Acid catalyzed dehydration reaction of 2-methyl-1-butanol produces 2-methyl-2-butene as the major product. Also acid catalyzed dehydration reaction of 3-methyl-1-butanol give the same product as major product. Explain the reason why both of the reaction produce the same product as the major product

Q: What is the major product generally formed when a tertiary alkyl bromide  (R3Br) reacts with sodium…

A: the solution are as follows:

Q: Predict the major product of the given hydration reaction. H3O+/H₂O draw structure ...

A: A question based on reactions of alkenes. An unsymmetrical alkene is given that has to be answered…

Q: To prepare an ether from an alkyl halide by a nucleophilic substitution reaction, what are the two…

A: Nucleophilic substitution reaction is a series of organic reactions in which one nucleophile…

Q: 1. LDA/THF 2. CH3-I

A: We have to predict the major product.

Q: Give the IUPAC name for the major product of the following reaction.

A:

Q: CI A B C D H₂O pyridine pyridine (CH3CH2)2NH 1. SOCI₂ 2. (CH3)2NH, pyridine Ⓒ Done

A: Given transformation: We have to find the reagents for this transformation.

Q: The coupling of an alkyne with an aryl halide in the presence of a palladium catalyst and…

A: Please find below the reactants along with the reaction taking place.

Q: How many unique ether products will be formed when the following reaction is performed?   Draw the…

A: Upon acid catalyzed reactions, alcohols can form ethers. This reaction also involves a nucleophilic…

Q: Match each reagent to the product that it forms. Multiple reagents may form the same product. Hoft…

A: Given are organic compounds made from same compound.The starting compound is secondary alcohol.

Q: Draw the major organic product for the reaction conditions shown. CH3 mCPBA CF3SO3H CH₂Cl₂

A: mCPBA is the meta chloro perbenzoic acid. It is oxidizing agent. Alkene react with mCPBA to form…

Q: Provide the major organic product of the following reaction. CH3CH₂CH₂CH₂CO₂H CH,CH,CH,CH,CHO…

A: Carbonyl or carboxyl group derivatives having alpha-H can react with a base to form an enolate ion…

Q: What is the major organic product of the following reaction?

A: Grignard reagent- Usually it is written as RMgX means alkyl magnesium halide. This is important…

Q: Draw the organic product(s) of the following reaction. Aqueous H2SO4 H2N-N- + ethanol

A: Solution ;      Fischer indole synthesis: This reaction is one of the types of pericyclic…

Q: Give the major product of this reaction sequence. 1) (CH3)2CuLi 2) weak acid (aq NH4CI) BA

A: The question is based on organic reactions.     we need to identify the product formed and explain…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: % Yield of the reaction is a measure of reaction efficiency in terms of the amount of product formed…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry…

A:

Q: Acetals are formed from the reaction of two alcohols with a carbonyl under acidic conditions. Acetal…

A: During the acetal formation by 1,2-ethanediol and two molecules of ethanol, the same types of bond…

Q: Draw the structure of the major organic product for the following reaction. & Cl + CH,COONa

A: Given is organic reaction. In which reactant is tertiary alkyl chloride.The reagent is sodium…

Q: Draw the major organic product of the following reactions. *CO₂CH3 1. NaOCH3 2. H3O+ .CO₂CH3

A: The Claisen reaction or Claisen condensation is a carbon–carbon bond forming reaction. In this…

Q: Draw the major organic product of the following reaction. O NH2

A: Organic reactions can be defined as the reactions in which organic reactants react with each other…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: What is required to complete the following reaction? H3C O H 1) CH3CH₂MgBr, ether 2) H3O+ 1) LDA,…

A:

Q: OH + H20 1.CHзMgBr 1. CHзONa CH3OH CH3OH H2SO4 2. Н2о 2. H20 H2SO4 I II III IV V

A:

Q: Draw the structure of the major organic product of the following reaction. CH3 CH3CH₂CH₂CCH=CH₂ CH3…

A: This is an example of oxymercuration-demercuration reaction in which greater substituted alcohol is…

Q: 4) Give an example of an enol which would tautomerize into a) an aldehyde and b) a ketone.

A: Tautomerism: Tautomerism is a process in isomer is converted into another by shifting the hydrogen…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry…

A:

Q: Draw the major organic product for the reaction conditions shown. MCPBA CF3SO3H CH3 CH2Cl2

A: mCPBA (meta-chloroperoxybenzoic acid) is a peracid commonly used in organic synthesis as an…

Q: Draw the major product of the reaction. OH NaH H2 NaBr + C6H100 DMF Br

A: The chemical reaction given is

Q: Hydration of aldehydes and ketones can be catalyzed by acid or base. Bases catalyze hydration by: O…

A: Hydration of aldehyde or ketone can take place in basic medium. Let,       Base =  NaOH ,   it is a…

Q: What is the role of phosphoric acid in the synthesis of cyclohexene? it is an antioxidant that…

A:

Q: 1. H-BR₂ 2. NaOH, H₂O₂

A: Given that, the reaction is:

Q: A single alkyl bromide reactant theoretically yields either of the given products, depending on the…

A: The reaction given is,

Q: Draw the structural formula of the product formed by treating each Wittig reagent with…

A: Treatment of o-chloroether of compound (A) and compound (B) with triphenylphosphine gives a…

Q: Draw the structure(s) of the major organic product(s) of the following reaction. fuming HNO,

A: HNO3 is a strong oxidizing agent can oxidises the aldehydes When fuming nitric acid (HNO3) react…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry…

A: Given: Mass of butanoic acid = 7.70 g Molar mass of butanoic acid = 88.11 g/mol Molar mass of ethyl…

Q: Draw the structure(s) for the major final product(s) formed in the following reaction sequence.

A: Electrophilic aromatic substitution reactions are the characteristic feature of benzene and other…

Q: Explain why pentane-2,4-dione forms two different alkylation products (Aor B) when the number of…

A: Alkylation of carbonyl compounds can be done by treating it with a base followed by the treatment of…

Q: According to Le Chatelier's Principle, acetal product formation tends to INCREASE (rather than…

A: Carbonyl compound (aldehyde and ketone) reacts with an alcohol to form hemiacetal in the presence of…

Q: Draw reaction mechanisms with all reactants, arrows, intermediates, and products. Your mechanism…

A: The objective of this question is to illustrate the reaction mechanism of 4-methylcyclohexanol with…

Designing a Synthesis

Organic synthesis is a branch of chemical synthesis that involves the planned construction of organic compounds/molecules from smaller units that possess functional groups. Friedrich Wöhler was the first scientist who designed the synthesis of an organic compound, urea from inorganic starting materials silver cyanate with ammonium chloride via a simple, one-step synthesis.