2SO2(g) + O2(g)=2SO3(g) Kp = 0.355 at 950 K A 2.75- L reaction vessel at 950K initially contains 0.100 mol of SO2 and 0.100 mol of O2 . Part A Calculate the total pressure (in atmospheres) in the reaction vessel when equilibrium is reached.

2SO2(g) + O2(g)=2SO3(g) Kp = 0.355 at 950 K A 2.75- L reaction vessel at 950K initially contains 0.100 mol of SO2 and 0.100 mol of O2 . Part A Calculate the total pressure (in atmospheres) in the reaction vessel when equilibrium is reached.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 55QRT

See similar textbooks

Similar questions

For the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
Kc for the decomposition of ammonium hydrogen sulfide is 1.8 104 at 25 C. NH4HS(s) NH3(g) + H2S(g) (a) When the pure salt decomposes in a flask, what are the equilibrium concentrations of NH3 and H2S? (b) If NH4HS is placed in a flask already containing 0.020 mol/L of NH3 and then the system is allowed to come to equilibrium, what are the equilibrium concentrations of NH3 and H2S?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
Nitrosyl chloride, NOC1, decomposes to NO and Cl2 at high temperatures. 2 NOCl(g) ⇌ 2 NO(g) + Cl2(g) Suppose you place 2.00 mol NOC1 in a 1.00–L flask, seal it, and raise the temperature to 462 °C. When equilibrium has been established, 0.66 mol NO is present. Calculate the equilibrium constant Kc for the decomposition reaction from these data.
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
For the equilibrium 2 SO2(g) + O2(g) 2 SO3(g) Kc = 245 (at 1000 K) the equilibrium concentrations are [SO2] = 0.102, [O2] = 0.0132, and [SO3] = 0.184. The concentration of SO2 is suddenly doubled. Show that the forward reaction takes place to reach a new equilibrium.
Phosgene, COCl2, used in the manufacture of polyurethane plastics, is prepared from CO and Cl2. CO(g)+Cl2(g)COCl2(g) An equilibrium mixture at 395C contains 0.012 mol CO and 0.025 mol Cl2 per liter, as well as COCl2 If Kc at 395C is 1.23 103, what is the concentration of COCl2?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Dinitrogen tetroxide, N2O4, is a colorless gas (boiling point, 21C), which dissociates to give nitrogen dioxide, NO2 a reddish brown gas. N2O4(g)2NO2(g) The equilibrium constant Kc at 25C is 0.125. What percentage of dinitrogen tetroxidc is dissociated when 0.0400 mol N2O4 is placed in a 1.00-L flask at 25C?