Multiple Choice: How many atoms of carbon-14 are in the average human body given the following four facts: 1. Carbon makes up 23% of the human body by weight. 2. The average human body has a mass of 150 kg. 3. There are approximately 83 moles in every kg of carbon. 4. One in every trillion atoms of carbon is carbon-14. a. 1,89 X 10 (exponent 15) b. 1,72 X 10 (exponent 15) c. 1,89 X 10 (exponent 16) d. 1,72 X 10 (exponent 16)

Q: According to NASA, the space shuttle's external fuel tank for the main propulsion system carries…

A: For determining the amount of limiting reactant or excess reactant, the mole ratio of reactants in a…

Q: The use of freons is being phased out because of the damage these compounds do to the stratospheric…

A: a.

Q: When Sample A of methane, CH4CH4, decomposes, it produces 35.0 gramsgrams of C and 2.04 gramsgrams…

A: Given that -  Sample A of methane, CH4 gas has following composition  -  Carbon, C = 35.0 grams…

Q: Use the balanced equation, N2 + O2 -->  2NO, to answer the following question. How many grams of…

A: The objective of this question is to determine the amount of O2 in grams that will completely react…

Q: How many mols of H2 can be made from the complete reaction of 4 mols of AL? Given: 2AL +…

A: Since from the above reaction we can see that 2 moles of Al is reacting to form 3 moles of H2  hence…

Q: How many moles of nitrogen monoxide can be made from 10.18 moles of nitrogen dioxide? nitrogen…

A: Given, Moles of NO2=10.18 moles  Moles of NO= ?

Q: Which of the following statements is not correct? A. 12.01 g of C contains 6.022 x 1023 atoms of C…

A: 1 mol of any substance contains Avogadro's number of particles (atom/ion/molecule etc.). Avogadro's…

Q: Balance the chemical equation shown below. What is the coefficient that should be placed in front of…

A: ANSWER :

Q: CH3CH₂CH(CH2CH3)CH₂CH₂CH3 Draw the molecule on the canvas by choosing buttons from the Tools (for…

A: Given -> 1-> CH3CH2CH(CH2CH3)CH2CH2CH3 2-> CH3CH(CH3)CH2CH2OH

Q: Consider aspirin (acetylsalicylic acid), C9H8O4 a. How much does one mole of aspirin weigh, in…

A: The formula of aspirin given is C9H8O4.

Q: 1. A sample of 2 tsp of sugar (C12H22O11) weighs 9.00 g. a. Record each step needed to calculate the…

A: We can calculate the moles of any substance from the following formula : Moles of substance = mass…

Q: This is the chemical formula for nickel tetracarbonyl (a powerfully poisonous liquid used in nickel…

A: Given :- chemical formula of nickel tetracarbonyl = Ni(CO)4  No.of.moles of C in sample = 47. mol…

Q: What is the molar mass of X3(ZT5)3 in grams per mole? (Assume that the molar mass of X is 33.81…

A: This question is related to stoichiometry. In the given question, it is asked to calculate the molar…

Q: 2. A sample of 2 tsp of sugar (C12H22O11) weighs 9.00 g. a. Record each step needed to calculate the…

A: a. Given that: Mass of sugar = 9.00 g. Molar mass of C12H22O11 = 12×12 + 22×1 + 11×16Molar mass of…

Q: 2 H2 (9) + O2 (9) 2 H20 (g) Hydrogen gas and oxygen gas react to form water vapor as shown in the…

A: The balanced reaction given is, =>

Q: One 55 g serving of a cereal provides 267.0 mg of sodium, which is 11.6 % of the recommended daily…

A: Convert 11.6% into 100% using mathematical interpretation & convert mass into moles by using the…

Q: Generating Gan Students run the experiment shown below in an open flesk, CaC, was reacted with…

A:

Q: When the following equation is balanced correctly, what is the coefficient in front of Ba(NO3)2?…

A: Steps on how to use the trial and error method to balance the chemical equations:Write the…

Q: T Questions 1-2: KC103 2 KCI+ 02 1. How many grams of O2 are produced from the decomposition of 8.56…

A: There are four questions are given but I'm solving first two questions according to the guidelines…

Q: How many moles are in 135.2g of H2O? Round to 2 decimal places.

A: Mole represent the quantity of a substance.It is used for fundamental particle like as proton…

Q: This is the chemical formula for methyl tert-butyl ether (the clean-fuel gasoline additive MTBE):…

A:

Q: Pressure Volume Temperature (K) Sample Substance (atm) (L) 02 600 1 Kr 273 1 3. B Хе 273 2 Which 2…

A: According to Avogadro's law- At a given condition of temperature and pressure, the volume occupied…

Q: Gaseous methane (CH4) reacts with gaseous oxygen gas (0₂) to produce gaseous carbon dioxide (CO₂)…

A:

Q: An unknown compound comprised of osmium and chlorine is 40.11% osmium by mass. a. If you assume…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall be…

Q: In the following reaction, 2H2 (g) + O2 (g) → 2 H20 (g), how many moles of oxygen (O2) would be…

A: Two moles of hydrogen gas reacts with one mole of oxygen gas to form two moles of water.

Q: 3.)  Sand consists mainly of silicon dioxide. When sand is heated with an excess of coke (carbon),…

A: Here in the given Question we need to write the balanced equation for the reaction and have to find…

Q: 8. To obtain pure lead, lead (II) sulfide is burned in an atmosphere of pure oxygen. The products of…

A: Here lead sulphide reacts with oxygen to give lead and sulphur trioxide.

Q: A chemist weighed out 22.5 g of calcium. Calculate the number of moles of calcium she weighed out.…

A:

Q: What is the molar mass of X3(ZT4)4 in grams per mole? (Assume that the molar mass of X is 22.2 grams…

A:

Q: mmonium nitrate: NHẠNO3(s) N20(g) + 2H209) How many g of dinitrogen monoxide can be made from 1.62 x…

A: In this question, we want to determine the mass of N2O gas in gram unit.  You can see details…

Q: The formula for nitrogen dioxide is NO₂2. a. How many grams of nitrogen are present in 3.85 moles of…

A: Here, we have to calculate the mass of nitrogen that is present in 3.85 moles of NO2 and the number…

Q: Carbon dioxide gas reacts with dihydrogen monoxide, producing carbon tetrahydride gas and oxygen…

A:

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.