A certain metal is used in catalytic converters to reduce harmful emissions from vehicles. A 12.55 A current is applied to an M3+ solution for 22.41 minutes. How many moles of M are obtained during the electrolysis? [?] mol M Round only at the end and use appropriate significant figures.

A certain metal is used in catalytic converters to reduce harmful emissions from vehicles. A 12.55 A current is applied to an M3+ solution for 22.41 minutes. How many moles of M are obtained during the electrolysis? [?] mol M Round only at the end and use appropriate significant figures.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 3P

See similar textbooks

Similar questions

Atomic masses can be determined by electrolysis. In one hour, a current of 0.600 A deposits 2.42 g of a certain metal, M, which is present in solution as M+ ions. What is the atomic mass of the metal?
If a 2.5 A current is run through a circuit for 35 minutes, how many coulombs of charge moved through the circuit?
A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
An active (metal) electrode was found to lose mass as the oxidation-reduction reaction was allowed to proceed. Was the electrode part of the anode or cathode? Explain.
Glucose is the major fuel for most living cells. The oxidative breakdown of glucose by our body to produce energy is called respiration. The reaction for the complete combustion of glucose is C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l) If this combustion reaction could be harnessed as a fuel cell, calculate the theoretical voltage that could be produced at standard conditions. (Hint: Use Gf values from Appendix 4.)
A galvanic cell is constructed in which the overall reactionis Cr2O72(aq)+14H2O+(aq)+6I(aq)2Cr3+(aq)+3I2(s)+21H2O(l) Calculate E for this cell. At pH 0, with [Cr2O72]=1.5M and [I]=0.40M, the cell potential is found to equal 0.87 V. Calculatethe concentration of Cr3+(aq) in the cell.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?