Calculate the heat released (kJ) in the reaction of 3.50 g of acetylene (C2H2) and excess hydrogen gas to form ethane gas: C2H2(g) + 2H2(g) C2H6(g) Given: 2C2H2(g) + 502g) 4CO2(g) + 2H20(g) AH = -2320 kJ/mol 2C2H6(g) + 702(g)→4CO2(g) + 6H20(g) AH = -3040 kJ/mol 2H2(g) + O2(g) 2H20(g) AH = -572 kJ/mol Multiple Choice None of the above 30.5 kJ 29.5 kJ 28.5 kJ 27.5 kJ

Calculate the heat released (kJ) in the reaction of 3.50 g of acetylene (C2H2) and excess hydrogen gas to form ethane gas: C2H2(g) + 2H2(g) C2H6(g) Given: 2C2H2(g) + 502g) 4CO2(g) + 2H20(g) AH = -2320 kJ/mol 2C2H6(g) + 702(g)→4CO2(g) + 6H20(g) AH = -3040 kJ/mol 2H2(g) + O2(g) 2H20(g) AH = -572 kJ/mol Multiple Choice None of the above 30.5 kJ 29.5 kJ 28.5 kJ 27.5 kJ

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

The average molecular speed in a sample of Kr gas at a certain temperature is 298 m/s. The average molecular speed in a sample of O3 gas is m/s at the same temperature.
A bomb calorimeter can be used to measure the enthalpy of reaction for combustions, such as the combustion of diborane represented by the following balanced equation: B2H6(g)+3O2(g)=B2O3(s)+3H2O(g)ΔHcombustion for this process is –1958 kJ/mol. Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is 7.854 kJ/°C at 22.61°C. What is the final temperature of the calorimeter?
The heat of formation at 25oC of liquid acetone, CH3C(O)CH3(l) is -247.5 kJ/mol. Which of the following is the correct heat of formation reaction for CH3C(O)CH3(l) )? 3C(s,graphite)+3H2(g)+12O2(g)→CH3C(O)CH3(l)△Hof=−247.5kJmol 3C(s,graphite)+6H(g)+O(g)→CH3C(O)CH3(l)△Hof=−247.5kJmol CH3C(O)CH3(l)+4O2(g)→3CO2(g)+3H2O(g)△Hof=−247.5kJmol C3(s,graphite)+3H2(g)+12O2(g)→CH3C(O)CH3(l)△Hof=−247.5kJmol 6C(s,graphite)+6H2(g)+O2(g)→2CH3C(O)CH3(l)△Hof=−247.5kJmol
The following thermochemical equation is for the reaction of carbon dioxide(g) with hydrogen(g) to form acetylene(g) (C,H) and water(g). 2C02(g) + 5H2(g)–C,H2(g) + 4H,O(g) AH = 46.5 kJ When 15.3 grams of carbon dioxide(g) react with excess hydrogen(g), kJ of energy are | Hint: An amount of energy is expressed as a positive number. The sign of AH in the thermochemical equation indicates whether the energy is absorbed or evolved.
Liquid methanol (CH3OH). can be used as an alternative fuel in pickup and SUV engines. An industrial method for preparing it uses the catalytic hydrogenation of carbon monoxide: CO(g) + 2 H₂(g) How much heat (in significant figures. catalyst CH, OH (1) kJ mol kJ ) is released when 15.0 L of CO at 85 °C and 112 kPa reacts with 13.2 L of H₂ at 75 °C and 744 torr? Round your answer to 3 mol Note: Reference the Fundamental constants, Conversion factors for non-SI units, and Thermodynamic properties of pure substances tables for additional information. 0.8 x G
When 0.636 g of sodium metal is added to an excess of hydrochloric acid, 6610 J of heat are produced. What is the enthalpy of the reaction as written? 2 Na(s) + 2HCl(aq) Enthalpy of reaction: → -2 NaCl(aq) + H₂(g) 107026.5 Incorrect kJ
（1）Consider the reaction: 2A (g) + 3 B (g) → 2 C (g) ΔHrxn = +254.3 kJ What will be the enthalpy change (in kJ) if 0.471 mol B reacts in excess A? （2）Consider the reaction: C (s) + O2 (g) → CO2 (g) ΔHrxn = -393.5 kJ What mass of carbon (in g) must be reacted via this mechanism to release 581.2 kJ of heat?
Carbon disulfide reacts with chlorine according to the following reaction equation: CS2(g) + 3 Cl2(g) S2 Cl2(g) + CCI4(g) kJ A,H° = -230 mol If 15.0 g of Cl2 (70.906 g/mol) reacts with excess CS2, how much heat is transferred (include any sign needed) for this reaction? Give your answer in kJ but do not put units in the answer box. Report it to two decimal places.