Answered: if i have 2.00 moles of gas at a…

Science

Chemistry

if i have 2.00 moles of gas at a pressure of 5.60 atm and a volume of 9.10 liters, what is the temperature? Show work

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter9: Gases

Section: Chapter Questions

Problem 28E: What is the temperature of an 11.2-L sample of carbon monoxide, CO, at 744 torr if it occupies 13.3...

See similar textbooks

Similar questions

A gas effuses through an opening one-fifth as fast as helium gas effuses through the same opening. (a) Is the gas heavier than helium? (b) What is the molar mass of the gas?
Consider a 5.00-L tank containing 375 g of Ar at a temperature of 25 C. (a) Calculate the pressure in the tank using both the ideal gas law and the van der Waals equation. (b) Which correction term, a(n/V)2 or bn, has the greatest influence on the pressure of this system?
A 275-mL sample of CO gas is collected over water at 31C and 755 mmHg. If the temperature of the gas collection apparatus rises to 39C, what is the new volume of the sample? Assume that the barometric pressure does not change.
38 For a gas sample whose total pressure is 740 torr, what are the partial pressures if the gas present consists of 1.3 mol of N2, 0.33 mol of O2, and 0.061 moI of Ar?
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
A mixture of N2 and Ne contains equal moles of each gas and has a total mass of 10.0 g. What is the density of this gas mixture at 500 K and 15.00 atm? Assume ideal gas behavior.
5.27 A newly discovered gas has a density of 2.39 g/L at 23.0°C and 715 mm Hg. What is the molar mass of the gas?
If 1 cubic foot-28.3 L-of air at common room conditions of 230C and 0.985 bar is adjusted to STP, what does the volume become?
Ethanol, C2H5OH, is produced industrially from ethylene, C2H4, by the following sequence of reactions: 3C2H4+2H2SO4C2H5HSO4+( C 2 H 5)2SO4C2H5HSO4+( C 2 H 5)2SO4+3H2O3C2H5OH+2H2SO4 What volume of ethylene at STP is required to produce 1.000 metric ton (1000 kg) of ethanol if the overall yield of ethanol is 90.1%?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
5-113 Ammonia and gaseous hydrogen chloride react to form ammonium chloride according to the following equation: If 4.21 L of NH3(g) at 27°C and 1.02 atm is combined with 5.35 L of HCI(g) at 26°C and 0.998 atm, what mass of NH4CI(s) will be generated?
The chlorofluorocarbon CCl2F2 can be recycled into a different compound by reaction with hydrogen to produce CCl2F2(g), a compound useful in chemical manufacturing: CCl2F2(g)+4H2(g)CH2F2(g)+2HCl(g) (a) Outline the steps necessary to answer the following question: What volume of hydrogen at 225 atm and 35.5 C would be required to react with 1 ton (1.000103kg) of CCl2F2? (b) Answer the question.