Calculate enthalpy of the reaction below using Hess' Law. 2CO(g) + O2(g) → 2CO2(g) 4H = ? C(s) + O2(g) CO2(g) AH = -393.5 kJ 2C(s) + O2(g). - -> 2CO(g) AH = -221.0 kJ -393.5 kJ O kJ O-614.5 kJ O2997 kJ

Calculate enthalpy of the reaction below using Hess' Law. 2CO(g) + O2(g) → 2CO2(g) 4H = ? C(s) + O2(g) CO2(g) AH = -393.5 kJ 2C(s) + O2(g). - -> 2CO(g) AH = -221.0 kJ -393.5 kJ O kJ O-614.5 kJ O2997 kJ

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter5: Principles Of Chemical Reactivity: Energy And Chemical Reactions

Section5.6: Calorimetry

Problem 5.7CYU: Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The...

See similar textbooks

Related questions

Q: 5.30 The average enthalpy change of vaporization of benzene between room temperature and the normal…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: None

A: According to the VSEPR theory, SeH2 has two bond pairs and two lone pairs. Hence, the electron pair…

Q: ->…

Q: 3. Draw the correct product for the following Diels-Alder reaction, make sure to include any…

Q: 2. For the following mechanism questions, please refer to Chapter 8.10 in the Klein text for more…

A: The objective of the question is to understand the mechanism of formation of cis- and trans- isomers…

Q: In addition to desired product (Zingerone), It is normal in the second step of attached experiment…

A: GroupChemical shiftAtomsSplittingremarkOH9.961singletphenolOH4.81singletalcoholCH6.591doublet…

Q: structures for c and d with stereochemistry MeO OMe O OH CH3C(OME)3 heat C p-TSA

A: Structure C and D are shown with stereochemistry. The mechanism of formation of structure C is…

Q: Predict the product(s) for each reaction below

A: This are the products for the given reaction. Hope this helps, thank you!

Q: Please provide explanations regarding IUPAC rules

Q: O Kinetics and Equilibrium Calculating an equilibrium constant from a heterogeneous equilibrium...…

A: To find the equilibrium constant for the decomposition of nickel carbonyl, we first calculate the…

Q: 4. Complete each of the following reactions by drawing the structures of the organic products. a) b)…

Q: -OH + O о OH NaH NaH gives H: which is a base only (not an Nu)

Q: Calculate the concentrations of all species in a 0.760 M Na2SO3 (sodium sulfite) solution. The…

A: Step 1: Step 2: Step 3: Step 4:

Q: Use the following atomic weights and quantities to calculate the overall % yield of…

A: Step 1:Step 2:Step 3:

Q: 4. Allene, C3H4, has point group symmetry Dzd, with character table provided below. It can be…

A: Step 1: Step 2:Step 3:

Q: None

Q: i dot want hand written image

A: Step 1:The reaction involves deprotonation of acetone by LDA to form an enolate ion, which then…

Q: Calculate the enthalpy of formation of benzene from the following data.2C6H6(g) + 15O2(g) --->…

Q: Propose an efficient synthesis for the following transformations using ONLY aldol, micheal and other…

A: Step 1: Step 2: Step 3: Step 4:

Q: Determine if the following is aromatic, antiaromatic or nonaromatic:

A: Step 1:For a Compound to be aromatic(i) It should be cyclic(ii) It should be planar(iii) It should…

Q: b. H 1. NaOH 2.

Q: Part 1)A buffer solution contains 0.125 M acetic acid and 0.150 M sodium acetate. The pKa of acetic…

A: Part 1. Given: [HC2H3O2]=0.125M;[C2H3O2−]=0.150M;pKa=4.74Step 1: Write the…

Q: Calculate the standard all potentials given the following data: + 2+ Cu (aq) + 2e¯ → Cu(s), E° › ·…

A: The objective of the question is to calculate the standard cell potential for the given reactions.…

Q: Predict the products of the following triglyceride when it undergoes saponification. Draw the arrow…

Q: None

A: Step 1: A Comprehensive Description of the Amine Basicity Order:The ability of the nitrogen atom to…

Q: show the mechanism step for this (i dont want hand writting image)

A: Step 1:- Given reaction represents, hydrogenation of 2-butene (C₄H₈) with H₂/Pd The mechanism for…

Q: sample weight: KOH: 1g KOtBu 1g 1-propanol: 1g 1-butanol 0.742g calculate the thoeretical and…

A: To calculate the theoretical and percent yields of methylbutenes, we first need to identify the…

Q: How many mL of 0.665 M sulfuric acid solution are required to completely neutralize 48.50 mL of…

A: Reaction involved is :-H2SO4(aq) + 2NaOH(aq) -> Na2SO4(aq) + 2H2O(l)From above reaction we know 1…

Q: 1016 3. Using Hess' Law, Calculate the standard heat of formation of copper(I) oxide given the…

A: Step 1:Introduction to question :Given ,Reaction 1 : CuO(s) → Cu(s) + ½ O2(g) Δ.Η° = 157.3…

Q: ionic bond hydrogen bond Answer Bank hydrophobic interaction disulfide bond Identify the major force…

A: The major force controlling the tertiary structure of proteins is the hydrophobic effect. This force…

Q: IUPAC nomenclature for the compound?

Q: Which of the following molecules is a cis alkene? oc OA A B OD OB 0

A: option c is the correct answer. If alkenes have two different substituents at each end of the C=C…

Q: The Ksp of Al(OH)3 is 3.0 x 10-34. Assuming no other reactions (like metal-ligand complex formation)…

Q: Please solve and show all work.

A: Step 1: When alkene treated with Br2 it gives trans vicinal dihalide as a product. This vicinal…

Q: Use these compounds and the reagents to draw the mechanism for this reaction. Show all steps and I…

Q: Show steps how to get the amount of error (Pduration - Pmarket) for second question in the picture,…

A: Answer to 9b-20:b. -$0.75Here's why:Duration: We don't need the exact duration value for this…

Q: None

Q: Synthesis: Give the correct starting material, reagents used or product as indicated. If you are not…

A: 1) Under reductive conditions, ozonolysis produces ketone or aldehyde upon cleavage of alkene or an…

Q: Two enzymes, E1 and E2, respectively catalyze the conversion of A to B, and B to C in two reactions…

A: The objective of this question is to determine the steady-state concentrations in a series of…

Q: How do I find the Reaction Quotient, E0cell and Ecell?

A: Standard reduction potential:Cu+2|Cu = 0.34 VZn+2|Zn = -0.76 VMg+2|Mg = -2.37 VQ = concentration of…

Q: Show work, thank you!

A: Redox reaction: CrO42- (aq) + HSnO2- → CrO2 (s) + H2SnO3 (aq) When balancing redox reactions under…

Q: ← Problem 32 of 37 Submit Draw the product of this reaction. Ignore inorganic byproducts. H На сво H…

A: D-Glucose is a simple sugar that is produced by plants through photosynthesis. D-glucose is the most…

Q: Retro aldol: H. NaOH H₂O H. HTH "j"82f NaOH

Q: the ph of a 0.010M solution of just HOCL in water is 4.8 . What is H+ in that solution? b) what is…

Q: Be sure to answer all parts. Determine Angas for each of the following reactions: (a) MgCO3(s) →…

Q: Calculate the pH of the following aqueous salt solutions. Report your calculated pH to 2 decimal…

A: Salt hydrolysis is a reaction in which one of the ions from a salt reacts with H2O, forming either…

Q: given both answer

A: 1. The angular momentum quantum number, signified by l, describes the general shape or region an…

Q: please give Step by Step Solution Otherwise i give you DISLIKE !!

A: The objective of the question is to draw the structures of the products that would form during…

Q: 17. What is the Aldol addition product formed from reaction of the following compound with itself? О…

Q: (D)The best route to synthesise aromatic primary amines is by reduction of the corresponding nitro…

A: Preparation of p-ToluidineThe reaction scheme for the preparation of p-toluidine (4-methylaniline)…

Question

Calculate enthalpy of the reaction below using Hess' Law.
2CO(g) + O2(g) → 2CO2(g) 4H = ?
C(s) + O2(g)
CO2(g) AH = -393.5 kJ
2C(s) + O2(g). -
->
2CO(g) AH = -221.0 kJ
-393.5 kJ
O kJ
O-614.5 kJ
O2997 kJ

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
A 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.