6. Use the balanced chemical reaction and corresponding reaction map tofind how many moles of CaCOs are produced from 85.0 grams of H2O.CaCN2 (s) + 3 H,O (I) → 2 NH3 (g) + CaCO3 (s)Grams ofGramsMillilitersGrams ofCACN,of H20of NH)CaCO,3 mol H2O2 mol NH31 mol CaCO;Moles ofMoles ofMoles ofMoles ofCACN2 (5)1 mol CACN23 mol H;O2 mol NH3H2O (I)NH3 (g)CACO3 (s)1 mol CaCO,100.09 g CaCO0.000045 mol NH3I milliliterI mol H2O18.02 g H2OI mol CACN292.11 g CaCN2

Molar mass of water = 18.02 g/mol OR Mass of 1 mole of water = 18.02 g Mass of 3 moles of water = (3…

6. Use the balanced chemical reaction and corresponding reaction map to find how many moles of CaCOs are produced from 85.0 grams of H2O. CACN2 (s) + 3 H20 (I) → 2 NH3 (g) + CaC03 (s) Grams of Grams Milliliters Grams of CACN2 of H2O of NH3 CACO, 3 mol H2O 2 mol NH3 1 mol CaCO, Moles of Moles of Moles of Mole 1 mol CaCN, 3 mol H-O 2 mal TET 1 mol CaC 100.09 g CaCOs 0.000045 mol NH3 I milliliter I mol H;0 18.02 g H2O I mol CACN2 92.11 g CaCN2

6. Use the balanced chemical reaction and corresponding reaction map to find how many moles of CaCOs are produced from 85.0 grams of H2O. CACN2 (s) + 3 H20 (I) → 2 NH3 (g) + CaC03 (s) Grams of Grams Milliliters Grams of CACN2 of H2O of NH3 CACO, 3 mol H2O 2 mol NH3 1 mol CaCO, Moles of Moles of Moles of Mole 1 mol CaCN, 3 mol H-O 2 mal TET 1 mol CaC 100.09 g CaCOs 0.000045 mol NH3 I milliliter I mol H;0 18.02 g H2O I mol CACN2 92.11 g CaCN2

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Consider the reaction. 2 Рb's) + O,(g) — 2 PЬО(s) An excess of oxygen reacts with 451.4 g of lead, forming 348.1 g of lead(II) oxide. Calculate the percent yield of the reaction. percent yield: % * TOOLS x10
Combining 0.333 mol Fe, O, with excess carbon produced 12.7 g Fe. Fe,0, + 3C → 2 Fe + 3 CO What is the actual yield of iron in moles? actual yield: mol What is the theoretical yield of iron in moles? theoretical yield: mol What is the percent yield? percent yield: %
SS a. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.255 mol of the first reactant were to react completely. CO₂(g) + 4H₂(g) → CH4 (g) + 2H₂O (1) mol CH₂ mol H₂O b. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.790 mol of the first reactant were to react completely. BaCl₂ (aq) + 2AgNO3(aq) → 2AgCl(s) + Ba(NO3)2 (aq) mol AgCl mol Ba(NO3)2 c. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.815 mol of the first reactant were to react completely. C3H8 (9)+502(g) → 4H₂O(1) + 3CO2(g) mol H₂O mol CO2 Submit Answer Retry Entire Group Show Hint 9 more group attempts remaining 19 Previous Next
What is the theoretical yield of water (in grams) that can be isolated from the reaction of 15.0 g of H2 and 80.0 g of O2? Molec. Wt. H2 = 2.016 g/mol , Molec Wt O2 = 32.00 g / mol, Molec Wt. H2O = 18.02 g/mol O2 + 2H2 → 2H2O
Use 1 decimal point for all atomic masses. 12.3 g of NCl3(g) are reacted with 0.605 g of H2(g) by the following reaction NCl3(g) + 3H2(g) --> NH3(g) + 3HCl(g) What is the limiting reagent? NCl3(g) H2(g) Based on the limiting reagent, what should the yield of NH3(g) be? g
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
Given the reaction CH 4 + 2O 2 ----------> 2H 2O + CO 2 which statement is FALSE? 16 g O2 reacts to form 18 g H2O 16 g CH4 combines with 64 g O2 1 mol CO2 is formed from 2 mol O2 1 mol CH4 reacts to form 2 mol H2O 18 g H2O is produced from 1 mol O2
How many moles of iron (Fe) will be produced from 6.20 moles of carbon monoxide (CO) reacting with excess iron (III) oxide (Fe₂O 23)? Fe₂O3 + 3C0→2Fe +3CO₂ A 4.13 mol Fe 00 B C 28.01 mol Fe 3.14 mol Fe 2.68 mol Fe
For the following unbalanced reaction, suppose exactly 5.85 g of each reactant is taken. Determine which reactant is limiting, and also determine what mass of the excess reagent will remain after the limiting reactant is consumed. NaCl(s) + H₂SO4 (1) → HCl(g) + Na2SO4(s) Limiting reactant: Mass of excess reagent = g
Use only 1 decimal point for the atomic masses. Determine the yield (amount of product) of HCl if 32.5 g of NH4Cl decomposes by the following reaction: NH4Cl(s)-->NH3(g)+HCl(g)
a. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.642 mol of the first reactant were to react completely. CO₂(g) + 4H₂(g) → CH4 (9) + 2H₂O(1) mol CH4 mol H₂O b. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.622 mol of the first reactant were to react completely. BaCl₂ (aq) + 2AgNO3(aq) → 2AgCl(s) + Ba(NO3)2 (aq) mol AgCl mol Ba(NO3)2 c. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.618 mol of the first reactant were to react completely. C3H8 (g) + 5O2(g) → 4H₂O(1) + 3CO₂ (9) mol H₂O mol CO₂
For the reaction below, balance the chemical equation and then calculate how many grams of NH3 form when each amount of reactant completely reacts. N2H4 (l) → NH3 (g) + N2 (g) a. 5.3 mol N2H4 b. 32.5 g N2H4 c. 14.7 kg N2H4