GivenPt2(aq) + 2 ePt(s)Ag (aq) + e → Ag(s)2 H*(aq) + 2e →→ H₂(g)°, = 0.00 VFe2+ (aq) + 2e → Fe(s)= -0.45 VIf the iron-iron ion electrode were the standard for values instead of the hydrogen-hydrogen ion electrode, the standard reduction potentials () for the four half-reactions above, incorresponding order, would be:Select one:O a.O b.+1.20 V- +0.80 VOC.O d.+1.65 V, +1.25 V, +0.45 V, 0.00 V-1.65 V, -1.25 V, -0.45 V, 0.00 V+1.20 V, +0.80 V, +0.45 V, 0.00 V-0.75 V, -0.35 V, -0.45 V, 0.00 V

The standard electrode potential values of the some half cells are given above. Pt2+(aq) + 2e-…

Given Pt² + (aq) + 2 e→→ Pt(s) Ag (aq)+eAg(s) 2 H*(aq) + 2 e -0.00 V Fe2+ (aq) + 2 e 8,-0.45 V If the iron-iron ion electrode were the standard for values instead of the hydrogen-hydrogen ion electrode, the standard reduction potentials (2) for the four half-reactions above, in corresponding order, would be: H₂(g) Fe(s) +1.20 V +0.80 V Select one: O a. +1.65 V, +1.25 V, +0.45 V, 0.00 V O b. -1.65 V, -1.25 V, -0.45 V, 0.00 V O C. +1.20 V, +0.80 V, +0.45 V, 0.00 V O d. -0.75 V, -0.35 V, -0.45 V, 0.00 V

Given Pt² + (aq) + 2 e→→ Pt(s) Ag (aq)+eAg(s) 2 H*(aq) + 2 e -0.00 V Fe2+ (aq) + 2 e 8,-0.45 V If the iron-iron ion electrode were the standard for values instead of the hydrogen-hydrogen ion electrode, the standard reduction potentials (2) for the four half-reactions above, in corresponding order, would be: H₂(g) Fe(s) +1.20 V +0.80 V Select one: O a. +1.65 V, +1.25 V, +0.45 V, 0.00 V O b. -1.65 V, -1.25 V, -0.45 V, 0.00 V O C. +1.20 V, +0.80 V, +0.45 V, 0.00 V O d. -0.75 V, -0.35 V, -0.45 V, 0.00 V

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.18QAP

See similar textbooks

Similar questions

What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
1. If you wish to convert 0.0100 mol of Au3+ (aq) ions into Au(s) in a “gold-plating” process, how long must you electrolyze a solution if the current passing through the circuit is 2.00 amps? 483 seconds 4.83 104 seconds 965 seconds 1450 seconds
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)
An electrode is prepared from liquid mercury in contact with a saturated solution of mercury(I) chloride, Hg2Cl, containing 1.00 M Cl . The cell potential of the voltaic cell constructed by connecting this electrode as the cathode to the standard hydrogen half-cell as the anode is 0.268 V. What is the solubility product of mercury(I) chloride?
You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.