Answered: 33. In the given net redox equation of…

33. In the given net redox equation of E- = + 1.89 V. The standard reduction potential for Co is - 0.28V. What is the standard reduction potential for Ce to Ce? 2Ce + Co → 2Ce" + Co

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 61QAP

See similar textbooks

Similar questions

A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For the standard cell potentials given here, determine the ?G for the cell in k].. (a) 0.000V,n=2 (b) +0.434V,n=2 (c) -2.439 V, n = 1