1. Incompound[Cr(en)2Cla]Cltheligandsthecoordinationthe coordination number isthe donor atomsarearecentral ion is

In the coordination compound [Cr(en)2Cl2]Cl , the central metal atom is Cr and the ligands are…

Answered: 1. In coordination compound…

1. In coordination compound [Cr(en)2Cla]Cl the ligands the the coordination number is the donor atoms are are central ion is

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 5QAP

See similar textbooks

Related questions

Q: 2. Complete the table: Formula [Ni(CO)4] trans-[Ru(H₂O)₂Cl₂]²+ [Re(NH3)2(NO₂)SCN]+…

A: Please find the attachment.

Q: The absorption spectrum of the complex ion [Co(NH3)6]3+ has strongly absorbs blue light at a…

Q: How many ligands are present in [Co(NH3)4Cl2)]Cl?

A: A ligand represents an ion as well as molecule that connects to central metal atom to establish a…

Q: An example of a coordination compound is [IrCIBr(en)2]Br. What is the oxidation state of the iridium…

Q: In [Cu(NH3)4]SO4.H2O, what is the type of the ligand, the coordination number, and the geometry?

Q: Coordination Chemistry 1. a) In the complex ion [Ni(CN)4I]^3-, the coordination number of nickel is?…

A: Coordination chemistry is defined as which we study about coordination complexes. Coordination…

Q: K2[Cu(CN)2Cl2] a.Systematic name b.The coordination number c.The correct hybridization for the…

Q: What is the total number of geometric and optical isomers for [Mn(en)2Br2]*? Note: en = H2NCH2CH2NH2…

A: Geometric isomers are isomers in which the order of atom bonding is the same but the arrangement of…

Q: CN- ion is a strong field ligand whereas Clis usually a weak field ligand. Draw d orbital energy…

Q: What is the color of FeC2O4 and K3[Fe(C2O4)3]·3H2O?

A: Name of. FeC2O4 Ferrous oxalate, or iron(II) oxalate, Preparation of K3[Fe(C2O4)3]·3H2O…

Q: Predict the number of unpaired spins in: - [Cr(en)3 ] 2+ (ethylenediamine is a strong field ligand).…

A: Given, [Cr(en)3]2+ (ethylenediamine is a strong field ligand). And [Mn(H2O)6]2+ (water is a…

Q: The complex [Ni(CN)4]

A: According to VBT ( valance bond theory) sp3d2 and d2sp3 hybridisations complexes are in…

Q: [Co(en)2Cl2]+ construct a model of the coordination compound. Can you construct another model with…

A: Geometrical isomers: These are also known as cis-trans isomers. Another name used for these isomers…

Q: 1. What is the number of unpaired electrons per atom metal in this compound [Fe(en)2Cl2]Cl ?

A: ANSWER: Step 1: The [Fe(en2Cl2] Cl is a low-spin complex because of the bonding with strong-field…

Q: For the complex [Pd(NO)4]Br4, assume NO is a strong ligand, then which statement is true The complex…

A: According to the crystal field theory the ligand atom acts as point negative change and the metal…

Q: Draw d orbital energy diagrams for the following octahedral complexes and determine the number of…

Q: Q3. Calculate the crystal field stabilization energy (in terms of Da) for the complexes:…

A: Applying formula of CFSE =[ x×-0.4+y×0.6]∆° + ZP Where X is no of electrons in t2g Y is no of…

Q: For the octahedral complex ions [Fe(CN)d] and [Fe(H:O)s]" Write the electron configuration in t and…

A: Spectrochemical series A series which consists of ligands in order of their ligand strength is known…

Q: Determine the oxidation state of the metal atom in each of the following complex ions.

Q: The oxidation state of the metal atom is metal atom is in the complex: and the coordination number…

A: Given complex: To determine:1) Oxidation state of metal atom2) Cordination number of metal atom

Q: How many geometric isomers does the octahedral coordination compound[Co(NH3)3Cl3] have?

A: Geometrical Isomerism in heteroleptic complexes due to different possible three dimensional spatial…

Q: Write the names of [Co(NH3)4CO3] (NO3) and [Cr(NH3)5Cl] Cl2 .

A: We have to write the names of [Co(NH3)4CO3] (NO3) and [Cr(NH3)5Cl] Cl2 .

Q: The octahedral complex ions [FeCl6]3- and [Fe(CN)6]3- are both paramagnetic, but the former is high…

A: Both the octahedral complex ions [FeCl6]3- and [Fe(CN)63- have Fe in +3 oxidation state. The number…

Q: Does [Mn(en)2Brz O Yes, but only w O Yes, when liga O [Mn(en)2B12]l O Yes, but only w

A: Optical active compound do not have any symmetry like plane of symmetry

Q: 5. What is the oxidation state of cobalt in [Co(NH3)3(OH2)2CI]Cl₂?

Q: Consider the following complex ions: [NiBr6]4-,[Ni(H2O)6]3+ and [Ni(CO)6]3+. Using the Crystal Field…

A: Step 1: Electron configuration of Ni+n central metal. The ground state electron configuration of…

Q: From the Lewis structure of NO2-, both N and O having unshared pairs of electrons can bond to metal…

Q: complex [Fe(H2O)6]+2

A: The theory which shows the orbital arrangement, bonding and the characteristics of coordination…

Q: Uses crystal field theory (CCT) to predict the number of unpaired electrons in the following…

Q: K2[Cu(CN)2Cl2] a. Systematic name or formula b. The coordination number c. The possible geometry…

A: As per our guidelines, I can answer only first three sub-parts. Because you have posted multiple…

Q: ng is true?

Q: Solutions of [Co(NH3)6]2+, [Co(H2O)6]2+ (both octahedral), and [CoCl4]2- (tetrahedral) are colored.…

A: A coordination complex consists of a central atom or ion , which usually metallic and is surrounded…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

1. In
compound
[Cr(en)2Cla]Cl
the
ligands
the
coordination
the coordination number is
the donor atoms
are
are
central ion is

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Predict whether the carbonate ligand CO32- will coordinate to a metal center as a monodentate, bidentate, or tridentate ligand.
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O
What is the most likely molecular geometry of the complex [Fe(en)2CI2]* ? O trigonal planar O octahedral O tetrahedral or square planar O linear O bent
10) What is a representative orbital-filling diagram for the cobalt ion in the low spin complex of [Co(CN)6]3-? (A) ↑L_TL TL - - 3d 4.s 4p 4d 3d 4s 4p 4d - 3d 4s 4p 4d - | |
The spectrochemical series is I< Br¯< Cl