Answered: 36. Which of these formulas is(are) not…

36. Which of these formulas is(are) not valid for hexane? A. CH14 B. C6H6 C. C6H16 D. CH3CH2CH2CH2CH2CH3 E. CH3(CH2).CH3

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter22: Organic And Biological Molecules

Section: Chapter Questions

Problem 118E

See similar textbooks

Similar questions

The addition of four identical monomer molecules produces the naturally occurring molecule shown below. H₂C H₂C H₂C CH CH₂ CH₂ CH₂ HC CH₂ CH₂ CH₂ CH₂ CH₂ CH What could be the structural formula of the monomer? A. CH2=C(CH3)CH2CH3 B. CH3CH=CHCH=CH₂ C. CH3CH₂CH₂CH=CH2 D. CH2=C(CH3)CH=CH2 CH,
Which of these formulas is(are) not valid for octane? A. C8H18B. C8H20C. C8H16D. CH3CH2CH2CH2CH2CH2CH2CH3E. CH3(CH2)6 CH3
1 Which of the following has(have) the same molecular formula as hexane? A. 3-ethylpentane B. 2,4-dimethylpentane C. 3,3-dimethylpentane D. 2,3-dimethylpentane E. 2,3-dimethylbutane 1b. Which of these formulas is(are) not theoretically possible? A. C6H6 B. C6H10 C. C6H12 D. C6H14 E. C6H16 1c. Which of these formulas is(are) not valid for hexane? A. C6H14 B. C6H6C. C6H16D. CH3CH2CH2CH2CH2CH3 E. CH3(CH2)4CH3
4 1. Which of the following are considered organic compounds? Circle all that apply. A. CO₂ F. CH3(CH2)3COOH B. CH4 G. CaCO3 C. CH2O H. C₂H5OH or this molecule? the main late D. HCOOH I. C10H20 E. HNO3 J. CsH explanation (2-3 tences) 2. From the above list of compounds, state the ones that are hydrocarbons. If none, write "None" as your answer for credit. pounds commonly referred to as organic familles, erns. These include: aromatics, enes, of these is/are considered to be explanation for your answer. 3. Draw the Lewis-dot structure for C4H10 below. to be alkane Provide an planation for your A. What is the main intermolecular force acting on this molecule? B. Is this molecule polar or nonpolar? Provide a brief explanation (2-3 sentences) for your answer. Draw the Louis
(Picture attached) Functional Groups: 1. Benzene 2. Halogen 3. Carboxyl 4. Hydroxyl Identify the functional groups that the 2 molecules contain. Note: each functional group can be used more than once. Put in numerical order with no space. Sucarlose = Ibuprofen =
16. Draw and name at least 4 structural isomers of C5H10O2. Be sure to include at least 2 different functional groups.
2. Identify the functional groups labelled A-I. HO, CO2H HOʻ но. HO, CO2H A HO H „CH3 H3č „CH3 H H3C° но E F Zocor (Merck) Pravachol (Bristol-Myers Squibb) Lipitor (Pfizer) FUNCTIONAL GROUPS A. В. C. D. Е. F. G. Н. I.
What is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3
Isomers that all have the composition C5H12 are a. pentane, cyclopentane, methylcyclobutane b. 2-methylbutane, pentane, 2,2-dimethylpropane c. pentane, 2-methylpentane, 3-methylpentane d. 2,2-dimethylpropane, cyclopentane, 2,2-dimethylbutane
1. Which of the following condensed structures is 2-hexanol? a. CH3CHOHCH2CH2CH2CH3 b. CH3CH2CH2CH2COCH3 C. CH3CHCHCH2CH2CH3 d. CH3CH2CH2CH2CH2CHO e. CH3CH2CH2CH2CH2CH2OH 2. Which of the following condensed structures is 2-hexanone? a. CH3CH2CH2CH2CH2CH2OH b. CH3CH2CH2CH2CH2CH3 C. CH3CHCHCH2CH2CH3 d. CH3CH2CH2CH2CH2CHO e. CH3CH2CH2CH2COCH3 3. How many structural isomers of heptane exist a. 1 b. 3 c. 6 d. 9 e. 10 4. The general formula for an alkyne is a. CnH2n b. CnH2n-2 C. CnH2n+2 d. CnHn e. C2nHn 5. The smallest alkene that requires a numbered position for the double bond when naming the compound is: a. methene b. ethene c. propene d. butene
4. Which of the following has isomeric forms?a. C2H3Clb. C2H5Clc. C2HCld. C2H4Cl2 5. Which of the following hydrocarbons always gives the same product when one of its hydrogen atoms is replaced by a chlorine atom.a. Hexaneb. Hex-1-enec. Cyclohexaned. Cyclohexene
Please answer both questions