4. Sketch and label an energy diagram for the following: E,-45 kJ, E₁=5kJ, Ep=25kJ, AH=_

Q: C6H12O6(s)→C3H6O3(s)+C2H5OH(l)+CO2(g) Calculate  ΔH∘rxn

A: Given, C6H12O6(s) → C3H6O3(s) + C2H5OH(l) + CO2(g) Standard enthalpy of the reaction (∆H°rxn) = ?…

Q: In the 1980s, there was an international agreement to destroy all stockpiles of mustard gas,…

A:

Q: Саф) + % 02 (2) CO2 (2) CACO3 (») Given the following set of reactions: Cao + CaOo ΔΗ = -635

A: Given : We have to calculate the enthalpy change for the given reaction.

Q: TRUE OR FALSE a. It requires more energy to break N-N bond (N2O4) than to break the N-N bond in N2…

A: The strength of the bonds depends upon their bond energy . As the number of electron pairs increase…

Q: H2O

A: 3C (graphite) + 3O2 (g) ------> 3CO2 (g)​​.....(d)  ∆Hb = 3 • ( -393.5 kJ )  ∆Hb = -1180.5 kJ

Q: Calculate ΔH° for the combustion of methane. CH4 (g) + 2 O2 (g) → CO2 (g) + 2 H2O (g) Given the…

A: We have to calculate the ∆H° for Reaction.

Q: Given the following combustion data for three different fuels: CH4 (g), C8H18 (l) and CH3OH (l), CH4…

A: The ratio of energy to the molar mass is known as energy density.

Q: Using the equations N₂ (g) + 3 H₂ (g) → 2 NH₃ (g) ∆H° = -91.8 kJ/mol C(s) + 2 H₂ (g) → CH₄ (g) ∆H° =…

A: Answer:- This question is answered by using the simple concept of Hess Law of constant heat…

Q: 2. Given the following data: CO(g)+H20(g) →CO2(g)+H2(g) AH" (25° C) = -42.0 kJmol-1 Cp (CO) = 26.8 +…

A: The given reaction is CO(g) + H2O(g) →CO2(g) + H2(g) T1=298KT2=1000KH1=-42.0kJ/mol To find: Change…

Q: Calculate ∆H for the reaction: 2H2(g) + 2C (s) + O2(g) → C2H5OH (l) Using the following:…

A:

Q: What is the enthalpy change associated with the reaction of 25.0 g of SO2 in excess oxygen? 2 SO2…

A:

Q: Calculate the ∆H for the reaction: N2O4 + CO → N2O + CO2

A: Given that -  Following Reaction -  N2O4 + CO → N2O + CO2  After balancing it can be written as -…

Q: Using the bond energies below, estimate ΔH (in ) for the reaction C2H4(g) + 3O2(g) → 2CO2(g) +…

A: Thermodynamics is the branch of chemistry that mainly deals with the heat transfer between system…

Q: 1. Calculate AH for the reaction: C2H4 (g) + H2 (g) ing data. a. C2H4 (g) + 3 02 (g) → 2 CO2 (g) + 2…

A:

Q: AU = C2₂H5OH +302 (g) →3H₂O -1373 kJ/mol at 298K. Calculate AH°. (9) +2CO2 (g)

A: To calculate ΔH° for the given reaction, we can use the relationship between enthalpy change (ΔH°),…

Q: Given the following combustion data for three different fuels: CH4 (g), C8H18 (l) and CH3OH (l),…

A: For fuel CH4 energy per gram is  CH4 (g) + 2 O2 (g) → CO2 (g) + 2 H2O (l) ΔH° = −890 kJenergy per…

Q: Using the equations N₂ (g) + 3 H₂ (g) → 2 NH₃ (g) ∆H° = -91.8 kJ/mol C(s) + 2 H₂ (g) → CH₄ (g) ∆H°…

A:

Q: Calculate ΔH for the reaction 4 NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (l)

A: ∆H = ∆H1 + ∆H2 + ∆H3 Target equation:-   4 NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (l) ∆H = ?

Q: Mass of cal = 30009 SP of cal .42 5/5°c mass of water. SPW #moles C used #moles H₂ used initial…

A:

Q: 200 160 PE (kJ) 120 80 155 kJ 40 40 kJ 112 kJ 172 kJ Reaction Progress 102 kJ

A:

Q: Calculate ∆H for the reaction 4 NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (g), from the following data.…

A:

Q: Using the equations 2 Sr(s) + O₂ (g) → 2 SrO (s) ∆H° = -1184 kJ/mol SrO (s) + CO₂ (g) → SrCO₃ (s)…

A: The given reactions given are as follows: The required equation is:

Q: For ionization energy, when is it more unfavorable? How does this relate to the ∆H ?

A: Unfavourable ionization energy means greater amount of energy requirements.  This is possible due to…

Q: Using the given bond dissociation energies, calculate AH° xn for the following reaction: 2 H- CI(g)…

A: Given reaction: 2 H-Cl (g) + Br-Br (g) → 2 H-Br (g) + Cl-Cl (g) Given bond energies: H-Cl = 427…

Q: Using the ∆Hfº for SO3(g) and SO2(g) calculate ∆Hº for the following reaction: SO3(g) SO2(g)…

A: • Given               S(s)+32 O2 (g) → SO3(g) , ∆Hf°=-395.2 kJ/mol-…

Q: Use the values of ∆Hfº in Appendix 4 to calculate ∆Hº for the following reactions.

A: ∆H0 = ∆H0product - ∆H0reactant

Q: Use the table below to determine ΔH for the following reaction N 2H 4(g) + H 2O(g) ↔ NH 2OH(g) + NH…

A: Given reaction: N2H 4 (g) + H2O (g) ↔ NH2OH (g) + NH3(g) Bond energies: Bond Energies, kJ/mol…

Q: Using the Heisenberg uncertainty principle, calculate ∆x for each of the following a) An electron…

A: According to Heisenberg uncertainty principle, the relationship between ∆x and ∆v is given by, =>…

Q: Calculate the energy change for the reaction 3C(s) + O2(g) h C3O2(g) from the following: 2CO(g) +…

A: 3C(s)+O2​(g)→C3​O2​(g),ΔH=−95kJ.Explanation:Step 1: According to the question, the energy change or…

Q: Using the following data, estimate AHf° for potassium chloride: K(s) + ½ Cl2(g) → KC(s). Lattice…

A:

Q: H3C-H + 105 A) -25 CI-CI 58 B) +25 hv H3C-CI 85 C) -58 + H-CI 103 D) +2 (kcal/mol) E) -31

A: