Answer the following question: What is the macroscopic feature of a system based on the options you have? i. phase ii. state iii. property

Q: N2(g)+H2(g)→NH3(g)N2(g)+H2(g)→NH3(g) Express your answer as a balanced chemical equation. Identify…

A: In order to get a balanced chemical equation, we need to adjust the coefficients on both the sides.…

Q: How many phases are present in the following systems? Also define each of the erminologies…

A: Phases They are the homogeneous and distinct of a system without the visible boundary. Phase diagram…

Q: f177415469 ec3dc78ff3c8bf724d9#10001 le Glass... Shop | Origami Owl O Inbox Outlook W... Sugarpill…

A: Carbon is heated with Oxygen to give carbon monoxide gas.

Q: Is it possible to have a homogeneous, binary liquid solution that has a higher (or lower) viscosity…

A: Solution stoichiometry involves the calculation of concentration of solutions in the given…

Q: Part C HЕr Express your answer as a chemical equation. Identify all of the phases in your answer.…

A: The given equation:

Q: НС( ag) + КОН (ад)—КС1(ад) + H,0() Express your answer as a net ionic equation. Identify all of the…

A:

Q: What is the state of a system that has a system pressure of 500 mmHg and a dew pressure of 622 mmHg…

A: We can define the dew pressure as the pressure of the system where appearance of liquid occurs from…

Q: The point on a phase diagram is where three phases of matter exist in equilibrium. The point is…

A: Given:

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: Directions: Use and interpret the phase diagram below to answer the following questions. Write your…

A:

Q: PCl3(l)+H2O(l)→H3PO3(aq)+HCl(aq) Express your answer as a chemical equation. Identify all of the…

A: The given unbalanced reaction is  PCl3(l)+H2O(l)→H3PO3(aq)+HCl(aq)

Q: Al(s) +H2SO4(aq) → Al2 (SO4)3(aq) + H2 (9) Express your answer as a chemical equation. Identify all…

A: Given:the three unbal;anced equation are: i)  Al(s) + H2SO4 (aq)  → Al2(SO4)3 (aq) + H2(g) ii) K2SO4…

Q: The phase diagram for the simple system aluminum copper is drawn below. Answer the following…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Cl₂OCl₂(g) + ClO2(g) Express your answer as a chemical equation. Identify all of th

A: Balance chemical equation is equation in which number of atoms on both sides of the equation are…

Q: Substance X is known to exist at 1 atm in the solid, liquid, or vapor phase, depending on the…

A: Amount of heat added = 6.0 kJ/mol  Starting temperature of X = 0 oC Since the starting temperature…

Q: Write a balanced chemical equation for the photosynthesis reaction in which gaseous carbon dioxide…

A: The reactants given are carbon dioxide i.e. CO2 and liquid water i.e. H2O and the products are…

Q: During a phase transition (such as freezing) there is a change in temperature. O True False

A:

Q: give 5 examples of a 1 phase diagram and show its phase rule

A: 1) Water phase diagram

Q: Q5/ A. Classify the ceramics materials and give typical example with justification for each class.…

A: Ceramic materials are the inorganic materials thta are made by the combination of nonmetallic and…

Q: P4(s)+O2(g)⟶P4O10(s)P4(s)+O2(g)⟶P4O10(s)   Express your answer as a chemical equation. Identify all…

A:

Q: Part A H2 SO4 (aq) and LİOH(ag) Express your answer as a chemical equation. Identify all of the…

A: A) Since H2SO4 is a strong acid and NaOH is a strong base. Hence they will react and form soluble…

Q: Cl(aq) + NO₂ (aq) → NO(g) + Ch (g) Express your answer as a chemical equation. Identify all of the…

A:

Q: Explain using an example the relationship of chemical potential to phase equilibrium.

A: Chemical potential is a thermodynamic property that describes the potential energy of a substance to…

Q: A student prepared two beakers with identical sprigs of a water plant as shown in the figure below.…

A: The graph explaining the number of bubbles released in the beaker containing the plant at varying…

Q: Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in…

A: 2 Al(s) +3 Cl2 (g) -------> 2 AlCl3 (s)

Q: Write real life application examples of isostatic, syndiotactic and atactic configurations

A:

Q: Cu₂O(s) + O2(g) → CuO(s) Express your answer as a chemical equation. Identify all of the phases in…

A: Answer:Balancing of chemical equation is based on the law of conservation of mass where total mass…

Q: C3H6(g)+O2(g)→CO2(g)+H2O(g)C3H6(g)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: A combustion reaction is a reaction in which a substance reacts with oxygen to give carbon dioxide…

Q: About 4.00 g of hydrogen gas undergoes combustion and produces water in its liquid state.…

A: The combustion equation of hydrogen gas is                               H2 + 12O2 = H2O  Here 1…

Q: What is umplung? Provide example.

A: Umpolung : Reversal of polarity. For example acetaldehyde is having electrophilic carbon.…

Q: Explain the significance of the Clapeyron equation and of the Clausius-Clapeyron equation.

A: Significance of Clapeyron equation and of the Clausius-Clapeyron equation has to be given,