For the reaction SO,Cl2(g) = SO2(g) + Cl2(g) Kp = 2.39 at 100°C A quantity of SO¿Cl2 was introduced into a 10.0-L container and brought to equilibrium at 100°C. The TOTAL pressure at equilibrium was measured to be 7.70 atm. Assuming ideal behavior, what is the mole fraction of Cl2 in the equilibrium mixture? 4 2.

For the reaction SO,Cl2(g) = SO2(g) + Cl2(g) Kp = 2.39 at 100°C A quantity of SO¿Cl2 was introduced into a 10.0-L container and brought to equilibrium at 100°C. The TOTAL pressure at equilibrium was measured to be 7.70 atm. Assuming ideal behavior, what is the mole fraction of Cl2 in the equilibrium mixture? 4 2.

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter5: Introduction To Chemical Equilibrium

Section: Chapter Questions

Problem 5.2E: 5.2. What is the difference between a static equilibrium and a dynamic equilibrium? Give examples...

See similar textbooks

Similar questions

At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
Explain why the development of a vapor pressure above a liquid in a closed container represents an equilibrium. What are the opposing processes? How do we recognize when the system has reached a state of equilibrium?
You place 0.600 mol of nitrogen, N2, and 1.800 mol of hydrogen, H2, into a reaction vessel at 450C and 10.0 atm. The reaction is N2(g)+3H2(g)2NH3(g) What is the composition of the equilibrium mixture if you obtain 0.048 mol of ammonia, NH3, from it?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of CI2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm? Cl2(g)+Br2(g)2BrCl(g)KP=4.7102
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?