Q: Write the systematic (IUPAC) name for each of the following organic molecules: structure…
A: Here are the IUPAC names for the compounds you provided: CH3-CH2-CH2-CH2-CH2-CH2-CH(SH)-CH3 IUPAC…
Q: jrj
A: Ring expansion SN1 reaction:The given starting material is primary alkyl halide, and the weak…
Q: calculate the energy difference for an electron moving from the n=1 to the n=3 level. Is this an…
A: In an atom, electrons occupy certain energy levels. The energy levels are often referred to as…
Q: Can you explain it? Provide examples with the various steps and explanations. How halogens affect…
A: Approach to solving the question: Halogen Detailed explanation: Key references: Clayden
Q: a) Please draw the products form the following reaction catalyzed by a restriction enzyme including…
A:
Q: Please correct answer and don't use hand raiting
A: A. Solution: Answer: The Volume of 0.02 N sulfuric acid required = 15 mLAlkalinity as CaCO3 = 150…
Q: Aktiv Learning App ← → C ↑ b Register for bartleby | bartleby x+ https://app.aktiv.com Draw an alkyl…
A:
Q: Show work with explanation needed . don't give Ai generated solution
A: Step 1:The organic compounds have same molecular formula and having different bonding connectivity…
Q: Add substituents to draw the conformer below, then rotate the back carbon to provide the structure…
A: Step 1:The Newman conformation of the given molecule is drawn by adding the substituents and then…
Q: 6.13: In addition to solving the problem please give brief explanation for concepts and solution if…
A:
Q: How many resonance structures can be drawn for the perbromate ion (BrO4) in which the central…
A: Step 1: Step 2: Step 3: Step 4:
Q: a solution prepared by combining 45.0 g of BaCl2 with enough water to prepare a 750.0 mL of…
A: First, we need to calculate the number of moles of BaCl2. The molar mass of BaCl2 is 208.23 g/mol.…
Q: Please correct answer and don't use hand raiting
A: Any molecule that can rotate the plane of polarized light clockwise or anticlockwise on passing…
Q: In vacuum, all electromagnetic radiation travels at the speed of light c; and can be characterized…
A: The statement is about the properties of electromagnetic radiation in a vacuum. It states that all…
Q: (c) Br H HO H 1. 1% NaOH, H₂O OH H3C LOH 2. H3O H3C (substance A) (substance B)
A:
Q: Which compound is diamagnetic? по a. K₁[Co(CN)6] Co 2+, strong CN, as impaired b. [Cr(NH3)6]SO4 Cr…
A: To determine which compound is diamagnetic, we need to check the electronic configurations and the…
Q: Draw a reasonable mechanism for the given reaction
A: We get a sodium salt (Sodium acetate) and chloroform as the final products.Diazomethane is…
Q: Identify the oxidation states of all elements in: 1. Potassium dichromate (K2Cr2O7) 2. Oxygen…
A: The oxidation state of an atom is a measure of the degree of oxidation of an atom. It is defined as…
Q: 9. please dont submit AI. answer as its wrong
A:
Q: 2. Please answer. NO AI. Please Check on answer to confrim its correct.
A: If you have any confusion related to any step, you can ask!
Q: If you inject 7 uL of 7 mg/mL solution of diazepam onto the above column with the conditions…
A: To calculate the mass of diazepam that enters the column when you inject 7 µL of a 7 mg/mL solution,…
Q: Please correct answer and don't use hand raiting
A: formyl anion Lewis & its resonance structure
Q: Please correct answer and don't use hand rating
A: Step 1: ReactionEpoxides are cyclic ethers with a three-atom ring, made up of two carbon atoms and…
Q: Determine the products for each. Label each carbonyl group as a ketone or aldehyde
A:
Q: 6d7: In addition to solving the problem please give brief explanation for concepts and solution if…
A:
Q: Don't use AI.
A: Approach to solving the question: First of all protonation will occur at the oxygen of carbonyl to…
Q: Can the alkyl halide in the drawing area be made in one step from an alcohol, without losing…
A: Step 1: Step 2: Step 3: Step 4:
Q: Please correct answer and don't use hand raiting
A: Theoretical yield= mole of limiting reagent*Me of product.A+B=C, where A is limiting reagent and…
Q: Write net ionic equations for the reaction that occurs when aqueous solutions of ammonium…
A:
Q: Predict the major products of both organic reactions. Be sure to use wedge and dash bonds to show…
A:
Q: mtl
A:
Q: 1. A gas sample occupies a volume of 25.0 cc under normal atmospheric pressure at room temperature.…
A: The problem is asking us to find the new volume of a gas when the pressure is increased by 20% at…
Q: Please correct answer and don't use hand raiting
A: An uncompetitive inhibitor binds only to the enzyme-substrate complex, which leads to a decrease in…
Q: For each reaction below, predict the major product(s). If the product has asymmetric centers, show…
A: Step 1:Addition of BH3 to the unsymmetrical alkene follow Markonikov rule but less substituted…
Q: Help me with my study guide
A: a) TLC with 50% Conversion (50/50 EtOAc/hexanes solvent)At 50% conversion:Lane 1 (starting…
Q: PLEASE ANSWER THIS QUESTION!!!!
A: Step 1: The solution uploaded is -Step 2:1.39 ppm (triplet, 3 H): This signal corresponds to the…
Q: Calculate the spin-only magnetic moment for the following complexes: a. [Co(NH3)6] 3+ b. [RhF6]³-…
A: To calculate the spin-only magnetic moment (μeff) for these complexes, we can use the…
Q: How would I rank in decreasing order
A: The first compound ( A) is an aldehyde (-CHO) The second compound (B) is an amide (-CONHCH3)The…
Q: draw the structures below: 3-cyclopropyl-5-propylcyclopentene (4Z, 6E) - 3-bromo-4-ethyl-5-methyl…
A:
Q: Please correct answer and don't use hand rating
A:
Q: Please correct answer and don't use hand raiting
A:
Q: Please correct answer and don't use hand raiting
A: a) By examining the diagram in this way, you can interpret which compositions will yield single,…
Q: Roughly sketch a plot of G vs. T for the two forms of CaCO3. Sketch G vs. T for the two forms under…
A: Steps for the Sketch1. Label the Axes:The x-axis is temperature (T), while the y-axis represents the…
Q: Answer the followings BY EQUATIONS: 1. Starting from 2-bromopropane prepare Three from the…
A:
Q: 4.17 Use Eqs. (4.30), (4.42), and (4.48) to show that (aСplaP) = -T (0² V/T²) p. The volumes of…
A: Problem StatementWe are tasked with proving the relationship:(∂P∂CP)T=−T(∂T2∂2V)Pusing…
Q: (this is aleks module practice not part of a graded assignment)
A:
Q: pleace solve it and explain in detail
A: Addition polymerization reaction:The monomer reacts with each other without losing any atoms to form…
Q: Please correct answer and don't use hand raiting
A: Step 1: Define the system and components.The system is Me-S-O, with the following components: Me…
Q: Draw the skeletal structure of the alkene that yield the following product. HBr ? Br
A: Answer:Explanation:The mechanism is shown below:The π-electrons from the π-bond abstracts the proton…
Q: Complete the following alpha decay equations Polonium-211:
A:
Step by step
Solved in 2 steps with 1 images
- 3. Both El and E2 reactions are possible with 3° alkyl halides. Which elimination mechanism would be favored by the base NaOH? Show the curved arrow mechanism leading to both regioisomers. Draw the energy diagram for this reaction and include the transition state structure leading to each of the possible products. Indicate which one would be favored and use the energy diagram to explain your reasoning. How would you favor the other regioisomer? Br z odd NaOHplease get the e1 and e2 product of this reaction18. Draw a reasonable mechanism and product(s) of the following E1 reaction. CH3NH₂ El
- When hydroxide is used as the base to carry out an E2 reaction on a vinylic halide, the reaction usually needs to be heated significantly. As shown below, such a reaction involving the E isomer typically requires much higher temperatures. Why is this so? Z isomer E isomer Br КОН КОН 70 °C 200-230 °C Br Br 70% 67%Draw the product of the E2 reaction shown below. Include the correct stereochemistry. Ignore any inorganic byproducts. H CH3 H Br Ph CH2CH3 NaNha MConsider the E1 elimination products. Draw the minor product. Br Ꭰ H₂O
