Calculate the heat released (kJ) in the reaction of 3.50 g of acetylene (C2H2) and excess hydrogen gas to form ethane gas: C2H2(g) + 2H2(g) C2H6(g) Given: 2C2H2(g) + 502g) 4CO2(g) + 2H20(g) AH = -2320 kJ/mol 2C2H6(g) + 702(g)→4CO2(g) + 6H20(g) AH = -3040 kJ/mol 2H2(g) + O2(g) 2H20(g) AH = -572 kJ/mol Multiple Choice None of the above 30.5 kJ 29.5 kJ 28.5 kJ 27.5 kJ

Calculate the heat released (kJ) in the reaction of 3.50 g of acetylene (C2H2) and excess hydrogen gas to form ethane gas: C2H2(g) + 2H2(g) C2H6(g) Given: 2C2H2(g) + 502g) 4CO2(g) + 2H20(g) AH = -2320 kJ/mol 2C2H6(g) + 702(g)→4CO2(g) + 6H20(g) AH = -3040 kJ/mol 2H2(g) + O2(g) 2H20(g) AH = -572 kJ/mol Multiple Choice None of the above 30.5 kJ 29.5 kJ 28.5 kJ 27.5 kJ

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

The average molecular speed in a sample of Kr gas at a certain temperature is 298 m/s. The average molecular speed in a sample of O3 gas is m/s at the same temperature.
A bomb calorimeter can be used to measure the enthalpy of reaction for combustions, such as the combustion of diborane represented by the following balanced equation: B2H6(g)+3O2(g)=B2O3(s)+3H2O(g)ΔHcombustion for this process is –1958 kJ/mol. Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is 7.854 kJ/°C at 22.61°C. What is the final temperature of the calorimeter?
The reactions of hydrocarbons are often studied in the petroleum industry. One such reaction is 2C3H8(g) → C6H6(ℓ) + 5H2(g) with ΔH° = 698 kJ. If 38 L of propane (C3H8) at 16.92°C and 0.74 atm is to react, how much heat in kJ must be supplied? R = 0.08206 L atm mol-1 K-1 Round your answer to 2 decimal places.
The heat of formation at 25oC of liquid acetone, CH3C(O)CH3(l) is -247.5 kJ/mol. Which of the following is the correct heat of formation reaction for CH3C(O)CH3(l) )? 3C(s,graphite)+3H2(g)+12O2(g)→CH3C(O)CH3(l)△Hof=−247.5kJmol 3C(s,graphite)+6H(g)+O(g)→CH3C(O)CH3(l)△Hof=−247.5kJmol CH3C(O)CH3(l)+4O2(g)→3CO2(g)+3H2O(g)△Hof=−247.5kJmol C3(s,graphite)+3H2(g)+12O2(g)→CH3C(O)CH3(l)△Hof=−247.5kJmol 6C(s,graphite)+6H2(g)+O2(g)→2CH3C(O)CH3(l)△Hof=−247.5kJmol
The following thermochemical equation is for the reaction of carbon dioxide(g) with hydrogen(g) to form acetylene(g) (C,H) and water(g). 2C02(g) + 5H2(g)–C,H2(g) + 4H,O(g) AH = 46.5 kJ When 15.3 grams of carbon dioxide(g) react with excess hydrogen(g), kJ of energy are | Hint: An amount of energy is expressed as a positive number. The sign of AH in the thermochemical equation indicates whether the energy is absorbed or evolved.
The combustion of neopentane is described by the reaction: C5H12(s) + O2(g) → CO2(g) + H2O (unbalanced) AH = -3456 kJ/mol neopentane %3D If 100.0 milligrams of neopentane is burned in a bomb calorimeter to heat 100.0 mL of water at 25°C, what would be the final temperature of water in °C? The specific heat of water is 4.184 J/g°C, The MW of neopentane is 72.15 g/mol. Answer in four significant figures. Indicate the unit.
Liquid methanol (CH3OH). can be used as an alternative fuel in pickup and SUV engines. An industrial method for preparing it uses the catalytic hydrogenation of carbon monoxide: CO(g) + 2 H₂(g) How much heat (in significant figures. catalyst CH, OH (1) kJ mol kJ ) is released when 15.0 L of CO at 85 °C and 112 kPa reacts with 13.2 L of H₂ at 75 °C and 744 torr? Round your answer to 3 mol Note: Reference the Fundamental constants, Conversion factors for non-SI units, and Thermodynamic properties of pure substances tables for additional information. 0.8 x G
please I want an answer question
Consider the reaction of ammonia gas with O2(g) according to the thermochemical equation given below: 4NH3(g) + 702(g) – 4NO2(g) + 6H2O(1) AH° = - 1132 kJ/mole I (a) Calculate the mass (g) NO2 produced together with the release of 226 J of heat. (b) Calculate the heat released when 3.75 g of NO2 are produced.
When 0.636 g of sodium metal is added to an excess of hydrochloric acid, 6610 J of heat are produced. What is the enthalpy of the reaction as written? 2 Na(s) + 2HCl(aq) Enthalpy of reaction: → -2 NaCl(aq) + H₂(g) 107026.5 Incorrect kJ
CH3OH(g) CO(g) + 2 H2(g) H = +90.7 kJ (a) Is the reaction exothermic or endothermic? exothermic endothermic (b) Calculate the amount of heat transferred when 45.0 g of CH3OH(g) are decomposed by this reaction at constant pressure.H = ____kJ(c) If the enthalpy change is 18.0 kJ, how many grams of hydrogen gas are produced?____g(d) How many kilojoules of heat are released when 11.5 g of CO(g) reacts completely with H2(g) to form CH3OH(g) at constant pressure?H = ____kJ(e) Calculate E when 750.0 g of CH3OH(g) completely reacts at a constant temperature of 300 K and constant pressure of 0.95 atm. R = 8.314 J/mol*K and R = 0.08206 atm*L/mol*K _____kJ HopHelpCh5N1
（1）Consider the reaction: 2A (g) + 3 B (g) → 2 C (g) ΔHrxn = +254.3 kJ What will be the enthalpy change (in kJ) if 0.471 mol B reacts in excess A? （2）Consider the reaction: C (s) + O2 (g) → CO2 (g) ΔHrxn = -393.5 kJ What mass of carbon (in g) must be reacted via this mechanism to release 581.2 kJ of heat?