intseBookPrintReferencesEnter your answer in the provided box.The rate constant for the following elementary reaction is 2.4 x 10° M2.5¹ at 25°C:2C(g)2A(g) +B(g) --0AG (kJ/mol)A 85.972B0C 54.414What is the rate constant for the reverse reaction at the same temperature?0.07 M21

Answer: Gibbs free energy change for a reaction is equal to the difference Gibbs free energy of…

Enter your answer in the provided box. The rate constant for the following elementary reaction is 2.4 x 10° M25¹ at 25°C: 2A(g) +B(g) → 2C(g) - 0 AG (kJ/mol) f A 85.972 B0 C 54.414 What is the rate constant for the reverse reaction at the same temperature?

Enter your answer in the provided box. The rate constant for the following elementary reaction is 2.4 x 10° M25¹ at 25°C: 2A(g) +B(g) → 2C(g) - 0 AG (kJ/mol) f A 85.972 B0 C 54.414 What is the rate constant for the reverse reaction at the same temperature?

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter18: Chemical Kinetics

Section: Chapter Questions

Problem 23P

See similar textbooks

Similar questions

The direct reaction of iron(III) oxide. Fe2O3, to give iron and oxygen gas is a nonspontaneous reaction; normally, iron combines with oxygen to give rust (the oxide). Yet we do change iron(III) oxide, as iron ore, into iron metal. How is this possible? Explain.
For the following reaction C(s)+2H2(g)CH4(g) K=0.26 at 1000C (3 significant figures). What is the equilibrium constant at 750C (3 significant figures)?
The reaction of carbon monoxide with hydrogen to form methanol is quite slow at room temperature. As a general rule, reactions go faster at higher temperatures. Suppose that you tried to speed up this reaction by increasing the temperature. (a) Assuming that rH does not change very much as the temperature changes, what effect would increasing the temperature have on rSsurroundings? (b) Assuming that rS for a reaction System does not change much as the temperature changes, what effect would increasing the temperature have on rSuniverse?
Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.
Describe how you would expect the spontaneity (G) for each of the following reactions to behave with a change of temperature. a Phosgene, COCl2, the starting material for the preparation of polyurethane plastics, decomposes as follows: COCl2(g)CO(g)+Cl2(g) b Chlorine is added to ethylene to produce dichloroethane, a solvent: Cl2(g)+C2H4(g)C2H4Cl2(l)
In Chapter 3, we discussed the conversion of biomass into biofuels. One important area of research associated with biofuels is the identification and development of suitable catalysts to increase the rate at which fuels can be produced. Do a web search to find an article describing biofuel catalysts. Then, write one or two sentences describing the reactions being catalyzed, and identify the catalyst as homogeneous or heterogeneous.
Consider the reaction N2O4(g)2NO2(g). Would you expect this reaction to be endothermic or exothermic? Why? N2O4 is a colorless gas; NO2 is red-brown. Would you expect a mixture of these gases to become more or less red-brown as you raise the temperature? Explain.
For the endothermic reaction AB(g)A(g)+B(g), the following represents a reaction container at two different temperatures. Which one (I or II) is at the lower temperature?
Why are there no changes specified for Ni in Exercise 13.61, part (f)? What property of Ni does change?
The recycling of polymers represents only one industrial process that allows creating order in one location by creating greater disorder at some other location, often at a power plant. List three other industrial processes that must create disorder in the surroundings to generate the desired material.
Silicon forms a series of compounds analogous to the al-kanes and having the general formula SinH2n+2. The first of these compounds is silane, SiH4, which is used in the electronics industry to produce thin ultrapure silicon films. SiH4(g) is somewhat difficult to work with because it is py-ropboric at room temperature—meaning that it bursts into flame spontaneously when exposed to air. (a) Write an equation for the combustion of SiH4(g). (The reaction is analogous to hydrocarbon combustion, and SiO2 is a solid under standard conditions. Assume the water produced will be a gas.) (b) Use the data from Appendix E to calculate ? for this reaction. (c) Calculate G and show that the reaction is spontaneous at 25°C. (d) Compare G for this reaction to the combustion of methane. (See the previous problem.) Are the reactions in these two exercises enthalpy or entropy driven? Explain.
a. Using the free energy profile for a simple one-step reaction, show that at equilibrium K = kf/kr, where kf and kr, are the rate constants for the forward and reverse reactions. Hint: Use the relationship G = RT ln(K) and represent kf and kr, using the Arrhenius equation.(K=AeEa/RT) b. Why is the following statement false? A catalyst can increase the rate of a forward reaction but not the rote of the reverse reaction.