During a neutralization reaction, 1 L of 1 mol/L HCl at 298 K was mixed with 0.95 L of 0.95 mol/L NaOH at 298 K. (a) Determine the enthalpy of neutralization using the relevant standard enthalpies of formation given below. дн? (кJ/mol) Substance HС(ад) NaOH(aq) Na*(aq) Cl'(aq) Nacl(s) H2O(1) ОН (ад) C2(aq) H*(aq) -167.2 -470.1 -240.1 -167.2 -411.0 -285.8 -230.0 -23.40 -0.00 (b) What are the concentrations of HCl and NaOH left after neutralization? (c) If the specific heat of water is 4.184 J/g-C at 298K, what is temperature of the final solution, assuming there is no heat loss?

During a neutralization reaction, 1 L of 1 mol/L HCl at 298 K was mixed with 0.95 L of 0.95 mol/L NaOH at 298 K. (a) Determine the enthalpy of neutralization using the relevant standard enthalpies of formation given below. дн? (кJ/mol) Substance HС(ад) NaOH(aq) Na(aq) Cl'(aq) Nacl(s) H2O(1) ОН (ад) C2(aq) H(aq) -167.2 -470.1 -240.1 -167.2 -411.0 -285.8 -230.0 -23.40 -0.00 (b) What are the concentrations of HCl and NaOH left after neutralization? (c) If the specific heat of water is 4.184 J/g-C at 298K, what is temperature of the final solution, assuming there is no heat loss?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: What is the change in enthalpy when 4.04 grams H₂ reacts with excess oxygen according to the…

A: Here we are required to find the change in enthalpy of reaction

Q: Given the following enthalpies of combustion: (a) 2H2(g) + O2(g) --> 2H2O(g);…

A: The reactions given are, a) 2 H2(g) + O2(g) --> 2 H2O(g); ΔH1 =…

Q: Please provide detailed solution and give the explanation of the concept

A: Step 1:From the given data 5230 J heat is produced by 0.5030 grams of sodium metal Then calculate…

Q: Calculate the change of enthalpy for the reaction 2Al (s) + 3Cl2 (g) --> 2AlCl3 (s) from the…

Q: A critical reaction in the production of energy to do work or drive chemical reactions in biological…

A: Please find the solution attached as handwritten note( as required ).

Q: 1. (a) Determine AH (kJ/mol) using Hess's law for the following reaction using the listed enthalpies…

A: The study of thermochemistry examines the heat energy involved in chemical processes and/or phase…

Q: When 0.828 g of sodium metal is added to an excess of hydrochloric acid, 8610 J of heat are…

A: Given data,Mass of Na=0.828gHeat=8610JMolar mass of Na=23g/mol

Q: A block of Lucite Cl= 1460J/kg(K) is heated to a temperature of Tli = 120 degrees C. It is then…

A: In an isolated calorimeter, the amount of heat lost by the heated lucite block is equal to the…

Q: When 0.5200.520 g of sodium metal is added to an excess of hydrochloric acid, 54105410 J of heat are…

A: First find the no. of moles in 0.520 g of Na. then apply unitary method.

Q: 1. When a 6.50 g sample of solid sodium hydroxide dissolves in 100.0 g of water in a coffee- cup…

Q: 7. (SF) Consider the following reaction: C2HO1(aq) + 8 KCIO:(aq) → 12 CO:(g) + 11 H.O(1) + 8 KCI(aq)…

Q: When 320 mg of naphthalene, C10H8(s), was burned in a bomb calorimeter (write the reaction and…

A: In bomb calorimeter, we use the following formula, q = -C.∆T=> -∆U = C.∆T C= heat capacity of…

Q: What volume (in L) of 1.10M FeCl, would be required to obtain 0.550 moles of Cl ions?

A: We have to calculate the volume of FeCl3 required.

Q: Part 1 of 2 Calculate the standard enthalpy of neutralization of HF (aq): HF (aq) + OH (aq) → F (aq)…

A: Answer-2 Enthalpy of reaction is an extensive property, so it can be added or subtracted the way…

Q: Calculate the standard enthalpy change

Q: 4.0

A: We will. Calculate ∆H

Q: When 0.278 g of sodium metal is added to an excess of hydrochloric acid, 2890 J of heat are…

A: The balanced reaction given is, => 2 Na (s) + 2 HCl (aq) → 2 NaCl (aq) + H2 (g) Given: Mass of Na…

Q: Calculate the change of enthalpy for the reaction 2Al (s) + 3CI2 (g) -- > 2AICI3 (s) from the…

Q: Calorimetry can also be used to determine nutritional Calories, which are actually kilocalories. One…

Q: Write out the reaction NH4CI(s)-NH3(g)+HCI(g) as a series of steps which include the reactions…

A: Solution NH4Cl is AN chemical compound with chemical name salt. it's conjointly called salt, the…

Q: Be sure to answer all parts. Given the thermochemical equation for photosynthesis, 6CO2G) + 6H,0(1)…

Q: b) What is the standard enthalpy of reaction per mole of KOH when 50.00 cm³ of 1.0 moldm³ of Nitric…

A: Enthalpy of reaction: The Heat of Reaction (which is also known as the Enthalpy of Reaction)…

Q: Given the reaction below, write the thermochemical equation showing the enthalpy of the…

Q: Calculate the change of enthalpy for the reaction 2Al (s) + 3Cl2 (g) --> 2AlCl3 (s) from the…

A: Enthalpy of reaction is calculated below.

Q: What is AH for the following chemical reaction? CO(g) + NH3(g)→HCN(g) + H₂O(g) You can use the…

Q: Ammonia burns in the presence of a platinum catalyst to produce nitric oxide, NO: 4 NH, (g) + 50,…

Q: Styrene (C8H8) is one of the substances used in the production of synthetic rubber and burns…

Q: At 25 °C, the standard enthalpy of formation of HF (aq) is -319.9 kJ it is -285.8 kJ mol Part: 0/2…

Q: Zn(s)+2H,O(1) Zn²* (aq) + 20H¯(aq) + H2(g) using data from the following reactions and applying…

A: H+ (aq) + OH- (aq) -----> H2O(l) ∆H°rxn1 = -56.0kJ Zn (s)-----------> Zn+2(aq)…

Q: Chemical energy is released or absorbed from reactions in various forms. The most easily measurable…

A: Given:∆fH°(A) = -225kJ/mol∆fH°(B) = -393 kJ/mol∆fH°(C) = 209 kJ/mol∆fH°(D) = -491 kJ/mol

Q: Calculate the change of enthalpy for the reaction 2Al (s) + 3CI2 (g) --> 2AICI3 (s) from the…

Question

During a neutralization reaction, 1 L of 1 mol/L HCl at 298 K was mixed with 0.95 L
of 0.95 mol/L NaOH at 298 K.
(a) Determine the enthalpy of neutralization using the relevant standard enthalpies of
formation given below.
дн? (кJ/mol)
Substance
HС(ад)
NaOH(aq)
Na*(aq)
Cl'(aq)
Nacl(s)
H2O(1)
ОН (ад)
C2(aq)
H*(aq)
-167.2
-470.1
-240.1
-167.2
-411.0
-285.8
-230.0
-23.40
-0.00
(b) What are the concentrations of HCl and NaOH left after neutralization?
(c) If the specific heat of water is 4.184 J/g-C at 298K, what is temperature of the final
solution, assuming there is no heat loss?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Step 7

Step 8

Step 9

Trending now

This is a popular solution!

Step by step

Solved in 9 steps with 7 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Calculate the change of enthalpy for the reaction 2AI (s) + 3C12 (g) --> 2AICI3 (s) from the following reactions: Reaction 1: 2AI (s) + 6HCI (aq) --> 2AICI3 (aq) + 3H2 (g) Change in enthalpy: -1049 kJ Reaction 2: HCI (g) --> HCI (aq) Change in enthalpy: -74.8 kJ/mol Reaction 3: H2 (g) + Cl2 (g) --> 2HCI (g) Change in enthalpy: -1845. kļ/mol Reaction 4: AICI3 (s) --> AICI3 (aq) Change in enthalpy: -323. kJ/mol Include the following: • The numerical answer with correct units. • State which reactions, if any, you had to "Flip". • State which reactions you had to multiply, if any, to get the correct amount of the compound.
6.69. Adding 2.00 g of Mg metal to 95.0 mL of 1.00 M HCl in a coffee-cup calorimeter leads to a temperature increase of 9.2°C. 01 020072 Ha. b. 10 (lom. Write a balanced net ionic equation for the reaction. If the molar heat capacity of 1.00 M HCl is the same as that for water [cp = 75.3 J/(mol °C)], what is AHxn? ·C 11°
When 0.638 of sodium metal is added to an excess of hydrochloric acid, 6630j of heat are produced. What is the enthalpy of the reaction as written? 2Na(s)+2HCl(aq)⟶2NaCl(aq)+H2(g) Enthalpy of reaction:
iv to vi please
and 2 Enthalpy #1.30 enoindice pled TT 2010 2D49.bs 22) When 1 mole of Fe2O3(s) reacts with H₂(g) to form Fe(s) and H2O(g) according to the following equation, 98.8 kJ of energy are absorbed. (6 Fe2O3(s) + 3 H2(g) → 2 Fe(s) + 3 H₂O(g) (pp) (20/d4 (pm) $40 D Reaclanis 13:48 SH Products endothermic, A endothermic, B (2) exothermic, A exothermic, B nad W (21 Enthalpy MOMS. Reactants Products (A) (B) Is the reaction endothermic or exothermic, and which of the enthalpy diagrams above represents grow olor and to noin (01 this reaction? SH GH TH A HOMH X HILD 08.10 Page 6 of 8
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
The question is in the image.
A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction АТР(аq) + H,О() — ADP(aq) + НРО (аq) ADP(aq) + HPO (aq) for which AGixn = -30.5 kJ/mol at 37.0 °C and pH 7.0. Calculate the value of AGrxn in a biological cell in which [ATP] = 5.0 mM, [ADP] = 0.40 mM, and [HPO;-] = 5.0 mM. AGrxn kJ/mol * TOOLS x10 Is the hydrolysis of ATP spontaneous under these conditions? yes no
For a particular isomer of C8H18,C8⁢H18, the combustion reaction produces 5093.7 kJ5093.7 kJ of heat per mole of C8H18(g)C8⁢H18⁡(g) consumed, under standard conditions. C8H18(g)+252O2(g)⟶8CO2(g)+9H2O(g)Δ?∘rxn=−5093.7 kJ/molC8⁢H18⁡(g)+252⁢O2⁡(g)⟶8⁢CO2⁢(g)+9⁢H2O(g)⁢Δ⁢Hrxn°=−5093.7 kJ/mol What is the standard enthalpy of formation of this isomer of C8H18(g)?
(b) What is the specific enthalpy of combustion of ethane? kJ/g. 3 sig. number.
The reaction between hydrogen and oxygen to yield water vapor has AH" = -1843 2H₂(g) + O₂(g) 2H₂O(g)AH <=-484kJ Part A What is the enthalpy change in kilojoules when 0.70 mol of H₂ reacts with 0.35 mol of O, to produce 0.70 mol of H₂ at constant pressure of 1.00 atm? Express your answer as a whole number. AH = Submit Part B W= Submit 1957 ΑΣΦ How much PV work is done in kilojoules for this reaction at constant pressure of 1.00 atm if the volume change is-9-2 L? Express your answer using two significant figures. 100 ΑΣΦΑ Part C Request Answer Request Answer kJ What is the value of AE for this reaction in kilojoules?
The standard heat of formation, AH;, is defined as the enthalpy change for the formation of one mole of Part B substance from its constituent elements in their standard states. Thus, elements in their standard states have AH: = 0. Heat of formation values can be used The combustion of ethene, C2H4, occurs via the reaction to calculate the enthalpy change of any reaction. C2H4 (g) + 302 (g)→2CO2(g) + 2H20(g) Consider, for example, the reaction with heat of formation values given by the following table: 2NΟ (5) + Ο, (s) 2ΝO, (g) ΔΗρ (kJ/mol) Substance with heat of formation values given by the following table: C2H4 (g) 52.47 CO2 (g) -393.5 Substance (kJ/mol) H2O(g) -241.8 NO(g) 90.2 Calculate the enthalpy for the combustion of ethene. 02 (g) Express your answer to four significant figures and include the appropriate units. NO2(g) 33.2 • View Available Hint(s) Then the heat of formation for the overall reaction is ΔΗ ΔΗ (products) -ΔΗ; (reactants ) [2(90.2) + 0] HA ? 2(33.2) -114 kJ/mol…