Please give me answers in 5min I will give you like sure Question 3Suppose you're given the following information:ATP+ H₂O-ADP + Pi AG" -30.5 kJ/mol.Phosphoenolpyruvate + H₂O- Pyruvate + PitAG"-61.9 kJ/molWhat would the AG" be for the reaction phosphoenolpyruvate + ADP pyruvate + ATP? Please answer in units of kJ/mol, but do not includethe units in your answer.

Answered: Image /qna-images/answer/3e25e7ff-1dee-4310-9ed8-5a5d5f52363a.jpg

Question 3 Suppose you're given the following information: ATP+ H₂0-ADP + Pi AG"=-30.5 kJ/mol Phosphoenolpyruvate + H₂0-Pyruvate + Pi What would the AG" be for the reaction phosphoenolpyruvate + ADP-pyruvate + ATP? Please answer in units of kJ/mol, but do not include the units in your answer. AG"-61.9 kJ/mol

Question 3 Suppose you're given the following information: ATP+ H₂0-ADP + Pi AG"=-30.5 kJ/mol Phosphoenolpyruvate + H₂0-Pyruvate + Pi What would the AG" be for the reaction phosphoenolpyruvate + ADP-pyruvate + ATP? Please answer in units of kJ/mol, but do not include the units in your answer. AG"-61.9 kJ/mol

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 9RQ: Define the standard enthalpy of formation. What are standard states for elements and for compounds?...

See similar textbooks

Similar questions

When a fossil fuel burns, is that fossil fuel the system? Explain your answer.
When glucose, C6H12O11, is metabolized to CO2 and H2O in living systems, the first step is the conversion of glucose to glucose-6-phosphate. glucose+H3PO4glucose-6-phosphate+H2OG=13.4kJ This nonspontaneous reaction can be made to proceed by coupling it with the hydrolysis of ATP. ATP+H2OADP+H3PO4G=31.0kJ (a) Write an equation for the coupled reaction and calculate G°. (b) Estimate the number of moles of ATP required to convert glucose to glucose-6-phosphate.
9.83 A student performing a calorimetry experiment combined 100.0 mL of 0.50 M HCl and 100.0 mL of 0.50 M NaOH in a coffee cup calorimeter. Both solutions were initially at 20.0°C, but when the two were mixed, the temperature rose to 23.2°C. (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 mL of 0.50 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCl and 100.0 mL of 1.00 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why?
What is the difference between G, G, and G 298 for a chemical Change?
A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?
The overall reaction that occurs when sugar is metabolized is C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) For this reaction, H° is -5650 kJ and G° is -5790 kJ at 25°C. (a) If 25% of the free energy change is actually converted to useful work, how many kilojoules of work are obtained when one gram of sugar is metabolized at body temperature, 37°C? (b) How many grams of sugar would a 120-lb woman have to eat to get the energy to climb the Jungfrau in the Alps, which is 4158 m high? ( w=9.79103mh, where w= work in kilojoules, m is body mass in kilograms, and h is height in meters.)
For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).
The enthalpy of vaporization for water is 40.65 kJ mol-1. As a design engineer for a project in a desert climate, you are exploring the option of using evaporative cooling. (a) If the air has an average volumetric heat capacity of 0.00130 J cm-3 K-1, what is the minimum mass of water that would need to evaporate in order to cool a 5 m? 5 m room with a 3 m ceiling by 5°F using this method? (b) Is this a spontaneous or nonspontaneous process?
Consider the following reaction: N2(g)+3H2(g)2NH3(g) Calculate G for this reaction under the following conditions (assume an uncertainty of 1 in all quantities): a. T=298K,PN2=PH2=200atm,PNH3=50atm b. T=298K,PN2=200atm,PH2=600atm,PNH3=200atm
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
9.96 Most first aid "cold packs" are based on the endothermic dissolution of ammonium nitrate in water: NH4NO3(s)NH4+(aq)+NO3(aq) H= 25.69 kJ A particular cold pack contains 50.0 g of NH4NO3 and 125.0 g of water. When the pack is squeezed, the NH4NO3dissolves in the water. If the pack and its contents are initially at 24.0°C, what is the lowest temperature that this bag could reach? (Assume that the ammonium nitrate solution has a specific heat of 4.25J g-l K-l, and that the heat capacity of the bag itself is small enough to be neglected.)
Define the standard enthalpy of formation. What are standard states for elements and for compounds? Using Hess's law, illustrate why the formula Hreaction=npHf(products)nfHf(reactants) works to calculate H for a reaction.