+S → Na₂S(this is a balanced equation)a. We have 10 moles of of Na. How many moles of S do we need toreact with the 10 moles of Na ?2. 2Nab. Using the data from part a, how many moles of Na₂S should we getfrom this reaction?c. What would be the weight in grams of the moles of Na₂S from part b?

Answer:- This question is answered by using the simple concept of stoichiometry which involves the…

2. 2Na +S → Na₂S (this is a balanced equation) a. We have 10 moles of of Na. How many moles of S do we need to react with the 10 moles of Na? b. Using the data from part a, how many moles of Na2S should we get from this reaction? c. What would be the weight in grams of the moles of Na₂S from part b?

2. 2Na +S → Na₂S (this is a balanced equation) a. We have 10 moles of of Na. How many moles of S do we need to react with the 10 moles of Na? b. Using the data from part a, how many moles of Na2S should we get from this reaction? c. What would be the weight in grams of the moles of Na₂S from part b?

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 9QAP: onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to...

See similar textbooks

Similar questions

DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form carbon tetrafluoride and nitrogen trifluoride. C2N2(g)+7F2(g)2CF4(g)+2NF3(g)(a) How many moles of fluorine react with 1.37 mol of cyanogen? (b) How many moles of CF4 are obtained from 13.75 mol of fluorine? (c) How many moles of cyanogen are required to produce 0.8974 mol of NF3? (d) How many moles of fluorine will yield 4.981 mol of nitrogen trifluoride?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.
Consider the following diagram, where atom X is represented by a square and atom Y is represented by a circle. (a) Write the equation for the reaction represented by the diagram. (b) If each circle stands for a mole of Y and each square a mole of X, how many moles of X did one start with? How many moles of Y? (c) Using the same representation described in part (b), how many moles of product are formed? How many moles of X and Y are left unreacted?
Consider the hypothetical reaction between A2 and AB pictured below. What is the balanced equation? lf 2.50 moles of A2 are reacted with excess AB, what amount (moles) of product will form? If the mass of AB is 30.0 u and the mass of A2 are 40.0 u, what is the mass of the product? If 15.0 g of AB is reacted, what mass of A2 is required to react with all of the AB, and what mass of product is formed?
Ammonia reacts with a limited amount of oxygen according to the equation 4NH3(g)+5O2(g)4NO(g)+6H2O(l)(a) How many moles of NO are obtained when 3.914 moles of oxygen are used? (b) How many moles of oxygen are required to react with 2.611 moles of ammonia? (c) How many moles of water are obtained when 0.8144 moles of ammonia are used? (d) How many moles of oxygen are required to produce 0.2179 mol of water?
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?