A container has 800.0 mL of an aqueous solution containing Cl ions. How many grams of CI ions are in the solution if the molarity is 0.326 M? g

Q: Calculate the mass change in grams bf the copper and nickel electrodes. mass change of copper…

A:

Q: synthesis could take more than one step. OH OCH3 1. OH 2. Predicting the expected major product.…

A: The question is based on the concept of organic reaction   We have to convert the reactant into…

Q: 1.Represent in the conventional manner, i.e., anode/cathode, the voltaic cell in which each of the…

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Thought Questions NOTE: Answer the following questions before the lab. The grade of these questions…

A: A question based on qualitative analysis, which is to be accomplished.

Q: 2. Do your observations support the principle that mass is conserved in a chemical reaction, that…

A: “Since you have asked multiple question, we will solve the first (Q2) question for you. If you want…

Q: Volume of N2OH pH added (ml) 1.00 1.22 1.48 1.85 2.18 2.89 3. 20 3.50 3.90 10 20 30 35 39 39.50…

A: The question is based on the concept of titrations. we are writing a strong acid with a strong base.…

Q: Using the given information from 1 through 6 and question 8, I need questions 7, 9, 10, 11, and 12

A: we are given: mass of Zn used = 1.02 g  Volume of gas collected = 393 mL * (1L/1000 mL) = 0.393 L…

Q: Br H₂C H H₂C Br Br. A D G CH₂ H,C. Br B CH₂ E Br CH₂ H Br. H₂C .. CH₂ F Br Br CH₂ To answer it…

A: To find out the most stable conformation of the given substituted cyclohexane first we shall draw…

Q: D. Solve the following. Show your solutions. Attach a plcture of your solution after each number.…

A:

Q: 1. Describe : Short range order, no order and long range order of arrangements 2. Give 2 example of…

A:

Q: I Review I Constants I Periodic Table Using mass measurements, early chemists were able to determine…

A: Part A Given: volume of water = 2 kg i.e mass of water = 2 kg = 2000 g

Q: When forming a bond, which ion will aluminum form? A. -5 ion B. 3 ion C. +3 ion D. +5 ion Which…

A: Question 6  Correct Option :   C.  +3 ion Atomic number of aluminium is 13.  Electronic…

Q: In this assignment, you will write and balance a chemical equation. Then, you will use a table of…

A: Understanding the kinetics of chemical processes is critical to unravelling the secrets of the…

Q: 1. NaOH 2. CH3CH,CH,Br 3. НСI, Н2О 4. NaOH N-H CH3CH2OH, HCI OCH3

A: Introduction : As per company norms we cannot answer more than three subparts .So, I have answered…

Q: a. Write the balanced net ionic equation for the reaction of chromium(III) nitrate with sodium…

A: To write the net ionic equation for the reaction of chromium (III) nitrate with sodium hydroxide to…

Q: 9. Which of the following solutions for a weak acid at equilibrium would have the largest pH? b. 3.2…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: A new element was found to have an 8p4 level in its electronic configuration. What can be said about…

A: Yes, the answer is correct. When an element has unpaired electron in its configuration then it shows…

Q: 3a. Write the structure of 2-bromobutane. 3b. Write the product of the substitution reaction between…

A:

Q: During a strenuous workout, an athlete generates 2210 kJ of heat energy. What mass of water would…

A: Q = nΔHvap   where Q is the heat dissipated by the systemn is moles of the compoundΔHvap is the heat…

Q: Sn Zn H₂O 0.213 0.387 4.186 5. If you have 50.0 g samples of each of the various metals and water,…

A:

Q: ) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction…

A: Given : We have to write complete balance redox reaction.

Q: Determine the oxidation numbers of each of the elements in the following reaction, and identify…

A: Oxidation is the loss of electrons or an increase in the oxidation state of an atom, an ion, or of…

Q: 27. Explain why in this reaction an increase in temperature does not cause a different product to…

A: Resonance  occurs at high Temperature  due to which the Resulting Product is same as given Product.

Q: Question 4: What is the relationship between these two molecules? H Me "Br Et i A) Identical B)…

A:

Q: In the formula 2NH4, identify the following: Number or elements Number of Nitrogen atoms

A: In 2NH4 molecule

Q: Tamiflu HN NH₂ 2. Identify the geometry relative to each atom that is attached to 2 or more atoms.…

A: You have to remember that in the given structure, carbon-carbon bonds are shown like this At every…

Q: Using the balanced chemical equation of the previous question, if you start with 0.500 moles of Na…

A: we have to calculate the moles of NaF formed

Q: How many moles of aluminum are required to c

A:

Q: A heat engine operates on a Carnot cycle. In this cycles, it absorbs 360J of energy while it expands…

A: Efficiency of a carnot engine given as (Q1–Q2)/Q1 = (Th—Tc)/Th Where Q1= heat of source Q2 =Heat of…

Q: Draw the stereoisomers for the compound CICH2CH2CHBrCH2C(OH)=CHC(CH3)3. Label the chiral centre with…

A: Given:-     We know that total stereoisomers is given as  = 2n  where n = number of stereocenter.…

Q: se solve for questions 1-8 using th

A: Answer 1: Mass of potassium bicarbonate is obtained by subtracting the mass of evaporating dish from…

Q: 1. The reaction P,010 (5) and PCIS (9) yields C13PO) as the only product. a. Write the chemical…

A: Note : As per our guidelines we are supposed to answer first 3 parts please resubmit the other parts…

Q: Blank 1 is a cheap material used to create buildings, bridges, and other massive constructions.…

A: Concrete consists of mixture of aggregates i.e.sand , gravel, portland cement water.

Q: 2. Predict and explain your prediction briefly, using resonance structures, whether…

A:

Q: Consider the reaction scheme shown below. Apply the steps outlined in Parts 1 and 2 to decide which…

A: Step 1: Ask if competition is feasible?The given substrate is a secondary alkyl halide. Note that in…

Q: How many isomers (include geometric and optical) are there for an octahedral complex where the metal…

A: Given : the molecule is octahedral complex and four different monodentate ligand and one bidentate…

Q: A colored flame is observed when a wire loop with a small sample of a solution containing a metal…

A:

Q: Name the following organic compounds. a) H2C-CH3 ÇH3 b) H3C-C-CH2-CH2-CH CH3 H2C-CH-CH

A: Answer:- This question is answered by using the simple concept of writing the name of the organic…

Q: 4. For each of the following molecules P H mm b0lo ou i) Draw the Lewis dot structure with 3D shape…

A: Answers are explained below.

Q: I need  answer step by step

A: Step 1:, Step 2: Step 3: Step 4:

Q: 1. Using the graphs of the food dyes created from your data, use the Imax to determine the amount of…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Fill in the missing part of this equation. ((-16 × 10 ² - -) 0 - ¹ - / x cm m

A: Answer: This question is based on unit conversion where we have to use the relation between cm3 and…

Q: Justify your answer with calculations of partial charges on these amino acid side chains at pH =…

A: Answer part (c) only

Q: Baking soda, NaHCO3, acts like a base because water loses a proton to

A: A substance which accepts proton from the other compound is called a Bronsted base

Q: Calculate pH for a weak acid/strong base titration. Determine the pH during the titration of 62.9 mL…

A:

Q: Suppose you need 0.15L of a 0.26M solution of NiCl2, but all you have is a solution that is a…

A: To calculate the volume of given solution needed , we would uae dilution law of solution .

Q: Draw the main organic products of the reaction. Indicate the stereochemistry, including all hydrogen…

A:

Q: Questions 2. What is an indicator? What is the purpose of an indicator blank? 3. What is the Mohr…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: : the limiting reactant co

A:

Q: 1. Place an asterisk by each stereocenter in the molecules depicted below. Note that if this were an…

A: