20. Which of the following statements is TRUE? A) Entropy is an extensive property. B) Entropy is not temperature dependent. C) Exothermic processes decrease the entropy of the surroundings. D) ASuniverse is always greater than zero for a nonspontaneous process. E) None of the above are true. 21. The change in Gibbs energy of a reaction: A) = work B) predicts speed C) = AH+TAS D) depends on the standard state chosen E) tells us if the reaction is spontaneous or not

20. Which of the following statements is TRUE? A) Entropy is an extensive property. B) Entropy is not temperature dependent. C) Exothermic processes decrease the entropy of the surroundings. D) ASuniverse is always greater than zero for a nonspontaneous process. E) None of the above are true. 21. The change in Gibbs energy of a reaction: A) = work B) predicts speed C) = AH+TAS D) depends on the standard state chosen E) tells us if the reaction is spontaneous or not

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 2RQ: What is the second law of thermodynamics? For any process, there are four possible sign combinations...

See similar textbooks

Similar questions

What is entropy? Why is entropy important?
For one day, keep a log of all the activities you undertake that consume Gibbs free energy. Distinguish betweenGibbs free energy provided by nutrient metabolism andthat provided by other energy resources.
Define the following: a. spontaneous process b. entropy c. positional probability d. system e. surroundings f. universe
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
Explain why absolute entropies can be measured.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
Which contains greater entropy, a quantity of frozen benzene or the same quantity of liquid benzene at the same temperature? Explain in terms of the dispersal of energy in the substance.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
A key component in many chemical engineering designs is the separation of mixtures of chemicals. (a) What happens to the entropy of the system when a chemical mixture is separated? (b) Are designs for chemical separation more likely to rely on spontaneous or nonspontaneous processes?
Given the following information at 25C, calculate G at 25C for the reaction 2A(g)+B(g)3C(g) Substance Hf(kJ/mol) S(J/molK) A(g) 191 244 B(g) 70.8 300 C(g) 197 164 a 956 kJ b 956 kJ c 346 kJ d 346 kJ e 1.03 103 kJ
Consider the reaction of 2 mol H2(g) at 25C and 1 atm with 1 mol O2(g) at the same temperature and pressure to produce liquid water at these conditions. If this reaction is run in a controlled way to generate work, what is the maximum useful work that can be obtained? How much entropy is produced in this case?