4. A sample containing 58.51 g manganese (Mn) is treated with an excessof sulfuric acid (H2SO4) to form manganese sulfate (MNSO4) andmolecular hydrogen (H2). If 81.52% of manganese sulfate was producedexperimentally, calculate the actual yield.

Answered: Image /qna-images/answer/38a1eab5-f57d-4392-a813-32243bff6fd7.jpg

4. A sample containing 58.51 g manganese (Mn) is treated with an excess of sulfuric acid (H2SO4) molecular hydrogen (H2). If 81.52% of manganese sulfate was produced experimentally, calculate the actual yield. form manganese sulfate (MNSO4) and

4. A sample containing 58.51 g manganese (Mn) is treated with an excess of sulfuric acid (H2SO4) molecular hydrogen (H2). If 81.52% of manganese sulfate was produced experimentally, calculate the actual yield. form manganese sulfate (MNSO4) and

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section: Chapter Questions

Problem 144QRT

See similar textbooks

Similar questions

Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?