H HHH н-с-с-с-с-н i iii H H H H 1. Consider the following chemical reaction for the combustion of butane: C,H10 + O2 H,O + CO, a) Given the bond energies in the accompanying table, find AH for the formation of 1 mole of water in this reaction. (Note: Assume that the reactants completely dissociate before recombining to form water) SHOW ALL WORK!! b) Is this reaction endothermic or exothermic? How do you know?

H HHH н-с-с-с-с-н i iii H H H H 1. Consider the following chemical reaction for the combustion of butane: C,H10 + O2 H,O + CO, a) Given the bond energies in the accompanying table, find AH for the formation of 1 mole of water in this reaction. (Note: Assume that the reactants completely dissociate before recombining to form water) SHOW ALL WORK!! b) Is this reaction endothermic or exothermic? How do you know?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section4.7: Where Does The Energy Come From?

Problem 4.13CE

See similar textbooks

Similar questions

Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.
What is the heat gained/released at constant pressure equal1o (qp = ?)? What is the heat gained/released at constant volume equal to (qv = ?)? Explain why H is obtained directly from a coffee-cup calorimeter, whereas E is obtained directly from a bomb calorimeter.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
The enthalpy change for the reaction CH4(g)+2O2(g)CO2(g)+2H2O(l) is 891 kJ for the reaction as written. a. What quantity of heat is released for each mole of water formed? b. What quantity of heat is released for each mole of oxygen reacted?
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
9.103 One reason why the energy density of a fuel is important is that to move a vehicle one must also move its unburned fuel. Octane is a major component of gasoline. It burns according to the reaction 2C8H18(l)+25O2(g)16CO2(g)+18H2O(g) H = 1.10104 kJ Starting from this thermochemical equation, describe how you would determine the energy density, in kJ/g, for octane. Be sure to indicate what you would need to calculate or look up to complete this problem.
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
Explain in your own words what is meant by the term entropy. Explain how both matter spread and energy spread are related to the concept of entropy.
For the reaction SF4(g)+F2(g)SF6(g) the value of G is 374 kJ. Use this value and data from Appendix 4 to calculate the value of Gf for SF4(g).