Method 2: Calculating AG from AH and Sº data.● If you have AHP and So data, you can use Hess' Law and calculate AH and AS, then calculateAGº.Ex. Calculate AG for the reaction below at 25 °C, given4NO(g) →→→→→2N₂O(g) + O₂(g)AH (kJ/mol)+90.37+81.570.00SubstanceNO(g)N₂O(g)O₂(g)So (J.mol-¹K-¹)210.6220.0205.0

Answered: Image /qna-images/answer/640d11ac-8665-4410-9265-b6957b227b18.jpg

Method 2: Calculating AG from AH and Soº data. ● If you have AHP and So data, you can use Hess' Law and calculate AH° and AS, then calculate AG°. Ex. Calculate AG for the reaction below at 25 °C, given 4NO(g) 2N₂O(g) + O2(g) Substance NO(g) N₂O(g) O₂(g) AH (kJ/mol) +90.37 +81.57 0.00 So (J.mol-¹K-¹) 210.6 220.0 205.0

Method 2: Calculating AG from AH and Soº data. ● If you have AHP and So data, you can use Hess' Law and calculate AH° and AS, then calculate AG°. Ex. Calculate AG for the reaction below at 25 °C, given 4NO(g) 2N₂O(g) + O2(g) Substance NO(g) N₂O(g) O₂(g) AH (kJ/mol) +90.37 +81.57 0.00 So (J.mol-¹K-¹) 210.6 220.0 205.0

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 73E: Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) +...

See similar textbooks

Related questions

Q: A student dissolves 11.3 g of ammonium nitrate (NH,NO,) in 250. g of water in a well-insulated open…

Q: A student dissolves 13.0 g of ammonium nitrate (NH4NO3) in 300. g of water in a well-insulated open…

A: An exothermic reaction is a chemical reaction that releases energy into the surrounding environment,…

Q: A student dissolves 13.2 g of potassium hydroxide (KOH)in 250. g of water in a well-insulated open…

Q: A student dissolves 11.8 g of potassium chloride (KCI) in 200. g of water in a well-insulated open…

A: A reaction will be exothermic if the energy of the system decreases from its value, that is, heat…

Q: A student dissolves 12.5 g of sodium hydroxide (NaOH)in 200. g of water in a well-insulated open…

Q: A student dissolves 11.3 g of ammonium nitrate (NH,NO,) in 250. g of water in a well-insulated open…

Q: Calculate AG for the reaction 2 H₂S(g) + 5O₂(g) For the following conditions at 25°C: PH₂S=0.0004…

Q: Calculate ΔHrxn values for the following equations using standard enthalpies of formation (ΔHof)…

A: Consider the given balanced reaction as; CaCl2.2H2O s → Ca2+aq + 2 Cl-aq + 2 H2O l Standard enthalpy…

Q: 50.0 mL of 1.45 mol/L NaOH and 50.0 mL of 1.45 mol/L HA are added to a coffee cup calorimeter, and…

Q: Calculate the standard enthalpy of formation of NaHCO3(s) given the following information:…

Q: Deterioration of buildings, bridges, and other structures through the rusting of iron costs millions…

A: Enthalpy is thermodynamics property which measure the energy of the reaction and is additive in…

Q: Which of the following statements is correct about this reaction at 25°C and 1 atm? NHNO:(s) →…

A: The reaction given is,

Q: A student dissolves 14.6 g of potassium chloride (KCl)in 300. g of water in a well-insulated open…

A: Given that, The mass of the KCl is ms = 14.6 g, The mass of the water is mw = 300. g. The initial…

Q: For the reaction: 2 NO (g) + O2 (g) N204 (g), calculate AG° (in kJ) at 800 К. O - 77.4 O + 8.2 O -…

Q: When 5.03 of solid potassium hydroxide are dissolved in 100.0 mL of distilled water in a coffee-cup…

Q: Given: 2 Ag+(aq) + Cu(s) ⟶ 2 Ag(s) + Cu2+(aq) ΔGo = -88.66 kJ/mol Calculate the…

A: The given balanced redox Chemical Reaction is - 2 Ag+(aq) + Cu(s) ⟶ 2 Ag(s) + Cu2+(aq)…

Q: A student dissolves 11.4 g of sodium hydroxide (NaOH)in 200. g of water in a well-insulated open…

Q: 1. Calculate the heat evolved when 13.56g of oxygen gas (O2) is used to burn white phosphorus at…

A: 1) Given, P4(s) + 5O2(g) → P4O10(s), ΔH = -3013 kJ/mol ∆H is in negative (-) which indicate the…

Q: A student dissolves 14.1 g of sodium hydroxide (NaOH)in 250. g of water in a well-insulated open…

A: Since the temperature of the water increases after the reaction, hence heat is evolved in the…

Q: A student dissolves 14.6 g of potassium chloride (KCl)in 300. g of water in a well-insulated open…

A: Given that, The mass of the KCl is ms = 14.6 g, The mass of the water is mw = 300. g. The initial…

Q: From the AE given for 25 °C, calculate AH at the same temperature for the reaction: 2 NO2 (g) → 2 NO…

Q: The Haber process to produce ammonia involves the equilibrium N₂(g) + 3 H₂(g) → 2 NH3(g) For this…

Q: Calculate AG°xn for the following reaction of white phosphorous with HCl. 2P (s) + 10HC1 (g) → 2PCI5…

A: The balanced reaction taking place is given as, => 2 P (s) + 10 HCl (g) -------> 2 PCl5 (g) +…

Q: A student dissolves 14.9 g of potassium hydroxide (KOH)in 300. g of water in a well-insulated open…

A: It is based on the concept of dissolution of salt. Dissolution is a process where a salt is…

Q: Calculate the AH for the following reaction: 2 H2S(g) + 3 02(g) → 2 H201) + 2 SO2(9) Use the data…

Q: Part A The value of AG" at 281.0 °Cfor the formation of phosphorous trichloride from its constituent…

Q: A student dissolves 11.7 g of potassium hydroxide (KOH)in 200. g of water in a well-insulated open…

Q: Consider the following: SiH 4(g) +2 O 2(g) SiO 2(s) +2 H 2 O (l) Delta H^ 0 =-1516.86 kJ/mol a.…

A: The reaction given is

Q: A student dissolves 11.3 g of potassium hydroxide (KOH)in 300. g of water in a well-insulated open…

A: Answer: To solve this question it is important to understand that water will be considered as…

Q: A student dissolves 11.6 g of sodium hydroxide (NaOH)in 250. g of water in a well-insulated open…

Q: Solid silver oxide, Ag2O(s), decomposes at temperatures in excess of 300 ∘C, yielding metallic…

A: The balanced decomposition reaction of silver oxide (Ag2O) at temperature in excess of 3000C can be…

Q: 1. Given the following reactions and data, use addition (similar to Hess's Law) to calculate AG° for…

A: First we would write balanced chemical equation for formation of 1 mol of H3PO4 (s) . Then we…

Q: Calculate AH, at 25 °C for CO(g), given that A Hº at 25 °C for the reaction below is -809.9 kJ. 2CH…

A: Given Equation- 2CH4+O2+4Cl2->8HCl+2CO. ∆H=-809.9KJ

Q: A student dissolves 11.0 g of ammonium chloride (NH, CI) in 200. g of water in a well-insulated open…

Q: A student dissolves 11.8 g of sodium hydroxide (NaOH)in 250. g of water in a well-insulated open…

Q: A student dissolves 12.3 g of ammonium chloride (NH4C1) in 200. g of water in a well-insulated open…

A: Given, The mass of the NH4Cl = 12.3 g Mass of the water = 200 g The molar mass of the NH4Cl = 53.5…

Q: A student dissolves 12.3 g of ammonium chloride (NH4C1) in 200. g of water in a well-insulated open…

A: Answer: For the given dissolution process NH4Cl will be considered as system and water will be…

Concept explainers

Environmental Pollution

Environmental pollution occurs due to some unwanted alteration in the surroundings which results in unfavorable effects on all organisms of that surrounding.

Question

Method 2: Calculating AG from AH and Sº data.
● If you have AHP and So data, you can use Hess' Law and calculate AH and AS, then calculate
AGº.
Ex. Calculate AG for the reaction below at 25 °C, given
4NO(g) →→→→→2N₂O(g) + O₂(g)
AH (kJ/mol)
+90.37
+81.57
0.00
Substance
NO(g)
N₂O(g)
O₂(g)
So (J.mol-¹K-¹)
210.6
220.0
205.0

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Given data

VIEW

Step 2: Explanation:step-1

VIEW

Step 3: Explanation:step-2

VIEW

Step 4: Explanation:step-3

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 5 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)
Define the standard enthalpy of formation. What are standard states for elements and for compounds? Using Hess's law, illustrate why the formula Hreaction=npHf(products)nfHf(reactants) works to calculate H for a reaction.
There are millions of organic compounds known, and new ones are being discovered or made at a rate of morethan 100,000 compounds per year. Organic compoundsburn readily in air at high temperatures to form carbondioxide and water. Several classes of organic compoundsare listed, with a simple example of each. Write a balanced chemical equation for the combustion in O2ofeach of these compounds, and then use the data inAppendix J to show that each reaction is product-favoredat room temperature. From these results, it is reasonable to hypothesize thatallorganic compounds are thermodynamically unstable inan oxygen atmosphere (that is, their room-temperaturereaction with O2(g) to form CO2(g) and H2O() isproduct-favored). If this hypothesis is true, how canorganic compounds exist on Earth?
Shown below is a diagram depicting the enthalpy change of a chemical reaction run at constant pressure. a Is the reaction exothermic or endothermic? b What is the sign of H? c What is the sign of q? d If the reaction does no work, what is the sign of E for this process?
Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate H for the reaction NO(g) + O(g) NO2(g)
Using values of fH and S, calculate rG for each of the following reactions at 25 C. (a) 2 Na(s) + 2 H2O() 2 NaOH(aq) + H2(g) (b) 6 C(graphite) + 3 H2(g) C6H6() Which of these reactions is (are) predicted to be product-favored at equilibrium? Are the reactions enthalpy- or entropy-driven?
For the reaction SF4(g)+F2(g)SF6(g) the value of G is 374 kJ. Use this value and data from Appendix 4 to calculate the value of Gf for SF4(g).
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
When 7.11 g NH4NO3 is added to 100 mL water, the temperature of the calorimeter contents decreases from 22.1 C to 17.1 C. Assuming that the mixture has the same specific heat as water and a mass of 107 g, calculate the heat q. Is the dissolution of ammonium nitrate exothermic or endothermic?
9.83 A student performing a calorimetry experiment combined 100.0 mL of 0.50 M HCl and 100.0 mL of 0.50 M NaOH in a coffee cup calorimeter. Both solutions were initially at 20.0°C, but when the two were mixed, the temperature rose to 23.2°C. (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 mL of 0.50 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCl and 100.0 mL of 1.00 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why?
The value of G for the reaction 2C4H10(g)+13O2(g)8CO2(g)+10H2O(l) is 5490. kJ. Use this value and data from Appendix 4 to calculate the standard free energy of formation for C4H 10(g).