A voltaic cell is constructed in which the anode is a Sn | Sn2+ half cell and the cathode is a CI | Cl₂ half cell.The half-cell compartments are connected by a salt bridge.(Use the lowest possible coefficients. Be sure to specify states such as (aq) or (s). If a box is not needed,leave it blank.)The anode reaction is:+The cathode reaction is:+The net cell reaction is:+In the salt bridge, anions migrateIn the external circuit, electrons migrate→+→The cathode reaction is:Sn²+ (aq) + 2Cr(s) 3Sn(s) + 2Cr³+ (aq)he anode reaction is:+voltaic cell is constructed in which the following cell reaction occurs. The half-cell compartments areonnected by a salt bridge.→In the salt bridge, anions migrate+n the external circuit, electrons migrate+the CI | Cl₂ compartmentthe Sn|Sn²+ electrode++the Cr| Cr³+ electrodethe CI | Cl₂ electrode.the Cr| Cr³+ compartmentthe Sn | Sn²+ compartment.the Sn|Sn²+ electrode.the Sn|Sn²+ compartment.Di

Note: As per the guidelines, solution of first question has been made. For the expert solution of…

A voltaic cell is constructed in which the anode is a Sn | Sn²+ half cell and the cathode is a CI | Cl₂ half cell. The half-cell compartments are connected by a salt bridge. (Use the lowest possible coefficients. Be sure to specify states such as (aq) or (s). If a box is not needed, leave it blank.) The anode reaction is: + The cathode reaction is: + The net cell reaction is: + 1 コーロ In the salt bridge, anions migrate - In the external circuit, electrons migrate + + + the Sn | Sn²+ electrode the CII Cl₂ compartment the CI | Cl₂ electrode. the Sn|Sn²+ compartment.

A voltaic cell is constructed in which the anode is a Sn | Sn²+ half cell and the cathode is a CI | Cl₂ half cell. The half-cell compartments are connected by a salt bridge. (Use the lowest possible coefficients. Be sure to specify states such as (aq) or (s). If a box is not needed, leave it blank.) The anode reaction is: + The cathode reaction is: + The net cell reaction is: + 1 コーロ In the salt bridge, anions migrate - In the external circuit, electrons migrate + + + the Sn | Sn²+ electrode the CII Cl₂ compartment the CI | Cl₂ electrode. the Sn|Sn²+ compartment.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.
The half cells Sn2+(aq) |Sn(s) and Cl2(g) |Cl(aq) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ______ electrode to the ____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the _____ half-cell.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.