Predict the reagent(s) needed to produce these products. OH HOT!!!! + || !!! OH Q Q 1. BH3-THF A B 0 D Ш 2. H2O2, NaOH 1. Hg(OAc)2, H2O 2. NaBH4, NaOH MCPBA MCPBA 2. H3O+ OsO4 (catalytic) H2O2 OH Q Done
Q: please draw
A: If you have any confusion related to any step , you can ask!
Q: Rank these compounds from lowest oxidation level on the left to highest oxidation level on the…
A: Detailed explanation: Here,The oxidation level of carboxylic acid is highest because it contains 2…
Q: Add the appropriate curved arrows for bond formation /bond breakage. Show all nonbonding electrons.…
A: Step 1: Formation of secondary carbonium ion:The bromine is better leaving group which is removed…
Q: when methyl vinyl ether reacts with a strong acid, H adds to C2 instead of C1 or the oxygen atom.…
A: Methyl vinyl ether is an organic compound with the formula CH3OCH=CH2. When it reacts with a strong…
Q: Provide the IUPAC name of the sulfide shown. × S 3
A:
Q: General polymerization processes. Describe stepwise polymerization and chain polymerization.
A: Polymerization is a process of reacting monomer molecules together in a chemical reaction to form…
Q: Please correct answer and don't use hand raiting
A: Approach to solving the question: This is a simple halogenation reaction of alkyne in which halogen…
Q: The bonding in the NH4+ ion may best be described in terms of 1. sp2 hybridization for the…
A: Hybridization is a concept in chemistry that describes the process of combining atomic orbitals to…
Q: If the reaction shown below favors the formation of reactants, which is the strongest acid in the…
A: In a chemical reaction, the strongest acid is the species that donates a proton (H+) most readily.…
Q: ded HW O Macmillan Learning Rank the structures in order of decreasing electrophile strength. Η CF3…
A:
Q: which newman projections match the molecule above? (multi select question) OH о H3C. H I- OH CH3…
A:
Q: Indicate the correct answer.a) There are graphite compounds that conduct electricity perpendicularly…
A: Graphite is a form of carbon where the carbon atoms are arranged in layers. These layers are held…
Q: Draw the major products of the elimination reaction below. If elimination would not occur at a…
A: The given elimination reaction follows the E2-Elimination mechanism. It's a type of elimination…
Q: Give detailed mechanism Solution with explanation needed. don't give Ai generated solution. avoid…
A: Step 1:The reactant is a tertiary alcohol and the reagent is p-toluenesulfonic acid (PTSA), also…
Q: sam
A:
Q: 2. Write a complete mechanism for the reaction shown below. Br₂ CHCH Br
A:
Q: Please correct answer and don't use hand raiting
A: Step 1:The reactant is an alkene, while the reagent is ozone (O3) for the first step and zinc and…
Q: 14
A:
Q: Don't use AI.
A: (a) H₃PO₄ (Phosphoric acid)Bonding Structure: Phosphoric acid encompasses a phosphorus (P) atom at…
Q: Indicate the species in solution for Li2CrO4 (aq)
A: Step 1:
Q: Please correct answer and don't use hand raiting and don't use Ai solution
A: Approach to solving the question: In order to answer the question, you need to first define what…
Q: None
A: To solve for the concentrations of HSO₄⁻, SO₄²⁻, and H⁺ in a 0.39 M KHSO₄ solution, given that Ka…
Q: Give detailed mechanism Solution with explanation needed..don't give Ai Generated solution
A: Approach to solving the question:Alkenes can undergo many addition reactions which follow specific…
Q: Part 1 of 2 Give the number of protons, neutrons, and electrons in each isotope. Krypton-85 Protons:…
A:
Q: Which of following statements are consistent with the Kinetic Molecular Theory? 1. Gases are…
A: The Kinetic Molecular Theory is a model that explains the behavior of gases. It is based on the…
Q: Write the systematic name of each organic molecule: structure مشه name о ☐
A: Thank you.
Q: Can you provide steps and explanations?
A: Carbon radical in the intermediate is sp2 hybridised. The molecular orbital diagram shows the…
Q: Carbonic acid, H2CO3 is a weaker acid than sulfurous acid, H2SO3. Which of the following reactions…
A: In chemistry, the strength of an acid refers to its ability to donate protons (H+ ions). A strong…
Q: How can acid be dilluted?
A: The process of diluting an acid involves mixing a concentrated acid solution with water to decrease…
Q: Please correct answer and don't use hand rating
A:
Q: Write the systematic (IUPAC) name for each of the following organic molecules: structure…
A: Here are the IUPAC names for the compounds you provided: CH3-CH2-CH2-CH2-CH2-CH2-CH(SH)-CH3 IUPAC…
Q: Indicate the correct answer. The more regular the tacticity, the more the polymera) inhibits its…
A: Tacticity is a term used in polymer chemistry to refer to the arrangement of pendant groups along…
Q: What are the products of theses reactions. Please draw the mechanism for the reactions.
A: Step 1: Step 2: Step 3: Step 4:
Q: At constant temperature, a sample of helium at 760. mmHg in a closed container was compressed from…
A: The problem is asking for the new pressure of a helium sample that was compressed from 5.00 L to…
Q: Please correct answer and don't use hand raiting
A: First set: Other Violation. Violated hunds rule. It is 4p thus it has three ml (-1,0,+1). Electrons…
Q: Can someone help me draw this reaction structure in Chem draw upload please
A: Please comment if you require any further assistance or clarification.Thank you.
Q: complete the mechanism for a fischer esterification by drawing in the curved arrows. I am stuck on…
A: So your answer:Thank you.
Q: 3. What is the major organic product obtained from the following reaction? OH 2 Na EC-CH3 H₂C C C…
A:
Q: Don't use AI.
A:
Q: It takes 957 J to raise the temperature of 35.7 g of sample by 5.7°C.The specific heat capacity of…
A:
Q: Add substituents to draw the conformer below, then rotate the back carbon to provide the structure…
A: Step 1:The Newman conformation of the given molecule is drawn by adding the substituents and then…
Q: Calculate the number of molecules in 3.00 molesmoles H2SH2S. Express your answer numerically in…
A: In chemistry, a mole is a unit of measurement for amount of substance. It is defined as exactly…
Q: Complete the given table
A:
Q: Predict the major products of this organic reaction. Be sure you use wedge and dash bonds when…
A: PAA is Peracetic acid.Peracetic acid reacts with cyclohexene to produce cyclohexene oxide, an…
Q: Calculate the molar solubility of Ag2CO3 in a solution buffered to a pH of 5.10. (Ksp (Ag2CO3)=8.1…
A: Approach to solving the question: ionic Equilibrium Detailed explanation: Key references: Atkins
Q: OH H3C OH CI CH3 CH2CH3 CH2CH3 CI H3C H3C HO HO OH CH3 CH2CH3 H H3C. H3C - σ- CH3 OH CH2CH3 H
A:
Q: what is the starting reagents or products?
A:
Q: Please correct answer and don't use hand rating
A:
Q: A student proposes the following mechanism for a nucleophilic substitution reaction: H HO :0: но…
A: Step 1: ReactionSN1 : It is two step reaction and having carbocation intermediate. Products are…
Q: Please correct answer and don't use hand raiting
A: Step 1:In quantum mechanics, each electron in an atom is described by a set of four quantum numbers:…
Step by step
Solved in 2 steps with 1 images
- Which products are most likely to form in this reaction? NH2 H2N NaNH2 NH2 liq. NH3 II O1, II & II O II & II O1& || OI & II3. What is the product of the following sequence of reactions? CI. I A) I CI NaOH B) II C) III NaNH, FO ||| D) IV IV NH₂What is the major organic product formed in the following sequence of reactions? A, B, C, or D?
- HO 2. Complete the following reactions by filling in any missing reactants, reagents or products. a) Zn(Hg) conc. HCI b) OH olamee hoosla bas im 0.011o om me Im 0.01 1o smulov c) awiboa lo omnl C sid gnien) to omi 010 CHO. РСС CH,Cl,Choose the reaction that will not proceed as written. OH H. 1) xs LIAIH4, ether a) H,C 2) H+, H20 NH2 b) H,C H3C HO, H3C CI pyridine OH H+ 1) xs CH3MgBr,ether + NH4+ + CH3CH2OH c) H3C H20 d) H;C NH2 OH OCH2CH3 2) H+, H20 H3C CH3 CH heat O b O a O d3.
- 2. Provide the product of each of the following reactions or reaction sequences. H H H Br. Br H H H 1. xs NaNH, 2. EtCl 3. H₂, Lindlar's catalyst 1. NaNH2 2. Mel 3. 9-BBN 4. 202, NaOH 1. NaNH, 2. Mel 3. H₂SO4, H₂O, HgSO4 1. NaNH, 2. Mel 3. NaNH, 4. Etl 5. Na, NH3 1. Br₂ 2. XS NaNH2 3. Etl 4. H₂, Lindlar's catalyst 2Give detailed Solution with explanation of all options..I need detailed explanation of all options in the box...don't give Handwritten answerB. Choose the major product for reaction I C. Choose the correct reagent for reaction IIA. HBrB. Br2/hvC. NBS/hvD. HBr/ROORE. B or C