80 x 10-2, mol Ⓒc. 2.70 x 10-2 O d. 9.00 x 10-3 mol O e. 3.00 × 10-3 mol 1 points mol

Q: 8. What is the final concentration of the mixture?

A:

Q: special sample of household vinegar contained 7.3% acidity. Determine the number of moles of acetic…

A: %mass of Aceticacid = 7.3 %  Mass of sample = 242 g Mass of Acetic acid= 242 × 7.3/100    = 17.7 g

Q: 1. A term used to describe the amount of substance. 2. The relationship between the mass or quantity…

A: In chemistry and every other scientific or engineering subject a long term is given a specific name…

Q: RITROE 19 K 39.30 132 20 Ca 21 Sc Ti Molarity (M M₁ = M₂V₂ Convert the mass 1570.3 mg of a chunk of…

A:

Q: Limestone is mostly consist of CaCo, You find that a sample of limestone weighing 153 mg gives 147…

A:

Q: What is the molarity of each solution? a. 39 g of KCl dissolved in enough water to give 375 mL of…

A: * molarity = Moles / volume of solution in L   * Moles = Mass / molar mass   By using this relation…

Q: 1 Pbzt 2. Pb2+ + HCI +NaCl 3. Pb?+theat 4. Pb+ NazSo 5. Pb2+ 十ーのUIfuric a さ . P62T+ NaOH + NaOlH -…

A:

Q: 6. A 25.00 mL aliquot of concentrated hydrochloric acid (11.7 M) is added to 175.00 ml of 3.25 M…

A: No of moles of HCl in aliquot = Molarity x Volume in L…

Q: In the standardization of NaOH solution, 0.521l g potassium hydrogen phthalate (204.22 g/mol) is…

A:

Q: How many grams of 2.50 % by mass aqueous HF (20.0 g/mol) are required to provide 20 % excess to…

A: In the given equation-Th4++4F-→Th F4SHere  one mole  Th4+  required  4  mole  of F-  or  4 mole of…

Q: part a b and c?

A: This can be considered as dilution because the final concentration of the concentrated HCl solution…

Q: 14. Calculate the formula mass of (NH4)2HPO4 (one type of fertilizer). A. 132 amu B. 46 amu C. 124…

A: Formula mass is the sum of the atomic masses of atoms in its empirical formula. The empirical…

Q: mass of solute

A:

Q: 4. If a given sample of silver and fluorine ideally combine to form 0.6mol of AgF, what is the…

A:

Q: a. How many moles of CaCl2 does 4.74 mL of 0.100 M CaCl2 solution contain? mol CaCl₂ b. How many…

A:

Q: What is the Molarity of 92.5 g of CuSO4.5H2O? O a. 0.45 O b. 0.37 О с. 0.23 O d. 0.15

A: Problems on Molarity

Q: A student weighs out a 17.2 g sample of ZnSO4, transfers it to a 500. mL volumetric flask, adds…

A: mass of zinc sulfate (ZnSO4) = 17.2 gVolume of the solution = 500. mL = 0.500 LMolarity of the zinc…

Q: An aqueous solution of hydrochloric acid contains 24% HCl by mass. Compute for the number of moles…

A:

Q: 4. what is the percent concentration(mass/volume) of a 2.5 M NaOH solution?

A:

Q: 37. Find the number of millimoles of solute in 3.0 L of 3.76 x 10-3 M KMN04. * a. 11.28 millimoles…

A:

Q: Given the following equation, what is the correct form of the conversion factor needed to convert…

A: The mol-to-mol ratio of a reaction is the ratio of the coefficients for a particular compound that…

Q: 1. Mol NaOH = L HCl * Molarity of HCl * Stoichiometry (mol NaOH / mol HCl) Molarity of HCL= 0.116…

A: 1.

Q: How many moles of solute are contained in each solution?   a. 120 mL of a 0.49 M NaNO3 solution:…

A: Molarity is a concentration term for a solution. The molarity of the given solution is defined as…

Q: One gram of each of the following compounds is mixed with 100mL of water. Which will form solutions…

A: Solutions of : Cu(OH)2PCl5Ca(CH3CO2)2C3H8NaNO3

Q: Determine the mass of RbNO3 necessary to prepare 500.0 mL of a solution that is 0.138 M RbNO3…

A: The volume of the solution is = 500.0 mL The molarity of the solution is = 0.138 M The required mass…

Q: moles o

A:

Q: 5)_NH; +_0:→__NO + _H20 _0:>. 0.3359 mol of ammonia will make how many grams of water? H:0

A: Balanced chemical equation is: 4NH3+5O2→4NO+6H2O This means that, 4 moles of ammonia gives 6 moles…

Q: 2) If an unknown sample contains 39.04% sulfuric acid by mass, then a 1.000 g of that sample would…

A:

Q: Sodium chloride, silver nitrate, lead (1I) nitrate, zinc sulfate, and magnesium chromate were…

A:

Q: 5)_NH; + 0.3359 mol of oxygen will make how many grams of water? NÓ +

A: Moles = Mass / Molar mass Mass = Moles X molar mass.

Q: Which of the following is an example of a soluble chloride? Formula must be written correctly for…

A: The solubility of the salts is compared by comparing the solubility products of the different salts.…

Q: 98. Write a balanced, complete ionic equation showing the neutralization of sulfuric acid with…

A:

Q: 7. The correct name for an aqueous solution of HBr is and correct formula for perchloric acid is a.…

A: The correct name for aqueous solution of HBr is Hydrobromic acid.

Q: Calculate the amount of grams of NH3 that can be made if 4.00 g of H₂ are completely consumed…

A: Given reaction 3H2 + N2 -------> 2 NH3 4g of H2 used To determine : amount of NH3 produced.

Q: e Determine the concentration of the sodium hydroxide solution in the Erlenmeyer flask. (Enter your…

A:

Q: 33. 0.2347 g of an ionic compound MX (135.32 g/mol) completely dissociates into its corresponding…

A: I request you to pls repost question (37)

Q: Which of the following is an example of a soluble chloride? Formula must be written correctly for…

A: Generally most of chlorides are soluble except lead and silver chlorides. and K2Cl and MgCl are…

Q: S + 6 HNO3 --> H₂SO4 + 6 NO2 + 2 H₂O In the above equation how many moles of water can be made when…

A: The given balanced chemical equation is S + 6 HNO3 → H2SO4 + 6 NO2 + 2 H2O The number of moles water…

Q: what is the volume of the solution?

A: Since you have posted multiple questions, we are entitled to answer the first only. Please repost…

Q: What mass of oxalic acid, H2 C204, is required to prepare 350. mL of a solution that has a…

A: The molarity of the oxalic acid (H2C2O4) solution is = 0.20 M The volume of the solution is = 350.…

Q: 2 KMN0, + 16 HCI → 2 KCI + 2 MnCl, + 8 H,0 + 5 Cl, a. What is the ratio between KMnO, and H,0? 4:2 1…

A: In given balance reaction , ratio of compounds eaisly calculated

Q: An unknown diprotic acid requires 53.32 mL of 0.117 M NaOH to completely neutralize a 1.147 g…

A: In an acid-base neutralization reaction the milimole of H+ and OH- are always consumed in same…

Q: 4) Which solution has the same number of moles of HCI as 37.5 mL of 0.200 M solution of HCI? A. 12.5…

A:

Q: Calculate the molarity of each of these solutions.

A: Step : 1           Calculate the molarity of each of these solutions.

Q: What is the final concentration of 1.0 L of 4.0 M HNO3 solution that was diluted to 8.0 L.

A:

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.