During a neutralization reaction, 1 L of 1 mol/L HCl at 298 K was mixed with 0.95 L of 0.95 mol/L NaOH at 298 K. (a) Determine the enthalpy of neutralization using the relevant standard enthalpies of formation given below. дн? (кJ/mol) Substance HС(ад) NaOH(aq) Na*(aq) Cl'(aq) Nacl(s) H2O(1) ОН (ад) C2(aq) H*(aq) -167.2 -470.1 -240.1 -167.2 -411.0 -285.8 -230.0 -23.40 -0.00 (b) What are the concentrations of HCl and NaOH left after neutralization? (c) If the specific heat of water is 4.184 J/g-C at 298K, what is temperature of the final solution, assuming there is no heat loss?

During a neutralization reaction, 1 L of 1 mol/L HCl at 298 K was mixed with 0.95 L of 0.95 mol/L NaOH at 298 K. (a) Determine the enthalpy of neutralization using the relevant standard enthalpies of formation given below. дн? (кJ/mol) Substance HС(ад) NaOH(aq) Na(aq) Cl'(aq) Nacl(s) H2O(1) ОН (ад) C2(aq) H(aq) -167.2 -470.1 -240.1 -167.2 -411.0 -285.8 -230.0 -23.40 -0.00 (b) What are the concentrations of HCl and NaOH left after neutralization? (c) If the specific heat of water is 4.184 J/g-C at 298K, what is temperature of the final solution, assuming there is no heat loss?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Explain how the heat measured in the given problem differs from the enthalpy change for the exothermic reaction described by the following equation:HCl(aq) + NaOH(aq) ⟶ NaCl(aq) + H2 O(l)
Calculate the change of enthalpy for the reaction 2AI (s) + 3C12 (g) --> 2AICI3 (s) from the following reactions: Reaction 1: 2AI (s) + 6HCI (aq) --> 2AICI3 (aq) + 3H2 (g) Change in enthalpy: -1049 kJ Reaction 2: HCI (g) --> HCI (aq) Change in enthalpy: -74.8 kJ/mol Reaction 3: H2 (g) + Cl2 (g) --> 2HCI (g) Change in enthalpy: -1845. kļ/mol Reaction 4: AICI3 (s) --> AICI3 (aq) Change in enthalpy: -323. kJ/mol Include the following: • The numerical answer with correct units. • State which reactions, if any, you had to "Flip". • State which reactions you had to multiply, if any, to get the correct amount of the compound.
6.69. Adding 2.00 g of Mg metal to 95.0 mL of 1.00 M HCl in a coffee-cup calorimeter leads to a temperature increase of 9.2°C. 01 020072 Ha. b. 10 (lom. Write a balanced net ionic equation for the reaction. If the molar heat capacity of 1.00 M HCl is the same as that for water [cp = 75.3 J/(mol °C)], what is AHxn? ·C 11°
When 0.638 of sodium metal is added to an excess of hydrochloric acid, 6630j of heat are produced. What is the enthalpy of the reaction as written? 2Na(s)+2HCl(aq)⟶2NaCl(aq)+H2(g) Enthalpy of reaction:
iv to vi please
and 2 Enthalpy #1.30 enoindice pled TT 2010 2D49.bs 22) When 1 mole of Fe2O3(s) reacts with H₂(g) to form Fe(s) and H2O(g) according to the following equation, 98.8 kJ of energy are absorbed. (6 Fe2O3(s) + 3 H2(g) → 2 Fe(s) + 3 H₂O(g) (pp) (20/d4 (pm) $40 D Reaclanis 13:48 SH Products endothermic, A endothermic, B (2) exothermic, A exothermic, B nad W (21 Enthalpy MOMS. Reactants Products (A) (B) Is the reaction endothermic or exothermic, and which of the enthalpy diagrams above represents grow olor and to noin (01 this reaction? SH GH TH A HOMH X HILD 08.10 Page 6 of 8
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
The question is in the image.
A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction АТР(аq) + H,О() — ADP(aq) + НРО (аq) ADP(aq) + HPO (aq) for which AGixn = -30.5 kJ/mol at 37.0 °C and pH 7.0. Calculate the value of AGrxn in a biological cell in which [ATP] = 5.0 mM, [ADP] = 0.40 mM, and [HPO;-] = 5.0 mM. AGrxn kJ/mol * TOOLS x10 Is the hydrolysis of ATP spontaneous under these conditions? yes no
For a particular isomer of C8H18,C8⁢H18, the combustion reaction produces 5093.7 kJ5093.7 kJ of heat per mole of C8H18(g)C8⁢H18⁡(g) consumed, under standard conditions. C8H18(g)+252O2(g)⟶8CO2(g)+9H2O(g)Δ?∘rxn=−5093.7 kJ/molC8⁢H18⁡(g)+252⁢O2⁡(g)⟶8⁢CO2⁢(g)+9⁢H2O(g)⁢Δ⁢Hrxn°=−5093.7 kJ/mol What is the standard enthalpy of formation of this isomer of C8H18(g)?
(b) What is the specific enthalpy of combustion of ethane? kJ/g. 3 sig. number.
The reaction between hydrogen and oxygen to yield water vapor has AH" = -1843 2H₂(g) + O₂(g) 2H₂O(g)AH <=-484kJ Part A What is the enthalpy change in kilojoules when 0.70 mol of H₂ reacts with 0.35 mol of O, to produce 0.70 mol of H₂ at constant pressure of 1.00 atm? Express your answer as a whole number. AH = Submit Part B W= Submit 1957 ΑΣΦ How much PV work is done in kilojoules for this reaction at constant pressure of 1.00 atm if the volume change is-9-2 L? Express your answer using two significant figures. 100 ΑΣΦΑ Part C Request Answer Request Answer kJ What is the value of AE for this reaction in kilojoules?