name and explain the intermolecular forces for H3CCH2CH2CH3CH2CH2CH2CH3

Q: H3C CH3 Но. HO For this molecule, draw the structure of the pair of enantiomers.

A:

Q: H3C HO.

A: The question is based on the concept of IUPAC naming of the organic compounds.   there are certain…

Q: what is IPUAC name for CH3CH2CH2CH2CH2CH2CH2-O-CHCH3?

A: General formula for ether functional group : R-O-R' where R and R' are same or…

Q: 2. The atomic number of fluorine is 9. How many electrons does an ion of fluorine have if it is…

A: How many electron in F- ?

Q: Can you walk me through how to draw the 3D structure of CH3CH2CHO

A: The given molecule is organic molecule and have aldehyde functional group. The name of the given…

Q: How would the molecular structure look like for this compound CH3CH₂CH=CHCH₂CH₂OH

A: Given a compound : CH3CH2CH=CHCH2CH2OH. We have to draw the molecular structure of the compound.…

Q: Provide the IUPAC name for the following compound: CH3CH2CH2CH2CH(CH3)CH2CH2CH(CH2CH3)2

A: Step 1:Long chain has 10 carbons So called dec   Step 2: Step 3: Step 4:

Q: What is the IUPAC name of the following? CH3CH₂CH₂CH₂CH₂COCH3

A: Rules for IUPAC nomenclature of ester:• The name of the ester depends on the alcohol and carboxylic…

Q: How many triacylglycerols can be prepared from three different fatty acids? Draw all possible…

A: The molecular structure of triacylglycerol consists of glycerol nucleus which is esterified with…

Q: For each pair of molecules, determine which would have the higher boiling point and explain why. a)…

A: To determine the molecule with higher boiling point with reasoning. Given Pair: (a) CH3CH2CH2CH3 Vs…

Q: ? BrCH2CH2CH2CH=CH2 CH3

A: The objective of this question is to identify the reagent and their roles in a multi-step synthesis…

Q: Take a look at this molecule, and then answer the questions in the table below it. CH₂OH CH₂OH H H H…

A: Step 1: Step 2:Step 3: Step 4:

Q: Explain what a β-1,4-glycosidic bond is made up of? (ie. Breakdown how a bond is considered a…

A: A β-1,4-glycosidic bond or linkage is formed by covalent bonding of oxygen to the Carbon 1 of one…

Q: Physical description: This substance is a colorless but fragrant liquid that is oily in appearance.…

A: A question based on IR spectroscopy and NMR spectroscopy. Based on the given details of IR spectrum…

Q: draw the bond line drawing of CH3CH2CH2CH2CO2H

A: bond line structural formula is another way of structural representation of organic compounds. Here,…

Q: Which of the attached molecules can hydrogen bond to anothermolecule like itself?

A: Given:-              Which of the attached molecules can hydrogen bond to another molecule like…

Q: Classify each of the molecules in the table. molecule CH3-CH₂-CH=CH-CH₂-CH=CH-(CH₂)9 O=C H…

A: Given are organic compounds.All the given compounds contain carboxylic acid functional group and…

Q: CH3CH2OH

A:

Q: CH₃COOCH₂CH₂CH(CH₃)₂ + HCl →

A: The given reaction is ester hydrolysis reaction in presence of an acid catalyst. Esters are…

Q: Identify the functions present in this compound.

A: Introduction: A functional group is a group of atoms that form parts of chemical molecules, that is…

Q: What is the IUPAC name of the following compound? CH2CH2CHCH2CH2 OH OH OH

A: If you have any questions let me know in comment box thankyou for your question.

Q: Arrange the following compounds in order of increasing boiling point. CH3CH₂CH₂CH₂C-OH…

A: Boiling point is directly proportional to the relative strength of intermolecular forces such as…

Q: 22. A. Name the reactants in the following chemical reaction. CH₂ CH₂ || OH + NH \ CH3 CH3 A, 스…

A: Carboxylic acid reacts with amine to form amides.

Q: SH CH3CH2CH2CH2

A:

Q: How

A: We will choose correct option

Q: The organic compound in Question 10 is classified as a(n) Select one: O halogenated hydrocarbon…

A: The compounds that contain hydrogen and carbon along with functional groups or multiple bonds are…

Q: What type of organic compound is CH₂CH₂OCH₂CH₂CH.,?

A: The organic compound is:                               We have to identify the type of the compound.

Q: 1. Consider the following molecules. Clearly circle the glycosidic bond on each structure. In the…

A: Let us first define Glycosides - a compound that is made by a simple sugar compound and another…

Q: 3. Draw the chemical structures of the products for each of the following chemical reaction.…

A: Given is organic reaction. The given reactant is ester.The given reagent is sodium hydroxide.

Q: Physical description: This substance is a colorless but fragrant liquid that is oily in appearance.…

A: A question based on IR spectroscopy and NMR spectroscopy. From the given set of data the most…

Q: 2. Which of the following compounds does NOT contain a toxicophore group?

A: A toxicophore group is a chemical moiety or a part of a compound that is responsible for the toxic…

Q: CH3(CH,)11OH

A: Carboxyilic acid on reaction with alcohol gives ester