2. Silver metal reacts with sulfur to form silver sulfide according to the following reaction: 2Ag (s) + S(s) → Ag,S (s) a. Identify the limiting reagent if 50.0 g Ag reacts with 10.0 g S. b. What is the theoretical yield in g of Ag2S produced from the reaction? C. What is the amount in g of the excess reactant expected to remain after the reaction? d. When the reaction occurred, the amount of Ag2S obtained was 45.0 g. What is the percent yield of the reaction? the reaction of 77.0 grams of of NH3, what is the percent yield? 3. For the balanced equation shown below, CACN2 produces 27.1 grams CACN2 + 3H20 CaCO3 + 2NH3

2. Silver metal reacts with sulfur to form silver sulfide according to the following reaction: 2Ag (s) + S(s) → Ag,S (s) a. Identify the limiting reagent if 50.0 g Ag reacts with 10.0 g S. b. What is the theoretical yield in g of Ag2S produced from the reaction? C. What is the amount in g of the excess reactant expected to remain after the reaction? d. When the reaction occurred, the amount of Ag2S obtained was 45.0 g. What is the percent yield of the reaction? the reaction of 77.0 grams of of NH3, what is the percent yield? 3. For the balanced equation shown below, CACN2 produces 27.1 grams CACN2 + 3H20 CaCO3 + 2NH3

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

In the reaction of 28 g NO2and 18 g H2O by the chemical equation: NO2 (g) + H2O (1) → HNO3 (1) + N0 (g) a- Balanced the reaction equation. b- Calculate the moles of given reactants. c- Calculate the moles of product, HNO3. Solve it on a sheet d- Calculate the mass of HNO3 formed in grams. e- Which of the reactants is the limiting reagent? N=14g/ mol. O = 16g/mol,H=1 gmol. wwww
22. The combustion of hexane (C,H14), a component of gasoline, is represented by the balanced chemical equation: 2 C6H14() + 19 O2(g) ® 12 CO2(g) + 14 H20(g). If 1.0 mole of hexane undergoes moles of O2 are required. combustion, a. 19 moles b. 7 moles C. 9.5 moles d. 26 moles e. 21 moles a O b O c e
10. Balance the equation for the combustion of butane, C,H,. C.H10 + O, > со, + H2O a. If 31.4 grams of butane burn according to this reaction, how many grams of oxygen would you need to ensure all the butane burned? (112 g O,)
A 3.82-g sample of magnesium nitride is reacted with 7.73 g of water. Mg3N2 + 3H2O → 2NH3 + 3MgO The yield of MgO is 2.04 g. What is the percent yield in the reaction?
Consider the reaction between sodium sulfide and copper(Il) sulfide: NazS (aq) + CuS04 (aq) -> Na2SO4(aq) + CuS (s) A chemist allows 16.7 g of Na,S and 35.0 g of CUSO, to react. Determine the theoretical yield of NazSO4 for the reaction. 31.1 20.5 30.4 O 21.0
Consider the reaction between ammonium and oxygen: 4 NH3 () + 5 02 ()> 4 NO ) + 6 H20 (m A chemist allows 6.20 g of NH3 and 16.6 g of O2 to react. Determine the theoretical yield of NO for the reaction. 12.5 9.83 10.9 O 11.2
Consider the generic chemical equation: 2 A + 4 B --------> 3 C 1. If 10.0 moles of each reactant were used to complete that reaction, which of the following is true. a. A is the limiting reactant and 15.0 moles of C will be produced. b. A is the limiting reactant and 20.0 moles of C will be produced. c. B is the limiting reactant and 7.50 moles of C will be produced. d. B is the limiting reactant and 22.5 moles of C will be produced. 2. What is the percent yield of this reaction if 6.40 moles of C were actually produced?
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
6. The gaseous hydrocarbon acetylene (C2H2) used in welders' torches, burns according to the following equation: 2C2H2(g) + 502(g)→ 4CO2(g) + 2H2O(g) a. What is the theoretical yield, in grams, of CO2, if 22.0 g of C2H2 completely reacts? b. If the actual yield in part a is 64.0 g of CO2, what is the percent yield of CO2 for the reaction?
3. Given: NaCl 1 NiCl₂ + 2 NaOH → 1 Ni(OH)₂ + 2 A student combines 2.44 g of NiCl₂ with 6.44 g NaOH. Determine a. The limiting reactant. b. The mass of the excess reactant that remains at the end of the reaction. c. The number of NaCl molecules that are formed if the reaction is 51% efficient.
Sodium and chlorine react to form sodium chloride: What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl
a. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.642 mol of the first reactant were to react completely. CO₂(g) + 4H₂(g) → CH4 (9) + 2H₂O(1) mol CH4 mol H₂O b. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.622 mol of the first reactant were to react completely. BaCl₂ (aq) + 2AgNO3(aq) → 2AgCl(s) + Ba(NO3)2 (aq) mol AgCl mol Ba(NO3)2 c. For the following balanced chemical equation, calculate how many moles of products would be produced if 0.618 mol of the first reactant were to react completely. C3H8 (g) + 5O2(g) → 4H₂O(1) + 3CO₂ (9) mol H₂O mol CO₂